1-benzhydryl-4-(5,5-diphenylpentyl)piperazine

ID: ALA1081175

PubChem CID: 46879886

Max Phase: Preclinical

Molecular Formula: C34H38N2

Molecular Weight: 474.69

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1ccc(C(CCCCN2CCN(C(c3ccccc3)c3ccccc3)CC2)c2ccccc2)cc1

Standard InChI:  InChI=1S/C34H38N2/c1-5-15-29(16-6-1)33(30-17-7-2-8-18-30)23-13-14-24-35-25-27-36(28-26-35)34(31-19-9-3-10-20-31)32-21-11-4-12-22-32/h1-12,15-22,33-34H,13-14,23-28H2

Standard InChI Key:  MSMMXPDNAAWHBC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   -2.5875  -13.1208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7625  -13.1208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3523  -12.4103    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7625  -11.6952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5875  -11.6952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0023  -12.4103    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8273  -12.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2408  -11.6976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2388  -13.1265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8264  -10.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2392  -10.2715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0651  -10.2722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4764  -10.9923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0613  -11.7027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0634  -13.1261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4748  -13.8404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0612  -14.5552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2320  -14.5514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8243  -13.8366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5273  -12.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1158  -13.1265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7092  -13.1276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1227  -12.4137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9477  -12.4149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3592  -13.1299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3612  -11.7010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9424  -13.8423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3532  -14.5568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1791  -14.5584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5924  -13.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1792  -13.1279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1863  -11.7036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5997  -10.9905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1882  -10.2745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3589  -10.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9492  -10.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  6  1  0
 17 18  1  0
  7  9  1  0
 18 19  2  0
 19  9  1  0
  2  3  1  0
  3 20  1  0
  8 10  2  0
 20 21  1  0
  3  4  1  0
 21 22  1  0
 10 11  1  0
 22 23  1  0
  4  5  1  0
 23 24  1  0
 11 12  2  0
 24 25  1  0
  5  6  1  0
 24 26  1  0
 12 13  1  0
 25 27  2  0
 27 28  1  0
 13 14  2  0
 28 29  2  0
 14  8  1  0
 29 30  1  0
  6  7  1  0
 30 31  2  0
 31 25  1  0
  9 15  2  0
 26 32  2  0
  1  2  1  0
 32 33  1  0
 15 16  1  0
 33 34  2  0
  7  8  1  0
 34 35  1  0
 16 17  2  0
 35 36  2  0
 36 26  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Cacna2d1 Voltage-dependent L-type calcium channel subunit beta-1/alpha-1B/alpha-2/delta-1 (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 474.69Molecular Weight (Monoisotopic): 474.3035AlogP: 7.40#Rotatable Bonds: 10
Polar Surface Area: 6.48Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.42CX LogP: 8.31CX LogD: 7.26
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.22Np Likeness Score: -0.61

References

1. Zamponi GW, Feng ZP, Zhang L, Pajouhesh H, Ding Y, Belardetti F, Pajouhesh H, Dolphin D, Mitscher LA, Snutch TP..  (2009)  Scaffold-based design and synthesis of potent N-type calcium channel blockers.,  19  (22): [PMID:19815411] [10.1016/j.bmcl.2009.09.008]

Source