The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-benzhydryl-4-(6,6-diphenylhexyl)piperazine ID: ALA1081176
PubChem CID: 46879887
Max Phase: Preclinical
Molecular Formula: C35H40N2
Molecular Weight: 488.72
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: c1ccc(C(CCCCCN2CCN(C(c3ccccc3)c3ccccc3)CC2)c2ccccc2)cc1
Standard InChI: InChI=1S/C35H40N2/c1-6-16-30(17-7-1)34(31-18-8-2-9-19-31)24-14-5-15-25-36-26-28-37(29-27-36)35(32-20-10-3-11-21-32)33-22-12-4-13-23-33/h1-4,6-13,16-23,34-35H,5,14-15,24-29H2
Standard InChI Key: PIRRXQFOIGSAFB-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
8.3875 -13.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2125 -13.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6227 -12.8311 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2125 -12.1161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3875 -12.1161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9727 -12.8311 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1477 -12.8323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7342 -12.1184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7362 -13.5473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1486 -11.4057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7358 -10.6923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9099 -10.6930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4986 -11.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9137 -12.1236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9116 -13.5470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5002 -14.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9138 -14.9761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7430 -14.9723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1507 -14.2575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4477 -12.8323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8592 -13.5473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6842 -13.5485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0977 -12.8346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9227 -12.8357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3362 -12.1218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1612 -12.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9247 -11.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5709 -12.8378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3951 -12.8393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8095 -12.1249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3935 -11.4075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5706 -11.4095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3396 -10.6954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9287 -9.9809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1029 -9.9793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6895 -10.6982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1027 -11.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17 18 1 0
7 9 1 0
18 19 2 0
19 9 1 0
2 3 1 0
3 20 1 0
8 10 2 0
20 21 1 0
3 4 1 0
21 22 1 0
10 11 1 0
22 23 1 0
4 5 1 0
23 24 1 0
11 12 2 0
24 25 1 0
5 6 1 0
25 26 1 0
12 13 1 0
25 27 1 0
26 28 2 0
13 14 2 0
28 29 1 0
14 8 1 0
29 30 2 0
6 7 1 0
30 31 1 0
9 15 2 0
31 32 2 0
32 26 1 0
1 2 1 0
27 33 2 0
15 16 1 0
33 34 1 0
7 8 1 0
34 35 2 0
16 17 2 0
35 36 1 0
1 6 1 0
36 37 2 0
37 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.72Molecular Weight (Monoisotopic): 488.3191AlogP: 7.79#Rotatable Bonds: 11Polar Surface Area: 6.48Molecular Species: NEUTRALHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.43CX LogP: 8.76CX LogD: 7.69Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.20Np Likeness Score: -0.57
References 1. Zamponi GW, Feng ZP, Zhang L, Pajouhesh H, Ding Y, Belardetti F, Pajouhesh H, Dolphin D, Mitscher LA, Snutch TP.. (2009) Scaffold-based design and synthesis of potent N-type calcium channel blockers., 19 (22): [PMID:19815411 ] [10.1016/j.bmcl.2009.09.008 ]