1-benzhydryl-4-(6,6-diphenylhexyl)piperazine

ID: ALA1081176

PubChem CID: 46879887

Max Phase: Preclinical

Molecular Formula: C35H40N2

Molecular Weight: 488.72

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1ccc(C(CCCCCN2CCN(C(c3ccccc3)c3ccccc3)CC2)c2ccccc2)cc1

Standard InChI:  InChI=1S/C35H40N2/c1-6-16-30(17-7-1)34(31-18-8-2-9-19-31)24-14-5-15-25-36-26-28-37(29-27-36)35(32-20-10-3-11-21-32)33-22-12-4-13-23-33/h1-4,6-13,16-23,34-35H,5,14-15,24-29H2

Standard InChI Key:  PIRRXQFOIGSAFB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    8.3875  -13.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2125  -13.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6227  -12.8311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2125  -12.1161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3875  -12.1161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9727  -12.8311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1477  -12.8323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7342  -12.1184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7362  -13.5473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1486  -11.4057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7358  -10.6923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9099  -10.6930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4986  -11.4131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9137  -12.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9116  -13.5470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5002  -14.2612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9138  -14.9761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7430  -14.9723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1507  -14.2575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4477  -12.8323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8592  -13.5473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6842  -13.5485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0977  -12.8346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9227  -12.8357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3362  -12.1218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1612  -12.1229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9247  -11.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5709  -12.8378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3951  -12.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8095  -12.1249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3935  -11.4075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5706  -11.4095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3396  -10.6954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9287   -9.9809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1029   -9.9793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6895  -10.6982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1027  -11.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 17 18  1  0
  7  9  1  0
 18 19  2  0
 19  9  1  0
  2  3  1  0
  3 20  1  0
  8 10  2  0
 20 21  1  0
  3  4  1  0
 21 22  1  0
 10 11  1  0
 22 23  1  0
  4  5  1  0
 23 24  1  0
 11 12  2  0
 24 25  1  0
  5  6  1  0
 25 26  1  0
 12 13  1  0
 25 27  1  0
 26 28  2  0
 13 14  2  0
 28 29  1  0
 14  8  1  0
 29 30  2  0
  6  7  1  0
 30 31  1  0
  9 15  2  0
 31 32  2  0
 32 26  1  0
  1  2  1  0
 27 33  2  0
 15 16  1  0
 33 34  1  0
  7  8  1  0
 34 35  2  0
 16 17  2  0
 35 36  1  0
  1  6  1  0
 36 37  2  0
 37 27  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Cacna2d1 Voltage-dependent L-type calcium channel subunit beta-1/alpha-1B/alpha-2/delta-1 (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 488.72Molecular Weight (Monoisotopic): 488.3191AlogP: 7.79#Rotatable Bonds: 11
Polar Surface Area: 6.48Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.43CX LogP: 8.76CX LogD: 7.69
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.20Np Likeness Score: -0.57

References

1. Zamponi GW, Feng ZP, Zhang L, Pajouhesh H, Ding Y, Belardetti F, Pajouhesh H, Dolphin D, Mitscher LA, Snutch TP..  (2009)  Scaffold-based design and synthesis of potent N-type calcium channel blockers.,  19  (22): [PMID:19815411] [10.1016/j.bmcl.2009.09.008]

Source