The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-benzhydrylpiperazin-1-yl)-2,2-diphenylethanone ID: ALA1081177
Cas Number: 48230-15-5
PubChem CID: 4059855
Max Phase: Preclinical
Molecular Formula: C31H30N2O
Molecular Weight: 446.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(C(c1ccccc1)c1ccccc1)N1CCN(C(c2ccccc2)c2ccccc2)CC1
Standard InChI: InChI=1S/C31H30N2O/c34-31(29(25-13-5-1-6-14-25)26-15-7-2-8-16-26)33-23-21-32(22-24-33)30(27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-20,29-30H,21-24H2
Standard InChI Key: GNGAFWNGMQIIFB-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-2.0260 -19.4427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2006 -19.4427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7902 -18.7319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2006 -18.0164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0260 -18.0164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4410 -18.7319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2664 -18.7331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6801 -18.0188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6781 -19.4484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2655 -17.3058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6785 -16.5920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5048 -16.5927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9163 -17.3132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5010 -18.0239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5031 -19.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9147 -20.1627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5009 -20.8778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6713 -20.8740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2634 -20.1589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0352 -18.7331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4469 -19.4484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2723 -19.4495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0332 -20.1627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6801 -20.1655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5047 -20.1670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9192 -19.4521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5031 -18.7344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6798 -18.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7903 -20.1589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2039 -20.8722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7922 -21.5886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0375 -21.5871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4474 -20.8731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4489 -18.0188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7 8 1 0
16 17 2 0
1 6 1 0
17 18 1 0
7 9 1 0
18 19 2 0
19 9 1 0
2 3 1 0
3 20 1 0
8 10 2 0
20 21 1 0
3 4 1 0
21 22 1 0
10 11 1 0
21 23 1 0
4 5 1 0
22 24 2 0
11 12 2 0
24 25 1 0
5 6 1 0
25 26 2 0
12 13 1 0
26 27 1 0
27 28 2 0
28 22 1 0
13 14 2 0
23 29 2 0
14 8 1 0
29 30 1 0
6 7 1 0
30 31 2 0
9 15 2 0
31 32 1 0
1 2 1 0
32 33 2 0
33 23 1 0
15 16 1 0
20 34 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.59Molecular Weight (Monoisotopic): 446.2358AlogP: 5.75#Rotatable Bonds: 6Polar Surface Area: 23.55Molecular Species: NEUTRALHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.25CX LogP: 6.28CX LogD: 6.05Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.38Np Likeness Score: -0.80
References 1. Zamponi GW, Feng ZP, Zhang L, Pajouhesh H, Ding Y, Belardetti F, Pajouhesh H, Dolphin D, Mitscher LA, Snutch TP.. (2009) Scaffold-based design and synthesis of potent N-type calcium channel blockers., 19 (22): [PMID:19815411 ] [10.1016/j.bmcl.2009.09.008 ]