1-(4-benzhydrylpiperazin-1-yl)-2,2-diphenylethanone

ID: ALA1081177

Cas Number: 48230-15-5

PubChem CID: 4059855

Max Phase: Preclinical

Molecular Formula: C31H30N2O

Molecular Weight: 446.59

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(C(c1ccccc1)c1ccccc1)N1CCN(C(c2ccccc2)c2ccccc2)CC1

Standard InChI:  InChI=1S/C31H30N2O/c34-31(29(25-13-5-1-6-14-25)26-15-7-2-8-16-26)33-23-21-32(22-24-33)30(27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-20,29-30H,21-24H2

Standard InChI Key:  GNGAFWNGMQIIFB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   -2.0260  -19.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2006  -19.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7902  -18.7319    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2006  -18.0164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0260  -18.0164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4410  -18.7319    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2664  -18.7331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6801  -18.0188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6781  -19.4484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2655  -17.3058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6785  -16.5920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5048  -16.5927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9163  -17.3132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5010  -18.0239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5031  -19.4480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9147  -20.1627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5009  -20.8778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6713  -20.8740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2634  -20.1589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0352  -18.7331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4469  -19.4484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2723  -19.4495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0332  -20.1627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6801  -20.1655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5047  -20.1670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9192  -19.4521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5031  -18.7344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6798  -18.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7903  -20.1589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2039  -20.8722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7922  -21.5886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0375  -21.5871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4474  -20.8731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4489  -18.0188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  7  8  1  0
 16 17  2  0
  1  6  1  0
 17 18  1  0
  7  9  1  0
 18 19  2  0
 19  9  1  0
  2  3  1  0
  3 20  1  0
  8 10  2  0
 20 21  1  0
  3  4  1  0
 21 22  1  0
 10 11  1  0
 21 23  1  0
  4  5  1  0
 22 24  2  0
 11 12  2  0
 24 25  1  0
  5  6  1  0
 25 26  2  0
 12 13  1  0
 26 27  1  0
 27 28  2  0
 28 22  1  0
 13 14  2  0
 23 29  2  0
 14  8  1  0
 29 30  1  0
  6  7  1  0
 30 31  2  0
  9 15  2  0
 31 32  1  0
  1  2  1  0
 32 33  2  0
 33 23  1  0
 15 16  1  0
 20 34  2  0
M  END

Associated Targets(non-human)

Cacna2d1 Voltage-dependent L-type calcium channel subunit beta-1/alpha-1B/alpha-2/delta-1 (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 446.59Molecular Weight (Monoisotopic): 446.2358AlogP: 5.75#Rotatable Bonds: 6
Polar Surface Area: 23.55Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.25CX LogP: 6.28CX LogD: 6.05
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.38Np Likeness Score: -0.80

References

1. Zamponi GW, Feng ZP, Zhang L, Pajouhesh H, Ding Y, Belardetti F, Pajouhesh H, Dolphin D, Mitscher LA, Snutch TP..  (2009)  Scaffold-based design and synthesis of potent N-type calcium channel blockers.,  19  (22): [PMID:19815411] [10.1016/j.bmcl.2009.09.008]

Source