The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7beta-O-benzyl-11,12-di-O-methylrosmanol ID: ALA1081336
PubChem CID: 44254872
Max Phase: Preclinical
Molecular Formula: C29H36O5
Molecular Weight: 464.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1c(C(C)C)cc2c(c1OC)[C@@]13CCCC(C)(C)[C@@H]1[C@H](OC3=O)[C@@H]2OCc1ccccc1
Standard InChI: InChI=1S/C29H36O5/c1-17(2)19-15-20-21(24(32-6)22(19)31-5)29-14-10-13-28(3,4)26(29)25(34-27(29)30)23(20)33-16-18-11-8-7-9-12-18/h7-9,11-12,15,17,23,25-26H,10,13-14,16H2,1-6H3/t23-,25-,26+,29+/m1/s1
Standard InChI Key: UXPWIDXFZIBEKD-OUYCBEJASA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-4.8348 -6.3613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8348 -7.1863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1251 -7.5945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1251 -5.9446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4112 -6.3613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4102 -7.1863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6973 -7.5954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9850 -7.1844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6994 -5.9456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9873 -6.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2702 -5.9507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2682 -5.1243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9894 -4.7105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6993 -5.1236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5457 -8.3089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9163 -8.3896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4145 -8.0069 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.4188 -5.5364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0056 -4.9496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7001 -6.7695 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4161 -4.7118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9910 -3.8855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5516 -4.7122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1603 -5.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5513 -3.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2684 -7.5964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7044 -8.4364 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.5401 -7.1741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1898 -7.5938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1857 -8.4333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9148 -8.8528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6442 -8.4305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6400 -7.5842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9103 -7.1684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2625 -3.4633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4179 -3.8699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 17 1 6
7 8 1 0
5 18 1 1
8 10 1 0
18 19 2 0
3 6 1 0
20 18 1 0
5 4 1 0
14 21 1 0
9 10 2 0
13 22 1 0
5 6 1 0
12 23 1 0
10 11 1 0
23 24 1 0
23 25 1 0
20 7 1 0
11 12 2 0
8 26 1 1
1 2 1 0
7 27 1 1
12 13 1 0
26 28 1 0
1 4 1 0
28 29 1 0
13 14 2 0
29 30 2 0
14 9 1 0
30 31 1 0
2 3 1 0
31 32 2 0
3 15 1 0
32 33 1 0
5 9 1 0
33 34 2 0
34 29 1 0
3 16 1 0
22 35 1 0
6 7 1 0
21 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.60Molecular Weight (Monoisotopic): 464.2563AlogP: 6.09#Rotatable Bonds: 6Polar Surface Area: 53.99Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.24CX LogD: 6.24Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.48Np Likeness Score: 1.86
References 1. Marrero JG, Moujir L, Andrés LS, Montaño NP, Araujo L, Luis JG.. (2009) Semisynthesis and biological evaluation of abietane-type diterpenes. Revision of the structure of rosmaquinone., 72 (8): [PMID:19711987 ] [10.1021/np900047p ]