The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-benzhydrylpiperazin-1-yl)-4,4-diphenylbutan-1-one ID: ALA1081365
PubChem CID: 11842614
Max Phase: Preclinical
Molecular Formula: C33H34N2O
Molecular Weight: 474.65
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCC(c1ccccc1)c1ccccc1)N1CCN(C(c2ccccc2)c2ccccc2)CC1
Standard InChI: InChI=1S/C33H34N2O/c36-32(22-21-31(27-13-5-1-6-14-27)28-15-7-2-8-16-28)34-23-25-35(26-24-34)33(29-17-9-3-10-18-29)30-19-11-4-12-20-30/h1-20,31,33H,21-26H2
Standard InChI Key: RCOIEEVFTMWYLS-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
16.4708 -19.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2958 -19.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7061 -18.5228 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2958 -17.8077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4708 -17.8077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0561 -18.5228 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2311 -18.5240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8176 -17.8101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8195 -19.2390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2319 -17.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8191 -16.3840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9932 -16.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5819 -17.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9971 -17.8152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9950 -19.2386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5835 -19.9529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9971 -20.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8264 -20.6639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2340 -19.9491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5311 -18.5240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9426 -19.2390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7676 -19.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1791 -19.9552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9445 -17.8101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7656 -20.6691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0041 -19.9563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4127 -20.6718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2370 -20.6733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6513 -19.9588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2353 -19.2414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4125 -19.2434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9419 -20.6662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5285 -21.3793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9401 -22.0953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7693 -22.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1790 -21.3802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 6 1 0
17 18 1 0
7 9 1 0
18 19 2 0
19 9 1 0
2 3 1 0
3 20 1 0
8 10 2 0
20 21 1 0
3 4 1 0
21 22 1 0
10 11 1 0
22 23 1 0
4 5 1 0
20 24 2 0
11 12 2 0
23 25 1 0
5 6 1 0
23 26 1 0
12 13 1 0
26 27 2 0
27 28 1 0
13 14 2 0
28 29 2 0
14 8 1 0
29 30 1 0
6 7 1 0
30 31 2 0
31 26 1 0
9 15 2 0
25 32 2 0
1 2 1 0
32 33 1 0
15 16 1 0
33 34 2 0
7 8 1 0
34 35 1 0
16 17 2 0
35 36 2 0
36 25 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.65Molecular Weight (Monoisotopic): 474.2671AlogP: 6.53#Rotatable Bonds: 8Polar Surface Area: 23.55Molecular Species: NEUTRALHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.30CX LogP: 6.92CX LogD: 6.66Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -0.64
References 1. Zamponi GW, Feng ZP, Zhang L, Pajouhesh H, Ding Y, Belardetti F, Pajouhesh H, Dolphin D, Mitscher LA, Snutch TP.. (2009) Scaffold-based design and synthesis of potent N-type calcium channel blockers., 19 (22): [PMID:19815411 ] [10.1016/j.bmcl.2009.09.008 ]