1-(4-benzhydrylpiperazin-1-yl)-4,4-diphenylbutan-1-one

ID: ALA1081365

PubChem CID: 11842614

Max Phase: Preclinical

Molecular Formula: C33H34N2O

Molecular Weight: 474.65

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CCC(c1ccccc1)c1ccccc1)N1CCN(C(c2ccccc2)c2ccccc2)CC1

Standard InChI:  InChI=1S/C33H34N2O/c36-32(22-21-31(27-13-5-1-6-14-27)28-15-7-2-8-16-28)34-23-25-35(26-24-34)33(29-17-9-3-10-18-29)30-19-11-4-12-20-30/h1-20,31,33H,21-26H2

Standard InChI Key:  RCOIEEVFTMWYLS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   16.4708  -19.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2958  -19.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7061  -18.5228    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2958  -17.8077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4708  -17.8077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0561  -18.5228    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2311  -18.5240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8176  -17.8101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8195  -19.2390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2319  -17.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8191  -16.3840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9932  -16.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5819  -17.1048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9971  -17.8152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9950  -19.2386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5835  -19.9529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9971  -20.6677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8264  -20.6639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2340  -19.9491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5311  -18.5240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9426  -19.2390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7676  -19.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1791  -19.9552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9445  -17.8101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7656  -20.6691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0041  -19.9563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4127  -20.6718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2370  -20.6733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6513  -19.9588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2353  -19.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4125  -19.2434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9419  -20.6662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5285  -21.3793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9401  -22.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7693  -22.0938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1790  -21.3802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  6  1  0
 17 18  1  0
  7  9  1  0
 18 19  2  0
 19  9  1  0
  2  3  1  0
  3 20  1  0
  8 10  2  0
 20 21  1  0
  3  4  1  0
 21 22  1  0
 10 11  1  0
 22 23  1  0
  4  5  1  0
 20 24  2  0
 11 12  2  0
 23 25  1  0
  5  6  1  0
 23 26  1  0
 12 13  1  0
 26 27  2  0
 27 28  1  0
 13 14  2  0
 28 29  2  0
 14  8  1  0
 29 30  1  0
  6  7  1  0
 30 31  2  0
 31 26  1  0
  9 15  2  0
 25 32  2  0
  1  2  1  0
 32 33  1  0
 15 16  1  0
 33 34  2  0
  7  8  1  0
 34 35  1  0
 16 17  2  0
 35 36  2  0
 36 25  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Cacna2d1 Voltage-dependent L-type calcium channel subunit beta-1/alpha-1B/alpha-2/delta-1 (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 474.65Molecular Weight (Monoisotopic): 474.2671AlogP: 6.53#Rotatable Bonds: 8
Polar Surface Area: 23.55Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.30CX LogP: 6.92CX LogD: 6.66
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -0.64

References

1. Zamponi GW, Feng ZP, Zhang L, Pajouhesh H, Ding Y, Belardetti F, Pajouhesh H, Dolphin D, Mitscher LA, Snutch TP..  (2009)  Scaffold-based design and synthesis of potent N-type calcium channel blockers.,  19  (22): [PMID:19815411] [10.1016/j.bmcl.2009.09.008]

Source