1-(4-benzhydrylpiperazin-1-yl)-5,5-diphenylpentan-1-one

ID: ALA1081366

PubChem CID: 46879970

Max Phase: Preclinical

Molecular Formula: C34H36N2O

Molecular Weight: 488.68

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CCCC(c1ccccc1)c1ccccc1)N1CCN(C(c2ccccc2)c2ccccc2)CC1

Standard InChI:  InChI=1S/C34H36N2O/c37-33(23-13-22-32(28-14-5-1-6-15-28)29-16-7-2-8-17-29)35-24-26-36(27-25-35)34(30-18-9-3-10-19-30)31-20-11-4-12-21-31/h1-12,14-21,32,34H,13,22-27H2

Standard InChI Key:  NCPOSTPOYGDVLG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   -2.5208  -25.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6958  -25.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2856  -25.0520    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6958  -24.3369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5208  -24.3369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9356  -25.0520    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7606  -25.0531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1741  -24.3392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1721  -25.7682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7597  -23.6266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1725  -22.9132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9984  -22.9139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4098  -23.6339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9946  -24.3444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9967  -25.7678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4081  -26.4820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9946  -27.1969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1653  -27.1931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7576  -26.4783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4606  -25.0531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0491  -25.7682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7759  -25.7693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1894  -25.0554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0144  -25.0565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4259  -25.7716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4279  -24.3426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0091  -26.4839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4199  -27.1985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2458  -27.2001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6591  -26.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2459  -25.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2530  -24.3453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6664  -23.6322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2548  -22.9162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4255  -22.9177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0159  -23.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0471  -24.3392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 17 18  1  0
  7  9  1  0
 18 19  2  0
 19  9  1  0
  2  3  1  0
  3 20  1  0
  8 10  2  0
 20 21  1  0
  3  4  1  0
 21 22  1  0
 10 11  1  0
 22 23  1  0
  4  5  1  0
 23 24  1  0
 11 12  2  0
 24 25  1  0
  5  6  1  0
 24 26  1  0
 12 13  1  0
 25 27  2  0
 27 28  1  0
 13 14  2  0
 28 29  2  0
 14  8  1  0
 29 30  1  0
  6  7  1  0
 30 31  2  0
 31 25  1  0
  9 15  2  0
 26 32  2  0
  1  2  1  0
 32 33  1  0
 15 16  1  0
 33 34  2  0
  7  8  1  0
 34 35  1  0
 16 17  2  0
 35 36  2  0
 36 26  1  0
  1  6  1  0
 20 37  2  0
M  END

Alternative Forms

Associated Targets(non-human)

Cacna2d1 Voltage-dependent L-type calcium channel subunit beta-1/alpha-1B/alpha-2/delta-1 (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 488.68Molecular Weight (Monoisotopic): 488.2828AlogP: 6.92#Rotatable Bonds: 9
Polar Surface Area: 23.55Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.30CX LogP: 7.36CX LogD: 7.11
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.26Np Likeness Score: -0.58

References

1. Zamponi GW, Feng ZP, Zhang L, Pajouhesh H, Ding Y, Belardetti F, Pajouhesh H, Dolphin D, Mitscher LA, Snutch TP..  (2009)  Scaffold-based design and synthesis of potent N-type calcium channel blockers.,  19  (22): [PMID:19815411] [10.1016/j.bmcl.2009.09.008]

Source