The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-hydroxy fissinolid ID: ALA1081404
PubChem CID: 46878891
Max Phase: Preclinical
Molecular Formula: C29H38O8
Molecular Weight: 514.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: 2-Hydroxy Fissinolid | 2-hydroxy fissinolid|CHEMBL1081404
Canonical SMILES: COC(=O)C[C@H]1C(C)(C)[C@@H](OC(C)=O)[C@@H]2CC3=C4CC(=O)O[C@@H](c5ccoc5)[C@]4(C)CC[C@@H]3[C@@]1(C)C2O
Standard InChI: InChI=1S/C29H38O8/c1-15(30)36-26-18-11-17-19(29(5,24(18)33)21(27(26,2)3)13-22(31)34-6)7-9-28(4)20(17)12-23(32)37-25(28)16-8-10-35-14-16/h8,10,14,18-19,21,24-26,33H,7,9,11-13H2,1-6H3/t18-,19+,21+,24?,25+,26+,28-,29-/m1/s1
Standard InChI Key: USQWQRAKBGJPTC-ANKFCNIWSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
8.1748 -1.0905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1748 -1.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8878 -2.3288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8878 -0.6761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6009 -1.0905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5951 -1.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3030 -2.3323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0237 -1.9244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0249 -1.1002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3142 -0.6795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5933 -0.2663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3111 0.1443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9811 0.6257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7291 1.4127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9048 1.4164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6456 0.6319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7324 -2.3430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4588 -2.3328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7496 -1.9155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0370 -2.3281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0321 -3.1528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7498 -3.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4679 -3.1515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7488 -1.0913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0382 -0.6760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0420 0.1481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3238 -1.0893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6086 -0.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4478 -1.7345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2339 -2.5361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3180 -3.5622 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3149 -4.3864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6008 -4.8002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0303 -4.8011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1818 -3.5657 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8616 -4.0876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4564 -1.5070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7627 -1.2021 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.7498 -4.3909 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 2 0
5 4 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
5 11 1 6
12 13 2 0
13 14 1 0
14 15 1 0
15 16 2 0
16 12 1 0
10 12 1 6
8 17 2 0
2 18 1 0
18 19 1 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
19 24 1 6
24 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
20 29 1 0
20 30 1 0
21 31 1 6
31 32 1 0
32 33 2 0
32 34 1 0
23 35 1 0
3 36 1 0
22 36 1 0
18 37 1 6
2 38 1 6
22 39 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 514.62Molecular Weight (Monoisotopic): 514.2567AlogP: 4.52#Rotatable Bonds: 4Polar Surface Area: 112.27Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.62CX LogD: 2.62Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.35Np Likeness Score: 2.95
References 1. Lin BD, Yuan T, Zhang CR, Dong L, Zhang B, Wu Y, Yue JM.. (2009) Structurally diverse limonoids from the fruits of Swietenia mahagoni., 72 (12): [PMID:19902967 ] [10.1021/np900522h ]