6-methoxypaeoniflorigenone

ID: ALA1081885

PubChem CID: 46883192

Max Phase: Preclinical

Molecular Formula: C18H20O6

Molecular Weight: 332.35

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Synonyms: 6-Methoxypaeoniflorigenone | 6-methoxypaeoniflorigenone|CHEMBL1081885|BDBM50310717

Canonical SMILES:  CO[C@@]12C[C@@H]3C(=O)[C@@](C)(C1)OC(O2)[C@H]3COC(=O)c1ccccc1

Standard InChI:  InChI=1S/C18H20O6/c1-17-10-18(21-2)8-12(14(17)19)13(16(23-17)24-18)9-22-15(20)11-6-4-3-5-7-11/h3-7,12-13,16H,8-10H2,1-2H3/t12-,13-,16?,17+,18+/m0/s1

Standard InChI Key:  BCPSDKWCITVQOP-IDNXCJIVSA-N

Molfile:  

     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
   17.7501  -22.3898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4654  -21.9769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0349  -21.9769    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7501  -23.2158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1774  -22.3937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8921  -21.9814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8926  -21.1546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1723  -20.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4605  -21.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5060  -21.3995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3029  -21.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3625  -20.0968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6893  -20.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1531  -20.7067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7054  -20.7865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3667  -20.6802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7842  -20.0188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9978  -19.4078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1476  -19.4022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1410  -20.1401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3204  -20.6272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5301  -20.8301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1182  -22.0132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2970  -22.3059    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.9780  -19.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 10 14  1  0
 11 15  1  0
 15 12  1  0
 12 13  1  0
 13 14  1  0
  1  4  2  0
  7  8  1  0
 14 16  1  6
 14 17  1  0
  8  9  2  0
 12 18  1  0
  9  2  1  0
 17 19  1  0
 19 18  1  0
  2  5  2  0
 12 20  1  6
 10 11  1  0
 11 21  1  0
 19 21  1  0
  1  3  1  0
 15 22  2  0
  5  6  1  0
 21 23  1  1
 23  3  1  0
  1  2  1  0
 11 24  1  6
  6  7  2  0
 16 25  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

Akr1b1 Aldose reductase (4007 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 332.35Molecular Weight (Monoisotopic): 332.1260AlogP: 1.93#Rotatable Bonds: 4
Polar Surface Area: 71.06Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.11CX LogD: 3.11
Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.78Np Likeness Score: 1.73

References

1. Ha do T, Ngoc TM, Lee I, Lee YM, Kim JS, Jung H, Lee S, Na M, Bae K..  (2009)  Inhibitors of aldose reductase and formation of advanced glycation end-products in moutan cortex (Paeonia suffruticosa).,  72  (8): [PMID:19670875] [10.1021/np9002004]

Source