1-(4-fluoro-3-((2-(methylamino)ethylamino)methyl)phenyl)-N-(2-methoxybenzyl)-3-(trifluoromethyl)-1H-pyrazole-5-carboxamide

ID: ALA1082203

PubChem CID: 46880200

Max Phase: Preclinical

Molecular Formula: C23H25F4N5O2

Molecular Weight: 479.48

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNCCNCc1cc(-n2nc(C(F)(F)F)cc2C(=O)NCc2ccccc2OC)ccc1F

Standard InChI:  InChI=1S/C23H25F4N5O2/c1-28-9-10-29-13-16-11-17(7-8-18(16)24)32-19(12-21(31-32)23(25,26)27)22(33)30-14-15-5-3-4-6-20(15)34-2/h3-8,11-12,28-29H,9-10,13-14H2,1-2H3,(H,30,33)

Standard InChI Key:  BWKYDBKPOJUVGC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
   -0.4171  -13.9004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4171  -14.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2974  -15.1424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0163  -14.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0163  -13.9004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2974  -13.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2912  -12.6565    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9573  -12.1705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7019  -11.3864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1232  -11.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3768  -12.1725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5526  -10.6831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1572   -9.9591    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3773  -10.7025    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9098   -9.9350    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.6716  -12.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6711  -13.4083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3854  -13.8211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0994  -13.4066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3862  -12.1712    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4975  -12.5344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7634  -12.1474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0669  -12.5867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5261  -13.3603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8257  -13.7947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8522  -14.6192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1513  -15.0544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2962  -15.9674    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1315  -15.1424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8459  -14.7299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5603  -15.1424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2747  -14.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9892  -15.1424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7036  -14.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  6  2  0
 16 17  1  0
  2  3  2  0
 17 18  1  0
  3  4  1  0
 18 19  1  0
  8  9  2  0
 16 20  2  0
 19 25  2  0
  9 10  1  0
 24 21  2  0
 10 11  2  0
 21 22  1  0
 11  7  1  0
 22 23  2  0
 23 19  1  0
  6  7  1  0
  4  5  2  0
 24 25  1  0
 10 12  1  0
 25 26  1  0
  5  6  1  0
 26 27  1  0
 12 13  1  0
  3 28  1  0
  7  8  1  0
  2 29  1  0
 12 14  1  0
 29 30  1  0
 30 31  1  0
 12 15  1  0
 31 32  1  0
  1  2  1  0
 32 33  1  0
  8 16  1  0
 33 34  1  0
M  END

Associated Targets(non-human)

Carm1 Histone-arginine methyltransferase CARM1 (53 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 479.48Molecular Weight (Monoisotopic): 479.1944AlogP: 3.28#Rotatable Bonds: 10
Polar Surface Area: 80.21Molecular Species: BASEHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.64CX Basic pKa: 9.56CX LogP: 3.22CX LogD: 1.09
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.31Np Likeness Score: -1.50

References

1. Therrien E, Larouche G, Manku S, Allan M, Nguyen N, Styhler S, Robert MF, Goulet AC, Besterman JM, Nguyen H, Wahhab A..  (2009)  1,2-Diamines as inhibitors of co-activator associated arginine methyltransferase 1 (CARM1).,  19  (23): [PMID:19836951] [10.1016/j.bmcl.2009.09.110]

Source