The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-fluoro-3-((2-(methylamino)ethylamino)methyl)phenyl)-N-(2-methoxybenzyl)-3-(trifluoromethyl)-1H-pyrazole-5-carboxamide ID: ALA1082203
PubChem CID: 46880200
Max Phase: Preclinical
Molecular Formula: C23H25F4N5O2
Molecular Weight: 479.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CNCCNCc1cc(-n2nc(C(F)(F)F)cc2C(=O)NCc2ccccc2OC)ccc1F
Standard InChI: InChI=1S/C23H25F4N5O2/c1-28-9-10-29-13-16-11-17(7-8-18(16)24)32-19(12-21(31-32)23(25,26)27)22(33)30-14-15-5-3-4-6-20(15)34-2/h3-8,11-12,28-29H,9-10,13-14H2,1-2H3,(H,30,33)
Standard InChI Key: BWKYDBKPOJUVGC-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
-0.4171 -13.9004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4171 -14.7299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2974 -15.1424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0163 -14.7299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0163 -13.9004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2974 -13.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2912 -12.6565 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9573 -12.1705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7019 -11.3864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1232 -11.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3768 -12.1725 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5526 -10.6831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1572 -9.9591 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.3773 -10.7025 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.9098 -9.9350 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.6716 -12.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6711 -13.4083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3854 -13.8211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0994 -13.4066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3862 -12.1712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4975 -12.5344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7634 -12.1474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0669 -12.5867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5261 -13.3603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8257 -13.7947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8522 -14.6192 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1513 -15.0544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2962 -15.9674 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.1315 -15.1424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8459 -14.7299 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5603 -15.1424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2747 -14.7299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9892 -15.1424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.7036 -14.7299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 6 2 0
16 17 1 0
2 3 2 0
17 18 1 0
3 4 1 0
18 19 1 0
8 9 2 0
16 20 2 0
19 25 2 0
9 10 1 0
24 21 2 0
10 11 2 0
21 22 1 0
11 7 1 0
22 23 2 0
23 19 1 0
6 7 1 0
4 5 2 0
24 25 1 0
10 12 1 0
25 26 1 0
5 6 1 0
26 27 1 0
12 13 1 0
3 28 1 0
7 8 1 0
2 29 1 0
12 14 1 0
29 30 1 0
30 31 1 0
12 15 1 0
31 32 1 0
1 2 1 0
32 33 1 0
8 16 1 0
33 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.48Molecular Weight (Monoisotopic): 479.1944AlogP: 3.28#Rotatable Bonds: 10Polar Surface Area: 80.21Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.64CX Basic pKa: 9.56CX LogP: 3.22CX LogD: 1.09Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.31Np Likeness Score: -1.50
References 1. Therrien E, Larouche G, Manku S, Allan M, Nguyen N, Styhler S, Robert MF, Goulet AC, Besterman JM, Nguyen H, Wahhab A.. (2009) 1,2-Diamines as inhibitors of co-activator associated arginine methyltransferase 1 (CARM1)., 19 (23): [PMID:19836951 ] [10.1016/j.bmcl.2009.09.110 ]