ID: ALA1082282
PubChem CID: 46867257
Max Phase: Preclinical
Molecular Formula: C48H90N20O15
Molecular Weight: 1187.37
Molecule Type: Protein
Associated Items:
Canonical SMILES: CC(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(N)=O)[C@@H](C)O)[C@@H](C)O
Standard InChI: InChI=1S/C48H90N20O15/c1-23(59-27(5)72)38(75)62-31(15-11-21-58-48(55)56)43(80)68-36(26(4)71)46(83)65-29(13-7-9-19-50)40(77)64-32(16-17-34(51)73)44(81)67-35(25(3)70)45(82)60-24(2)39(76)61-30(14-10-20-57-47(53)54)41(78)63-28(12-6-8-18-49)42(79)66-33(22-69)37(52)74/h23-26,28-33,35-36,69-71H,6-22,49-50H2,1-5H3,(H2,51,73)(H2,52,74)(H,59,72)(H,60,82)(H,61,76)(H,62,75)(H,63,78)(H,64,77)(H,65,83)(H,66,79)(H,67,81)(H,68,80)(H4,53,54,57)(H4,55,56,58)/t23-,24-,25+,26+,28-,29-,30-,31-,32-,33-,35-,36-/m0/s1
Standard InChI Key: PTYYUNSMCQJTHL-JPPFDADPSA-N
Molfile:
RDKit 2D
83 82 0 0 0 0 0 0 0 0999 V2000
-2.8911 -8.0948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1794 -9.3323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8911 -7.2698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1794 -8.5073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6810 -11.8085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7492 -8.5064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0375 -7.2689 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0375 -8.0939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7492 -9.3314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0375 -9.7439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0375 -10.5689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6784 -8.5064 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3943 -8.0939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1060 -9.3314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1060 -8.5064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3943 -7.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6784 -6.8564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5350 -8.5054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2509 -7.2679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2509 -8.0929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5350 -9.3304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2509 -9.7429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2509 -10.5679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9668 -10.9804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6795 -8.0929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3912 -9.3304 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3912 -8.5054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6795 -7.2679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3912 -6.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3912 -6.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1071 -5.6179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1071 -8.0929 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8229 -8.5054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5346 -7.2679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5346 -8.0929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8229 -9.3304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1071 -9.7429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9658 -8.0976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6775 -9.3351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9658 -7.2726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6775 -8.5101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5348 -11.8094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1072 -8.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8189 -7.2724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8189 -8.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1072 -9.3349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8189 -9.7474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8189 -10.5724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2469 -8.0948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9627 -9.3323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9627 -8.5073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2469 -7.2698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9627 -6.8573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9627 -6.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6786 -5.6198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3924 -8.5073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1041 -7.2698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1041 -8.0948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3924 -9.3323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8199 -8.5073 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6059 -8.5067 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.3200 -8.0936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0349 -8.5055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3193 -7.2686 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6757 -10.9835 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0412 -12.2208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3937 -12.2215 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4646 -8.0954 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0985 -6.8557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8202 -8.0935 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9636 -11.8060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9652 -8.5057 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6795 -5.6179 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5282 -9.7405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2489 -8.5058 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5337 -10.9844 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8198 -12.2225 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2474 -12.2225 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3923 -8.0981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5337 -8.5094 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6786 -4.7960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6776 -8.0954 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1041 -9.7448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13 12 1 1
13 15 1 0
15 14 2 0
13 16 1 0
16 17 1 0
18 20 1 0
20 19 2 0
18 21 1 6
21 22 1 0
22 23 1 0
23 24 1 0
25 27 1 0
27 26 2 0
25 28 1 1
28 29 1 0
29 30 1 0
30 31 2 0
33 32 1 6
33 35 1 0
35 34 2 0
33 36 1 0
36 37 1 0
38 41 1 0
41 39 2 0
38 40 1 1
43 45 1 0
45 44 2 0
43 46 1 6
46 47 1 0
47 48 1 0
49 51 1 0
51 50 2 0
49 52 1 1
52 53 1 0
53 54 1 0
54 55 1 0
56 58 1 0
58 57 2 0
56 59 1 6
1 61 1 0
61 62 1 0
8 12 1 0
62 63 1 0
62 64 2 0
27 32 1 0
58 60 1 0
1 4 1 0
4 2 2 0
1 3 1 1
6 8 1 0
8 7 2 0
6 9 1 6
9 10 1 0
10 11 1 0
5 66 1 0
36 74 1 6
16 69 1 1
75 38 1 0
35 75 1 0
11 65 1 0
65 5 1 0
76 42 1 0
48 76 1 0
70 18 1 0
15 70 1 0
42 77 1 0
5 67 2 0
42 78 2 0
24 71 1 0
79 43 1 0
41 79 1 0
80 49 1 0
45 80 1 0
72 25 1 0
20 72 1 0
55 81 1 0
4 68 1 0
68 6 1 0
82 56 1 0
51 82 1 0
30 73 1 0
59 83 1 0
M END| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Natural Product: No | Oral: No | Chemical Probe: No | Parenteral: No |
| Molecule Type: Protein | Topical: No | First In Class: No | Black Box: No |
| Chirality: No | Availability: No | Prodrug: No |
| MESH ID | MESH Heading | EFO IDs | EFO Terms | Max Phase for Indication | References |
|---|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| Molecular Weight: 1187.37 | Molecular Weight (Monoisotopic): 1186.6895 | AlogP: ┄ | #Rotatable Bonds: ┄ |
| Polar Surface Area: ┄ | Molecular Species: ┄ | HBA: ┄ | HBD: ┄ |
| #RO5 Violations: ┄ | HBA (Lipinski): ┄ | HBD (Lipinski): ┄ | #RO5 Violations (Lipinski): ┄ |
| CX Acidic pKa: ┄ | CX Basic pKa: ┄ | CX LogP: ┄ | CX LogD: ┄ |
| Aromatic Rings: ┄ | Heavy Atoms: ┄ | QED Weighted: ┄ | Np Likeness Score: ┄ |
| 1. Karatas H, Townsend EC, Bernard D, Dou Y, Wang S.. (2010) Analysis of the binding of mixed lineage leukemia 1 (MLL1) and histone 3 peptides to WD repeat domain 5 (WDR5) for the design of inhibitors of the MLL1-WDR5 interaction., 53 (14): [PMID:20575550] [10.1021/jm100139b] |
| 2. Karatas, Hacer H, Townsend, Elizabeth C EC, Bernard, Denzil D, Dou, Yali Y and Wang, Shaomeng S. 2010-07-22 Analysis of the binding of mixed lineage leukemia 1 (MLL1) and histone 3 peptides to WD repeat domain 5 (WDR5) for the design of inhibitors of the MLL1-WDR5 interaction. [PMID:20575550] |
| 3. Bolshan, Yuri Y and 16 more authors. 2013-03-14 Synthesis, Optimization, and Evaluation of Novel Small Molecules as Antagonists of WDR5-MLL Interaction. [PMID:24900672] |
| 4. Getlik, Matthäus M and 17 more authors. 2016-03-24 Structure-Based Optimization of a Small Molecule Antagonist of the Interaction Between WD Repeat-Containing Protein 5 (WDR5) and Mixed-Lineage Leukemia 1 (MLL1). [PMID:26958703] |
| 5. Li, Dong-Dong DD and 9 more authors. 2016-08-08 Structure-based design and synthesis of small molecular inhibitors disturbing the interaction of MLL1-WDR5. [PMID:27116709] |
| 6. Li, Dong-Dong DD and 8 more authors. 2016-11-29 High-affinity small molecular blockers of mixed lineage leukemia 1 (MLL1)-WDR5 interaction inhibit MLL1 complex H3K4 methyltransferase activity. [PMID:27598236] |
| 7. Li, Dong-Dong DD and 5 more authors. 2016-11-15 Structure-based design of ester compounds to inhibit MLL complex catalytic activity by targeting mixed lineage leukemia 1 (MLL1)-WDR5 interaction. [PMID:27720555] |
| 8. Wang, Feng F and 17 more authors. 2018-07-12 Discovery of Potent 2-Aryl-6,7-dihydro-5 H-pyrrolo[1,2- a]imidazoles as WDR5-WIN-Site Inhibitors Using Fragment-Based Methods and Structure-Based Design. [PMID:29889518] |
| 9. Ye, Xiaoqing X and 11 more authors. 2019-02-15 The identification of novel small-molecule inhibitors targeting WDR5-MLL1 interaction through fluorescence polarization based high-throughput screening. [PMID:30626558] |
| 10. Tian, Jianhua and 24 more authors. 2020-01-23 Discovery and Structure-Based Optimization of Potent and Selective WD Repeat Domain 5 (WDR5) Inhibitors Containing a Dihydroisoquinolinone Bicyclic Core. [PMID:31858797] |
| 11. Chacón Simon, Selena and 14 more authors. 2020-04-23 Discovery of WD Repeat-Containing Protein 5 (WDR5)-MYC Inhibitors Using Fragment-Based Methods and Structure-Based Design. [PMID:32223236] |
Source(1):