ID: ALA1082284
PubChem CID: 46889993
Max Phase: Preclinical
Molecular Formula: C47H90N20O14
Molecular Weight: 1159.36
Molecule Type: Protein
Associated Items:
Canonical SMILES: C[C@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H](C(=O)N(C)[C@@H](CCCCN)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(N)=O)[C@@H](C)O)[C@@H](C)O
Standard InChI: InChI=1S/C47H90N20O14/c1-23(50)37(73)60-29(14-11-21-58-47(55)56)41(77)66-35(26(4)70)45(81)67(5)32(15-7-9-19-49)43(79)63-30(16-17-33(51)71)42(78)65-34(25(3)69)44(80)59-24(2)38(74)61-28(13-10-20-57-46(53)54)39(75)62-27(12-6-8-18-48)40(76)64-31(22-68)36(52)72/h23-32,34-35,68-70H,6-22,48-50H2,1-5H3,(H2,51,71)(H2,52,72)(H,59,80)(H,60,73)(H,61,74)(H,62,75)(H,63,79)(H,64,76)(H,65,78)(H,66,77)(H4,53,54,57)(H4,55,56,58)/t23-,24-,25+,26+,27-,28-,29-,30-,31-,32-,34-,35-/m0/s1
Standard InChI Key: BMQKBMJJUNPVPV-NCKQPBNLSA-N
Molfile:
RDKit 2D
81 80 0 0 0 0 0 0 0 0999 V2000
1.5848 -2.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2965 -3.3075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5848 -1.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2965 -2.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1567 -5.7837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7266 -2.4815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4383 -1.2440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4383 -2.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7266 -3.3065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4383 -3.7190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4383 -4.5440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1542 -2.4815 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8700 -2.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5817 -3.3065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5817 -2.4815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8700 -1.2440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1542 -0.8315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0109 -2.4807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7268 -1.2432 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7268 -2.0682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0109 -3.3057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7268 -3.7182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7268 -4.5432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4426 -4.9557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1554 -2.0683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8671 -3.3058 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8671 -2.4808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1554 -1.2433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8671 -0.8308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8671 -0.0058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5829 0.4067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5829 -2.0683 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2988 -2.4808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0105 -1.2433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0105 -2.0683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2988 -3.3058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5829 -3.7183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4416 -2.0727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1533 -3.3102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4416 -1.2477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1533 -2.4852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0104 -5.7846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5830 -2.4852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2947 -1.2477 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2947 -2.0727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5830 -3.3102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2947 -3.7227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2947 -4.5477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7227 -2.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4386 -3.3075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4386 -2.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7227 -1.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4386 -0.8325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4386 -0.0075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1545 0.4050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8683 -2.4826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5800 -1.2451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5800 -2.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8683 -3.3076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2959 -2.4826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8699 -2.4819 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3002 -1.2439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1515 -4.9587 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4346 -6.1963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8694 -6.1969 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0113 -2.0706 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5744 -0.8311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2961 -2.0689 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4396 -5.7814 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4411 -2.4811 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1554 0.4067 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0043 -3.7159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7248 -2.4811 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0095 -4.9596 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2958 -6.1978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7233 -6.1978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8682 -2.0733 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0095 -2.4846 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1545 1.2288 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1535 -2.0706 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5800 -3.7201 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13 12 1 1
13 15 1 0
15 14 2 0
13 16 1 0
16 17 1 0
18 20 1 0
20 19 2 0
18 21 1 6
21 22 1 0
22 23 1 0
23 24 1 0
25 27 1 0
27 26 2 0
25 28 1 1
28 29 1 0
29 30 1 0
30 31 2 0
33 32 1 6
33 35 1 0
35 34 2 0
33 36 1 0
36 37 1 0
38 41 1 0
41 39 2 0
38 40 1 1
43 45 1 0
45 44 2 0
43 46 1 6
46 47 1 0
47 48 1 0
49 51 1 0
51 50 2 0
49 52 1 1
52 53 1 0
53 54 1 0
54 55 1 0
56 58 1 0
58 57 2 0
56 59 1 6
1 61 1 0
8 12 1 0
27 32 1 0
58 60 1 0
1 4 1 0
4 2 2 0
1 3 1 1
6 8 1 0
8 7 2 0
6 9 1 6
9 10 1 0
10 11 1 0
5 64 1 0
36 72 1 6
16 67 1 1
73 38 1 0
35 73 1 0
63 5 1 0
11 63 1 0
74 42 1 0
48 74 1 0
68 18 1 0
15 68 1 0
68 62 1 0
42 75 1 0
5 65 2 0
42 76 2 0
24 69 1 0
77 43 1 0
41 77 1 0
78 49 1 0
45 78 1 0
70 25 1 0
20 70 1 0
55 79 1 0
4 66 1 0
66 6 1 0
80 56 1 0
51 80 1 0
30 71 1 0
59 81 1 0
M END| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Natural Product: No | Oral: No | Chemical Probe: No | Parenteral: No |
| Molecule Type: Protein | Topical: No | First In Class: No | Black Box: No |
| Chirality: No | Availability: No | Prodrug: No |
| MESH ID | MESH Heading | EFO IDs | EFO Terms | Max Phase for Indication | References |
|---|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| Molecular Weight: 1159.36 | Molecular Weight (Monoisotopic): 1158.6945 | AlogP: ┄ | #Rotatable Bonds: ┄ |
| Polar Surface Area: ┄ | Molecular Species: ┄ | HBA: ┄ | HBD: ┄ |
| #RO5 Violations: ┄ | HBA (Lipinski): ┄ | HBD (Lipinski): ┄ | #RO5 Violations (Lipinski): ┄ |
| CX Acidic pKa: ┄ | CX Basic pKa: ┄ | CX LogP: ┄ | CX LogD: ┄ |
| Aromatic Rings: ┄ | Heavy Atoms: ┄ | QED Weighted: ┄ | Np Likeness Score: ┄ |
| 1. Karatas H, Townsend EC, Bernard D, Dou Y, Wang S.. (2010) Analysis of the binding of mixed lineage leukemia 1 (MLL1) and histone 3 peptides to WD repeat domain 5 (WDR5) for the design of inhibitors of the MLL1-WDR5 interaction., 53 (14): [PMID:20575550] [10.1021/jm100139b] |
| 2. Karatas, Hacer H, Townsend, Elizabeth C EC, Bernard, Denzil D, Dou, Yali Y and Wang, Shaomeng S. 2010-07-22 Analysis of the binding of mixed lineage leukemia 1 (MLL1) and histone 3 peptides to WD repeat domain 5 (WDR5) for the design of inhibitors of the MLL1-WDR5 interaction. [PMID:20575550] |
| 3. Bolshan, Yuri Y and 16 more authors. 2013-03-14 Synthesis, Optimization, and Evaluation of Novel Small Molecules as Antagonists of WDR5-MLL Interaction. [PMID:24900672] |
| 4. Getlik, Matthäus M and 17 more authors. 2016-03-24 Structure-Based Optimization of a Small Molecule Antagonist of the Interaction Between WD Repeat-Containing Protein 5 (WDR5) and Mixed-Lineage Leukemia 1 (MLL1). [PMID:26958703] |
| 5. Li, Dong-Dong DD and 9 more authors. 2016-08-08 Structure-based design and synthesis of small molecular inhibitors disturbing the interaction of MLL1-WDR5. [PMID:27116709] |
| 6. Li, Dong-Dong DD and 8 more authors. 2016-11-29 High-affinity small molecular blockers of mixed lineage leukemia 1 (MLL1)-WDR5 interaction inhibit MLL1 complex H3K4 methyltransferase activity. [PMID:27598236] |
| 7. Li, Dong-Dong DD and 5 more authors. 2016-11-15 Structure-based design of ester compounds to inhibit MLL complex catalytic activity by targeting mixed lineage leukemia 1 (MLL1)-WDR5 interaction. [PMID:27720555] |
| 8. Wang, Feng F and 17 more authors. 2018-07-12 Discovery of Potent 2-Aryl-6,7-dihydro-5 H-pyrrolo[1,2- a]imidazoles as WDR5-WIN-Site Inhibitors Using Fragment-Based Methods and Structure-Based Design. [PMID:29889518] |
| 9. Ye, Xiaoqing X and 11 more authors. 2019-02-15 The identification of novel small-molecule inhibitors targeting WDR5-MLL1 interaction through fluorescence polarization based high-throughput screening. [PMID:30626558] |
| 10. Tian, Jianhua and 24 more authors. 2020-01-23 Discovery and Structure-Based Optimization of Potent and Selective WD Repeat Domain 5 (WDR5) Inhibitors Containing a Dihydroisoquinolinone Bicyclic Core. [PMID:31858797] |
| 11. Chacón Simon, Selena and 14 more authors. 2020-04-23 Discovery of WD Repeat-Containing Protein 5 (WDR5)-MYC Inhibitors Using Fragment-Based Methods and Structure-Based Design. [PMID:32223236] |
Source(1):