ID: ALA1082286
PubChem CID: 46889995
Max Phase: Preclinical
Molecular Formula: C49H94N20O14
Molecular Weight: 1187.42
Molecule Type: Protein
Associated Items:
Canonical SMILES: C[C@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H](C(=O)N(C)[C@@H](CCCCN(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(N)=O)[C@@H](C)O)[C@@H](C)O
Standard InChI: InChI=1S/C49H94N20O14/c1-25(51)39(75)61-31(16-13-22-59-49(56)57)43(79)67-37(28(4)72)47(83)69(7)34(17-9-11-23-68(5)6)45(81)64-32(18-19-35(52)73)44(80)66-36(27(3)71)46(82)60-26(2)40(76)62-30(15-12-21-58-48(54)55)41(77)63-29(14-8-10-20-50)42(78)65-33(24-70)38(53)74/h25-34,36-37,70-72H,8-24,50-51H2,1-7H3,(H2,52,73)(H2,53,74)(H,60,82)(H,61,75)(H,62,76)(H,63,77)(H,64,81)(H,65,78)(H,66,80)(H,67,79)(H4,54,55,58)(H4,56,57,59)/t25-,26-,27+,28+,29-,30-,31-,32-,33-,34-,36-,37-/m0/s1
Standard InChI Key: PBPOVNDZNWBXLP-RETRBKMKSA-N
Molfile:
RDKit 2D
83 82 0 0 0 0 0 0 0 0999 V2000
-3.1280 -4.9829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4163 -6.2204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1280 -4.1579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4163 -5.3954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4441 -8.6967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9862 -5.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2745 -4.1570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2745 -4.9820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9862 -6.2195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2745 -6.6320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2745 -7.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4413 -5.3945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1572 -4.9820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8689 -6.2195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8689 -5.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1572 -4.1570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4413 -3.7445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2980 -5.3936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0138 -4.1561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0138 -4.9811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2980 -6.2186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0138 -6.6311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0138 -7.4561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7297 -7.8686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4424 -4.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1541 -6.2185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1541 -5.3935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4424 -4.1560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1541 -3.7435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1541 -2.9185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8700 -2.5060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8700 -4.9810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5859 -5.3935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2976 -4.1560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2976 -4.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5859 -6.2185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8700 -6.6310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7288 -4.9856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4405 -6.2231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7288 -4.1606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4405 -5.3981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2977 -8.6975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8701 -5.3981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5818 -4.1606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5818 -4.9856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8701 -6.2231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5818 -6.6356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5818 -7.4606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0099 -4.9829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7258 -6.2204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7258 -5.3954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0099 -4.1579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7258 -3.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7258 -2.9204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4416 -2.5079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1554 -5.3953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8671 -4.1578 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8671 -4.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1554 -6.2203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5830 -5.3953 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8428 -5.3948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5874 -4.1567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0127 -9.1071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4421 -9.1043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4388 -7.8717 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2780 -9.1092 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1568 -9.1098 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7015 -4.9835 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8617 -3.7440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5832 -4.9817 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7266 -8.6936 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7282 -5.3939 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4424 -2.5060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2914 -6.6287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0119 -5.3939 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2967 -7.8725 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5828 -9.1106 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0104 -9.1106 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1553 -4.9862 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2966 -5.3975 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4417 -1.6841 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4406 -4.9835 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8671 -6.6328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15 14 2 0
13 16 1 0
16 17 1 0
18 20 1 0
20 19 2 0
18 21 1 6
21 22 1 0
22 23 1 0
23 24 1 0
25 27 1 0
27 26 2 0
25 28 1 1
28 29 1 0
29 30 1 0
30 31 2 0
33 32 1 6
33 35 1 0
35 34 2 0
33 36 1 0
36 37 1 0
38 41 1 0
41 39 2 0
38 40 1 1
43 45 1 0
45 44 2 0
43 46 1 6
46 47 1 0
47 48 1 0
49 51 1 0
51 50 2 0
49 52 1 1
52 53 1 0
53 54 1 0
54 55 1 0
56 58 1 0
58 57 2 0
56 59 1 6
1 61 1 0
8 12 1 0
27 32 1 0
58 60 1 0
1 4 1 0
4 2 2 0
1 3 1 1
6 8 1 0
8 7 2 0
6 9 1 6
9 10 1 0
10 11 1 0
13 12 1 1
13 15 1 0
5 66 1 0
36 74 1 6
16 69 1 1
75 38 1 0
35 75 1 0
65 5 1 0
11 65 1 0
76 42 1 0
48 76 1 0
70 18 1 0
15 70 1 0
70 62 1 0
42 77 1 0
5 67 2 0
42 78 2 0
24 71 1 0
71 63 1 0
71 64 1 0
79 43 1 0
41 79 1 0
80 49 1 0
45 80 1 0
72 25 1 0
20 72 1 0
55 81 1 0
4 68 1 0
68 6 1 0
82 56 1 0
51 82 1 0
30 73 1 0
59 83 1 0
M END| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Natural Product: No | Oral: No | Chemical Probe: No | Parenteral: No |
| Molecule Type: Protein | Topical: No | First In Class: No | Black Box: No |
| Chirality: No | Availability: No | Prodrug: No |
| MESH ID | MESH Heading | EFO IDs | EFO Terms | Max Phase for Indication | References |
|---|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| Molecular Weight: 1187.42 | Molecular Weight (Monoisotopic): 1186.7258 | AlogP: ┄ | #Rotatable Bonds: ┄ |
| Polar Surface Area: ┄ | Molecular Species: ┄ | HBA: ┄ | HBD: ┄ |
| #RO5 Violations: ┄ | HBA (Lipinski): ┄ | HBD (Lipinski): ┄ | #RO5 Violations (Lipinski): ┄ |
| CX Acidic pKa: ┄ | CX Basic pKa: ┄ | CX LogP: ┄ | CX LogD: ┄ |
| Aromatic Rings: ┄ | Heavy Atoms: ┄ | QED Weighted: ┄ | Np Likeness Score: ┄ |
| 1. Karatas H, Townsend EC, Bernard D, Dou Y, Wang S.. (2010) Analysis of the binding of mixed lineage leukemia 1 (MLL1) and histone 3 peptides to WD repeat domain 5 (WDR5) for the design of inhibitors of the MLL1-WDR5 interaction., 53 (14): [PMID:20575550] [10.1021/jm100139b] |
| 2. Karatas, Hacer H, Townsend, Elizabeth C EC, Bernard, Denzil D, Dou, Yali Y and Wang, Shaomeng S. 2010-07-22 Analysis of the binding of mixed lineage leukemia 1 (MLL1) and histone 3 peptides to WD repeat domain 5 (WDR5) for the design of inhibitors of the MLL1-WDR5 interaction. [PMID:20575550] |
| 3. Bolshan, Yuri Y and 16 more authors. 2013-03-14 Synthesis, Optimization, and Evaluation of Novel Small Molecules as Antagonists of WDR5-MLL Interaction. [PMID:24900672] |
| 4. Getlik, Matthäus M and 17 more authors. 2016-03-24 Structure-Based Optimization of a Small Molecule Antagonist of the Interaction Between WD Repeat-Containing Protein 5 (WDR5) and Mixed-Lineage Leukemia 1 (MLL1). [PMID:26958703] |
| 5. Li, Dong-Dong DD and 9 more authors. 2016-08-08 Structure-based design and synthesis of small molecular inhibitors disturbing the interaction of MLL1-WDR5. [PMID:27116709] |
| 6. Li, Dong-Dong DD and 8 more authors. 2016-11-29 High-affinity small molecular blockers of mixed lineage leukemia 1 (MLL1)-WDR5 interaction inhibit MLL1 complex H3K4 methyltransferase activity. [PMID:27598236] |
| 7. Li, Dong-Dong DD and 5 more authors. 2016-11-15 Structure-based design of ester compounds to inhibit MLL complex catalytic activity by targeting mixed lineage leukemia 1 (MLL1)-WDR5 interaction. [PMID:27720555] |
| 8. Wang, Feng F and 17 more authors. 2018-07-12 Discovery of Potent 2-Aryl-6,7-dihydro-5 H-pyrrolo[1,2- a]imidazoles as WDR5-WIN-Site Inhibitors Using Fragment-Based Methods and Structure-Based Design. [PMID:29889518] |
| 9. Ye, Xiaoqing X and 11 more authors. 2019-02-15 The identification of novel small-molecule inhibitors targeting WDR5-MLL1 interaction through fluorescence polarization based high-throughput screening. [PMID:30626558] |
| 10. Tian, Jianhua and 24 more authors. 2020-01-23 Discovery and Structure-Based Optimization of Potent and Selective WD Repeat Domain 5 (WDR5) Inhibitors Containing a Dihydroisoquinolinone Bicyclic Core. [PMID:31858797] |
| 11. Chacón Simon, Selena and 14 more authors. 2020-04-23 Discovery of WD Repeat-Containing Protein 5 (WDR5)-MYC Inhibitors Using Fragment-Based Methods and Structure-Based Design. [PMID:32223236] |
Source(1):