The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-acetylpolyveoline ID: ALA1082369
PubChem CID: 46871720
Max Phase: Preclinical
Molecular Formula: C25H35NO2
Molecular Weight: 381.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: N-Acetylpolyveoline | CHEMBL1082369
Canonical SMILES: CC(=O)N1c2ccccc2[C@H]2[C@@H]1C[C@@H]1[C@@]2(C)CC[C@H]2C(C)(C)[C@H](O)CC[C@]12C
Standard InChI: InChI=1S/C25H35NO2/c1-15(27)26-17-9-7-6-8-16(17)22-18(26)14-20-24(4)13-11-21(28)23(2,3)19(24)10-12-25(20,22)5/h6-9,18-22,28H,10-14H2,1-5H3/t18-,19-,20-,21+,22-,24-,25+/m0/s1
Standard InChI Key: OGSHVAKUSGJWTH-FQBMDWTRSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
9.6627 -6.7543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6537 -7.5793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3620 -7.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3796 -6.3396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0877 -6.7666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0804 -7.5916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7871 -8.0074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5078 -7.6011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8019 -6.3576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5140 -6.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9815 -5.5480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8081 -5.4716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1316 -6.2376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4299 -4.9275 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1430 -5.3519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9558 -6.1570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5590 -6.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3499 -6.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5323 -5.6675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9267 -5.1082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9335 -8.7021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0855 -5.9416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7897 -7.1805 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.5120 -5.9539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0654 -8.4143 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.5618 -8.7916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9377 -7.9848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4267 -7.0057 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.5030 -4.7072 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.4177 -4.1047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1242 -3.6828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6991 -3.7038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 6 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 1 0
10 13 1 0
12 11 1 0
11 9 1 0
12 13 1 0
13 16 1 0
15 14 1 0
14 12 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
3 21 1 0
5 22 1 1
9 23 1 1
10 24 1 1
6 25 1 6
3 26 1 0
2 27 1 6
1 2 1 0
13 28 1 1
1 4 1 0
12 29 1 1
2 3 1 0
14 30 1 0
3 6 1 0
30 31 2 0
5 4 1 0
30 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 381.56Molecular Weight (Monoisotopic): 381.2668AlogP: 5.13#Rotatable Bonds: ┄Polar Surface Area: 40.54Molecular Species: NEUTRALHBA: 2HBD: 1#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.91CX LogD: 3.91Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.68Np Likeness Score: 1.57
References 1. Ngantchou I, Nyasse B, Denier C, Blonski C, Hannaert V, Schneider B.. (2010) Antitrypanosomal alkaloids from Polyalthia suaveolens (Annonaceae): their effects on three selected glycolytic enzymes of Trypanosoma brucei., 20 (12): [PMID:20529682 ] [10.1016/j.bmcl.2010.04.145 ]