5-(dibenzo[b,d]thiophen-4-yl)-3-morpholino-1H-isochromen-1-one

ID: ALA1082377

PubChem CID: 46871847

Max Phase: Preclinical

Molecular Formula: C25H19NO3S

Molecular Weight: 413.50

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=c1oc(N2CCOCC2)cc2c(-c3cccc4c3sc3ccccc34)cccc12

Standard InChI:  InChI=1S/C25H19NO3S/c27-25-20-9-3-6-16(21(20)15-23(29-25)26-11-13-28-14-12-26)18-7-4-8-19-17-5-1-2-10-22(17)30-24(18)19/h1-10,15H,11-14H2

Standard InChI Key:  HIXSAQJSWPMYFZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 35  0  0  0  0  0  0  0  0999 V2000
    8.1462  -24.6668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8595  -24.2573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8574  -23.4323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1405  -23.0143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4286  -24.2638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4215  -23.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6458  -24.5242    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.1574  -23.8599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6330  -23.1949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2948  -22.4485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4770  -22.3700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9987  -23.0399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3437  -23.7837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1429  -25.4910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5697  -27.1409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2860  -26.7277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2814  -25.8970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5715  -27.9667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9946  -25.4777    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7163  -25.8894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4233  -25.4736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4226  -24.6475    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7087  -24.2387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9913  -24.6520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5643  -25.4887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8532  -26.7315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8558  -25.9063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4269  -25.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4283  -26.7326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1418  -27.1400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  4  2  0
  6  9  1  0
 26 15  1  0
  8  7  1  0
 15 16  1  0
  7  5  1  0
 16 17  1  0
 17 25  2  0
  5  1  1  0
 15 18  2  0
  6  4  1  0
 17 19  1  0
 19 20  1  0
  8  9  2  0
  1  2  2  0
  9 10  1  0
  5  6  2  0
 10 11  2  0
 19 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 27 25  1  0
 11 12  1  0
  2  3  1  0
 26 27  2  0
 27 14  1  0
 12 13  2  0
 14 28  2  0
 13  8  1  0
 28 29  1  0
 14  1  1  0
 29 30  2  0
 30 26  1  0
M  END

Associated Targets(Human)

PRKDC Tchem DNA-dependent protein kinase (1929 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 413.50Molecular Weight (Monoisotopic): 413.1086AlogP: 5.66#Rotatable Bonds: 2
Polar Surface Area: 42.68Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 2.20CX LogP: 5.77CX LogD: 5.77
Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.37Np Likeness Score: -0.71

References

1. Payne SL, Rodriguez-Aristegui S, Bardos J, Cano C, Golding BT, Hardcastle IR, Peacock M, Parveen N, Griffin RJ..  (2010)  Mapping the ATP-binding domain of DNA-dependent protein kinase (DNA-PK) with coumarin- and isocoumarin-derived inhibitors.,  20  (12): [PMID:20472428] [10.1016/j.bmcl.2010.04.102]

Source