N-Methyl-4-[7-(4-cyano-3-trifluoromethylphenyl)-8-oxo-6-thioxo-5,7-diazaspiro[3.4]oct-5-yl]benzamide

ID: ALA1082405

PubChem CID: 15952000

Max Phase: Preclinical

Molecular Formula: C22H17F3N4O2S

Molecular Weight: 458.47

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNC(=O)c1ccc(N2C(=S)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C23CCC3)cc1

Standard InChI:  InChI=1S/C22H17F3N4O2S/c1-27-18(30)13-3-6-15(7-4-13)29-20(32)28(19(31)21(29)9-2-10-21)16-8-5-14(12-26)17(11-16)22(23,24)25/h3-8,11H,2,9-10H2,1H3,(H,27,30)

Standard InChI Key:  IJXGISWNZBHSFJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   11.8000  -22.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3835  -23.6446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0956  -24.0611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5121  -23.3489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9109  -20.5523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9097  -21.3793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6242  -21.7920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3403  -21.3788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3374  -20.5487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6224  -20.1398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1956  -20.1344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4813  -19.7223    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1953  -21.7910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4815  -21.3782    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.1947  -22.6156    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.9825  -20.9944    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.0076  -21.8555    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0149  -22.6801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2802  -22.2566    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7896  -21.5939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3521  -23.1707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0374  -20.8075    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.1037  -22.2477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5234  -22.9597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3480  -22.9512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7539  -22.2315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3291  -21.5188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5060  -21.5307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5784  -22.2216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9821  -21.5025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9993  -22.9307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5956  -23.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  4  1  0
  5  6  2  0
  7  8  2  0
 11 12  3  0
  5 11  1  0
 18  1  1  0
  1 19  1  0
 19 20  1  0
 20 17  1  0
  8 17  1  0
 18 21  2  0
  6 13  1  0
 20 22  2  0
 19 23  1  0
  8  9  1  0
 13 14  1  0
 23 24  2  0
  6  7  1  0
 24 25  1  0
 13 15  1  0
 25 26  2  0
  9 10  2  0
 26 27  1  0
 13 16  1  0
 27 28  2  0
 28 23  1  0
 17 18  1  0
 10  5  1  0
  4  1  1  0
 26 29  1  0
 29 30  2  0
  1  2  1  0
 29 31  1  0
  2  3  1  0
 31 32  1  0
M  END

Associated Targets(non-human)

Ar Androgen Receptor (5522 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 458.47Molecular Weight (Monoisotopic): 458.1024AlogP: 4.00#Rotatable Bonds: 3
Polar Surface Area: 76.44Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.15CX LogD: 4.15
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.70Np Likeness Score: -1.22

References

1. Jung ME, Ouk S, Yoo D, Sawyers CL, Chen C, Tran C, Wongvipat J..  (2010)  Structure-activity relationship for thiohydantoin androgen receptor antagonists for castration-resistant prostate cancer (CRPC).,  53  (7): [PMID:20218717] [10.1021/jm901488g]

Source