The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Methyl-4-[7-(4-cyano-3-trifluoromethylphenyl)-8-oxo-6-thioxo-5,7-diazaspiro[3.4]oct-5-yl]benzamide ID: ALA1082405
PubChem CID: 15952000
Max Phase: Preclinical
Molecular Formula: C22H17F3N4O2S
Molecular Weight: 458.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)c1ccc(N2C(=S)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C23CCC3)cc1
Standard InChI: InChI=1S/C22H17F3N4O2S/c1-27-18(30)13-3-6-15(7-4-13)29-20(32)28(19(31)21(29)9-2-10-21)16-8-5-14(12-26)17(11-16)22(23,24)25/h3-8,11H,2,9-10H2,1H3,(H,27,30)
Standard InChI Key: IJXGISWNZBHSFJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
11.8000 -22.9324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3835 -23.6446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0956 -24.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5121 -23.3489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9109 -20.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9097 -21.3793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6242 -21.7920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3403 -21.3788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3374 -20.5487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6224 -20.1398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1956 -20.1344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4813 -19.7223 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1953 -21.7910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4815 -21.3782 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.1947 -22.6156 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.9825 -20.9944 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.0076 -21.8555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0149 -22.6801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2802 -22.2566 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7896 -21.5939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3521 -23.1707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0374 -20.8075 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.1037 -22.2477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5234 -22.9597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3480 -22.9512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7539 -22.2315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3291 -21.5188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5060 -21.5307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5784 -22.2216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9821 -21.5025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9993 -22.9307 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5956 -23.6498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 4 1 0
5 6 2 0
7 8 2 0
11 12 3 0
5 11 1 0
18 1 1 0
1 19 1 0
19 20 1 0
20 17 1 0
8 17 1 0
18 21 2 0
6 13 1 0
20 22 2 0
19 23 1 0
8 9 1 0
13 14 1 0
23 24 2 0
6 7 1 0
24 25 1 0
13 15 1 0
25 26 2 0
9 10 2 0
26 27 1 0
13 16 1 0
27 28 2 0
28 23 1 0
17 18 1 0
10 5 1 0
4 1 1 0
26 29 1 0
29 30 2 0
1 2 1 0
29 31 1 0
2 3 1 0
31 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.47Molecular Weight (Monoisotopic): 458.1024AlogP: 4.00#Rotatable Bonds: 3Polar Surface Area: 76.44Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.15CX LogD: 4.15Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.70Np Likeness Score: -1.22
References 1. Jung ME, Ouk S, Yoo D, Sawyers CL, Chen C, Tran C, Wongvipat J.. (2010) Structure-activity relationship for thiohydantoin androgen receptor antagonists for castration-resistant prostate cancer (CRPC)., 53 (7): [PMID:20218717 ] [10.1021/jm901488g ]