The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(5-(2-fluoro-4-hydroxyphenyl)-8-oxo-6-thioxo-5,7-diazaspiro[3.4]octan-7-yl)-2-(trifluoromethyl)benzonitrile ID: ALA1082406
PubChem CID: 15951528
Max Phase: Preclinical
Molecular Formula: C20H13F4N3O2S
Molecular Weight: 435.40
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccc(N2C(=O)C3(CCC3)N(c3ccc(O)cc3F)C2=S)cc1C(F)(F)F
Standard InChI: InChI=1S/C20H13F4N3O2S/c21-15-9-13(28)4-5-16(15)27-18(30)26(17(29)19(27)6-1-7-19)12-3-2-11(10-25)14(8-12)20(22,23)24/h2-5,8-9,28H,1,6-7H2
Standard InChI Key: STEOIDKTSDJLHB-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
5.4452 -26.5532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0286 -27.2653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7408 -27.6818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1573 -26.9696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5558 -24.1729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5546 -24.9999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2691 -25.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9853 -24.9994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9824 -24.1693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2673 -23.7604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8404 -23.7550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1261 -23.3428 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8401 -25.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1263 -24.9988 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.8395 -26.2363 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.6273 -24.6150 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.6526 -25.4762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6599 -26.3009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9252 -25.8773 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4347 -25.2145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9971 -26.7915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6825 -24.4281 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.7488 -25.8684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1686 -26.5804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9933 -26.5719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3992 -25.8522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9744 -25.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1511 -25.1514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2238 -25.8423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7633 -27.2985 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
5 6 2 0
7 8 2 0
11 12 3 0
5 11 1 0
18 1 1 0
1 19 1 0
19 20 1 0
20 17 1 0
8 17 1 0
18 21 2 0
6 13 1 0
20 22 2 0
19 23 1 0
8 9 1 0
13 14 1 0
23 24 2 0
6 7 1 0
24 25 1 0
13 15 1 0
25 26 2 0
9 10 2 0
26 27 1 0
13 16 1 0
27 28 2 0
28 23 1 0
17 18 1 0
10 5 1 0
4 1 1 0
26 29 1 0
24 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 435.40Molecular Weight (Monoisotopic): 435.0665AlogP: 4.48#Rotatable Bonds: 2Polar Surface Area: 67.57Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.60CX Basic pKa: ┄CX LogP: 4.91CX LogD: 4.89Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.56Np Likeness Score: -1.07
References 1. Jung ME, Ouk S, Yoo D, Sawyers CL, Chen C, Tran C, Wongvipat J.. (2010) Structure-activity relationship for thiohydantoin androgen receptor antagonists for castration-resistant prostate cancer (CRPC)., 53 (7): [PMID:20218717 ] [10.1021/jm901488g ]