1-(9H-carbazol-4-yloxy)-3-(4-(4-methoxybenzyl)piperidin-1-yl)propan-2-ol

ID: ALA1082500

PubChem CID: 46889811

Max Phase: Preclinical

Molecular Formula: C28H32N2O3

Molecular Weight: 444.58

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(CC2CCN(CC(O)COc3cccc4[nH]c5ccccc5c34)CC2)cc1

Standard InChI:  InChI=1S/C28H32N2O3/c1-32-23-11-9-20(10-12-23)17-21-13-15-30(16-14-21)18-22(31)19-33-27-8-4-7-26-28(27)24-5-2-3-6-25(24)29-26/h2-12,21-22,29,31H,13-19H2,1H3

Standard InChI Key:  GYVPBQWEZRVOPO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   10.4009  -20.2301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1170  -19.8169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1142  -18.9866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8269  -18.5716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5427  -18.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2554  -18.5662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9712  -18.9758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2523  -17.7414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6840  -18.5608    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3996  -18.9736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1102  -18.5621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1114  -17.7369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3957  -17.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6789  -17.7383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8257  -17.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6863  -19.8174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6792  -18.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3950  -18.5752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0657  -18.4343    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4022  -17.6798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2207  -17.7669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7035  -17.1025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3689  -16.3508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5468  -16.2674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0677  -16.9327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5399  -17.7370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5379  -18.5623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2514  -18.9746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9666  -18.5622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9640  -17.7332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2500  -17.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6777  -18.9757    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3914  -18.5624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  2  0
  6  7  1  0
 17 18  1  0
  3 18  2  0
  6  8  1  0
 18 21  1  0
 20 19  1  0
 19 17  1  0
  7  9  1  0
  9 10  1  0
 20 21  2  0
  3  4  1  0
 21 22  1  0
  1  2  2  0
 22 23  2  0
  4  5  1  0
 23 24  1  0
 16  1  1  0
 24 25  2  0
 25 20  1  0
  5  6  1  0
 15 26  1  0
  9 14  1  0
 26 27  2  0
 10 11  1  0
 27 28  1  0
 11 12  1  0
 28 29  2  0
 12 13  1  0
 29 30  1  0
 13 14  1  0
 30 31  2  0
 31 26  1  0
  2  3  1  0
 12 15  1  0
 32 33  1  0
 29 32  1  0
M  END

Associated Targets(Human)

ADRB1 Tclin Beta-1 adrenergic receptor (6630 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRB2 Tclin Beta-2 adrenergic receptor (11824 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRB3 Tclin Beta-3 adrenergic receptor (5850 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 444.58Molecular Weight (Monoisotopic): 444.2413AlogP: 5.02#Rotatable Bonds: 8
Polar Surface Area: 57.72Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.98CX LogP: 4.88CX LogD: 3.30
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.40Np Likeness Score: -0.34

References

1. Tasler S, Baumgartner R, Aschenbrenner A, Ammendola A, Wolf K, Wieber T, Schachtner J, Blisse M, Quotschalla U, Ney P..  (2010)  A vHTS approach for the identification of beta-adrenoceptor ligands.,  20  (11): [PMID:20434333] [10.1016/j.bmcl.2010.04.009]

Source