The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(9H-carbazol-4-yloxy)-3-(4-(4-methoxybenzyl)piperidin-1-yl)propan-2-ol ID: ALA1082500
PubChem CID: 46889811
Max Phase: Preclinical
Molecular Formula: C28H32N2O3
Molecular Weight: 444.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CC2CCN(CC(O)COc3cccc4[nH]c5ccccc5c34)CC2)cc1
Standard InChI: InChI=1S/C28H32N2O3/c1-32-23-11-9-20(10-12-23)17-21-13-15-30(16-14-21)18-22(31)19-33-27-8-4-7-26-28(27)24-5-2-3-6-25(24)29-26/h2-12,21-22,29,31H,13-19H2,1H3
Standard InChI Key: GYVPBQWEZRVOPO-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
10.4009 -20.2301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1170 -19.8169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1142 -18.9866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8269 -18.5716 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5427 -18.9812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2554 -18.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9712 -18.9758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2523 -17.7414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6840 -18.5608 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3996 -18.9736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1102 -18.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1114 -17.7369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3957 -17.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6789 -17.7383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8257 -17.3246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6863 -19.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6792 -18.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3950 -18.5752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0657 -18.4343 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4022 -17.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2207 -17.7669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7035 -17.1025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3689 -16.3508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5468 -16.2674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0677 -16.9327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5399 -17.7370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5379 -18.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2514 -18.9746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9666 -18.5622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9640 -17.7332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2500 -17.3246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6777 -18.9757 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3914 -18.5624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16 17 2 0
6 7 1 0
17 18 1 0
3 18 2 0
6 8 1 0
18 21 1 0
20 19 1 0
19 17 1 0
7 9 1 0
9 10 1 0
20 21 2 0
3 4 1 0
21 22 1 0
1 2 2 0
22 23 2 0
4 5 1 0
23 24 1 0
16 1 1 0
24 25 2 0
25 20 1 0
5 6 1 0
15 26 1 0
9 14 1 0
26 27 2 0
10 11 1 0
27 28 1 0
11 12 1 0
28 29 2 0
12 13 1 0
29 30 1 0
13 14 1 0
30 31 2 0
31 26 1 0
2 3 1 0
12 15 1 0
32 33 1 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.58Molecular Weight (Monoisotopic): 444.2413AlogP: 5.02#Rotatable Bonds: 8Polar Surface Area: 57.72Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.98CX LogP: 4.88CX LogD: 3.30Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.40Np Likeness Score: -0.34
References 1. Tasler S, Baumgartner R, Aschenbrenner A, Ammendola A, Wolf K, Wieber T, Schachtner J, Blisse M, Quotschalla U, Ney P.. (2010) A vHTS approach for the identification of beta-adrenoceptor ligands., 20 (11): [PMID:20434333 ] [10.1016/j.bmcl.2010.04.009 ]