The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1-(3-(9H-carbazol-4-yloxy)-2-hydroxypropyl)piperidin-4-yl)(4-methoxyphenyl)methanone ID: ALA1082828
PubChem CID: 46889853
Max Phase: Preclinical
Molecular Formula: C28H30N2O4
Molecular Weight: 458.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(=O)C2CCN(CC(O)COc3cccc4[nH]c5ccccc5c34)CC2)cc1
Standard InChI: InChI=1S/C28H30N2O4/c1-33-22-11-9-19(10-12-22)28(32)20-13-15-30(16-14-20)17-21(31)18-34-26-8-4-7-25-27(26)23-5-2-3-6-24(23)29-25/h2-12,20-21,29,31H,13-18H2,1H3
Standard InChI Key: NRJOGQSIFAHXIH-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-2.9833 -2.0775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2670 -1.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2698 -0.8337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5569 -0.4186 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8410 -0.8283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1282 -0.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5877 -0.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1313 0.4117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3007 -0.4079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0164 -0.8207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7271 -0.4092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7283 0.4162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0125 0.8281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2956 0.4148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4428 0.8286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6980 -1.6646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7051 -0.8347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9892 -0.4222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3187 -0.2813 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9821 0.4733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1635 0.3863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6806 1.0507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0153 1.8026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8375 1.8860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3167 1.2206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1571 0.4162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1551 -0.4094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8687 -0.8217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5840 -0.4093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5814 0.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8673 0.8286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4428 1.6535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2990 -0.8208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3001 -1.6457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 7 1 0
17 18 1 0
3 18 2 0
6 8 1 0
18 21 1 0
20 19 1 0
19 17 1 0
7 9 1 0
9 10 1 0
20 21 2 0
3 4 1 0
21 22 1 0
1 2 2 0
22 23 2 0
4 5 1 0
23 24 1 0
16 1 1 0
24 25 2 0
25 20 1 0
5 6 1 0
15 26 1 0
9 14 1 0
26 27 2 0
10 11 1 0
27 28 1 0
11 12 1 0
28 29 2 0
12 13 1 0
29 30 1 0
13 14 1 0
30 31 2 0
31 26 1 0
2 3 1 0
15 32 2 0
12 15 1 0
29 33 1 0
16 17 2 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.56Molecular Weight (Monoisotopic): 458.2206AlogP: 4.66#Rotatable Bonds: 8Polar Surface Area: 74.79Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.89CX LogP: 3.99CX LogD: 3.38Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.38Np Likeness Score: -0.55
References 1. Tasler S, Baumgartner R, Aschenbrenner A, Ammendola A, Wolf K, Wieber T, Schachtner J, Blisse M, Quotschalla U, Ney P.. (2010) A vHTS approach for the identification of beta-adrenoceptor ligands., 20 (11): [PMID:20434333 ] [10.1016/j.bmcl.2010.04.009 ]