The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(1-(3-(9H-carbazol-4-yloxy)-2-hydroxypropyl)piperidin-4-yl)-1H-benzo[de]isoquinoline-1,3(2H)-dione ID: ALA1083363
PubChem CID: 46889809
Max Phase: Preclinical
Molecular Formula: C32H29N3O4
Molecular Weight: 519.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C1c2cccc3cccc(c23)C(=O)N1C1CCN(CC(O)COc2cccc3[nH]c4ccccc4c23)CC1
Standard InChI: InChI=1S/C32H29N3O4/c36-22(19-39-28-13-5-12-27-30(28)23-8-1-2-11-26(23)33-27)18-34-16-14-21(15-17-34)35-31(37)24-9-3-6-20-7-4-10-25(29(20)24)32(35)38/h1-13,21-22,33,36H,14-19H2
Standard InChI Key: CFGRSSGFUGIJMC-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 45 0 0 0 0 0 0 0 0999 V2000
18.2119 -11.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9367 -11.5855 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6417 -12.0236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9573 -10.7673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3620 -11.6299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0590 -12.0628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7839 -11.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8075 -10.8499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6861 -10.3752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3862 -10.8089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1097 -10.4194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1344 -9.5965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4295 -9.1645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7088 -9.5564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6187 -12.8483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2544 -10.3353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4997 -14.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2162 -14.0602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2133 -13.2297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9262 -12.8145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6422 -13.2243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3552 -12.8091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0712 -13.2189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3520 -11.9841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7841 -12.8037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5000 -13.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2108 -12.8050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4961 -11.5676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7790 -11.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7849 -14.0607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7778 -13.2306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4938 -12.8181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1643 -12.6772 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5009 -11.9225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3196 -12.0096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8024 -11.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4677 -10.5931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6455 -10.5097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1663 -11.1752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8 11 2 0
18 19 1 0
19 32 2 0
3 5 1 0
19 20 1 0
9 4 1 0
20 21 1 0
9 10 1 0
21 22 1 0
2 3 1 0
22 23 1 0
10 11 1 0
22 24 1 0
10 5 2 0
23 25 1 0
25 26 1 0
11 12 1 0
12 13 2 0
5 6 1 0
25 29 1 0
26 27 1 0
27 1 1 0
1 28 1 0
28 29 1 0
30 31 2 0
13 14 1 0
31 32 1 0
14 9 2 0
1 2 1 0
3 15 2 0
32 35 1 0
34 33 1 0
33 31 1 0
6 7 2 0
4 16 2 0
34 35 2 0
2 4 1 0
35 36 1 0
30 17 1 0
36 37 2 0
7 8 1 0
37 38 1 0
17 18 2 0
38 39 2 0
39 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.60Molecular Weight (Monoisotopic): 519.2158AlogP: 4.97#Rotatable Bonds: 6Polar Surface Area: 85.87Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.03CX LogP: 4.06CX LogD: 3.34Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.31Np Likeness Score: -0.47
References 1. Tasler S, Baumgartner R, Aschenbrenner A, Ammendola A, Wolf K, Wieber T, Schachtner J, Blisse M, Quotschalla U, Ney P.. (2010) A vHTS approach for the identification of beta-adrenoceptor ligands., 20 (11): [PMID:20434333 ] [10.1016/j.bmcl.2010.04.009 ]