The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-[3-(3,5-Dichloro-benzoylamino)-2,2-dimethyl-nonanoylamino]-3-phenyl-propionic acid ethyl ester ID: ALA108343
PubChem CID: 44338853
Max Phase: Preclinical
Molecular Formula: C29H38Cl2N2O4
Molecular Weight: 549.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCC(NC(=O)c1cc(Cl)cc(Cl)c1)C(C)(C)C(=O)N[C@@H](Cc1ccccc1)C(=O)OCC
Standard InChI: InChI=1S/C29H38Cl2N2O4/c1-5-7-8-12-15-25(33-26(34)21-17-22(30)19-23(31)18-21)29(3,4)28(36)32-24(27(35)37-6-2)16-20-13-10-9-11-14-20/h9-11,13-14,17-19,24-25H,5-8,12,15-16H2,1-4H3,(H,32,36)(H,33,34)/t24-,25?/m0/s1
Standard InChI Key: JTGHENRHNSIXGJ-SKCDSABHSA-N
Molfile:
RDKit 2D
37 38 0 0 1 0 0 0 0 0999 V2000
6.6667 -10.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9542 -11.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8167 -10.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3792 -11.3042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5292 -11.3125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1042 -11.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2417 -10.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0917 -10.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8042 -11.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6667 -10.0667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3917 -10.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1042 -12.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8167 -10.0792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4000 -12.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6792 -11.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6792 -12.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0917 -10.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8042 -12.1250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5167 -10.8792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9625 -10.9000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.3917 -13.3667 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.5417 -12.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3667 -12.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8042 -9.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2417 -10.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2292 -11.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5167 -10.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8000 -8.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5292 -9.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8167 -7.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8167 -8.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5292 -8.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9500 -10.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1042 -7.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5042 -8.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2292 -9.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2292 -8.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 5 1 0
4 1 1 0
5 7 1 0
6 3 1 0
7 2 1 0
8 4 1 0
9 8 1 0
10 1 2 0
11 6 2 0
12 6 1 0
13 3 2 0
14 12 2 0
15 11 1 0
16 14 1 0
8 17 1 1
18 9 2 0
19 9 1 0
20 15 1 0
21 14 1 0
22 2 1 0
23 2 1 0
24 17 1 0
25 7 1 0
26 19 1 0
27 24 2 0
28 24 1 0
29 25 1 0
30 31 1 0
31 32 1 0
32 29 1 0
33 26 1 0
34 30 1 0
35 28 2 0
36 27 1 0
37 35 1 0
37 36 2 0
16 15 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 549.54Molecular Weight (Monoisotopic): 548.2209AlogP: 6.38#Rotatable Bonds: 14Polar Surface Area: 84.50Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.08CX Basic pKa: ┄CX LogP: 7.41CX LogD: 7.41Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.21Np Likeness Score: -0.42
References 1. Iijima K, Katada J, Yasuda E, Uno I, Hayashi Y.. (1999) N-[2,2-dimethyl-3-(N-(4-cyanobenzoyl)amino)nonanoyl]-L-phenylalanine ethyl ester as a stable ester-type inhibitor of chymotrypsin-like serine proteases: structural requirements for potent inhibition of alpha-chymotrypsin., 42 (2): [PMID:9925737 ] [10.1021/jm980562h ]