The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-(1-(3-chloro-1-(3-chlorobenzyl)-1H-indole-7-carboxamido)ethyl)benzoic acid ID: ALA1083445
PubChem CID: 24765675
Max Phase: Preclinical
Molecular Formula: C25H20Cl2N2O3
Molecular Weight: 467.35
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](NC(=O)c1cccc2c(Cl)cn(Cc3cccc(Cl)c3)c12)c1ccc(C(=O)O)cc1
Standard InChI: InChI=1S/C25H20Cl2N2O3/c1-15(17-8-10-18(11-9-17)25(31)32)28-24(30)21-7-3-6-20-22(27)14-29(23(20)21)13-16-4-2-5-19(26)12-16/h2-12,14-15H,13H2,1H3,(H,28,30)(H,31,32)/t15-/m0/s1
Standard InChI Key: RMUKIVLVEMOFHB-HNNXBMFYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
12.2611 2.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2599 1.6268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6883 2.4578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9729 2.8670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6912 1.6273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9737 1.2153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1438 0.4055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9665 0.3171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3042 1.0722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1289 1.0943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5605 0.3912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4012 2.8730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1172 2.4632 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3981 3.6980 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8302 2.8784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5462 2.4686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5462 1.6447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2613 1.2350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9752 1.6503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9695 2.4795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2537 2.8855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8270 3.7034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6942 1.2426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6984 0.4176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4066 1.6587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1627 -0.3323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5936 -1.0349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4192 -1.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8120 -0.2829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3789 0.4168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5903 -0.2063 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
17.6366 -0.2578 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3 4 2 0
15 16 1 0
6 7 1 0
16 17 2 0
7 8 2 0
17 18 1 0
8 9 1 0
18 19 2 0
9 5 1 0
19 20 1 0
4 1 1 0
20 21 2 0
21 16 1 0
9 10 1 0
15 22 1 1
5 6 2 0
10 11 1 0
2 6 1 0
23 24 1 0
23 25 2 0
19 23 1 0
3 12 1 0
11 26 2 0
26 27 1 0
12 13 1 0
27 28 2 0
5 3 1 0
28 29 1 0
12 14 2 0
29 30 2 0
30 11 1 0
1 2 2 0
7 31 1 0
13 15 1 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.35Molecular Weight (Monoisotopic): 466.0851AlogP: 6.19#Rotatable Bonds: 6Polar Surface Area: 71.33Molecular Species: ACIDHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.06CX Basic pKa: ┄CX LogP: 6.10CX LogD: 2.98Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: -1.15
References 1. Colucci J, Boyd M, Berthelette C, Chiasson JF, Wang Z, Ducharme Y, Friesen R, Wrona M, Levesque JF, Denis D, Mathieu MC, Stocco R, Therien AG, Clarke P, Rowland S, Xu D, Han Y.. (2010) Discovery of 4-[1-[([1-[4-(trifluoromethyl)benzyl]-1H-indol-7-yl]carbonyl)amino]cyclopropyl]benzoic acid (MF-766), a highly potent and selective EP4 antagonist for treating inflammatory pain., 20 (12): [PMID:20471829 ] [10.1016/j.bmcl.2010.04.065 ]