The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Biphenyl-4-carboxylic Acid(1-{(S)-1-Benzyl-4-[4-(tetrahydropyran-4-ylmethyl)piperazin-1-yl]butylcarbamoyl}cyclopentyl)-amide ID: ALA1083560
PubChem CID: 46237957
Max Phase: Preclinical
Molecular Formula: C40H52N4O3
Molecular Weight: 636.88
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC1(C(=O)N[C@@H](CCCN2CCN(CC3CCOCC3)CC2)Cc2ccccc2)CCCC1)c1ccc(-c2ccccc2)cc1
Standard InChI: InChI=1S/C40H52N4O3/c45-38(36-17-15-35(16-18-36)34-12-5-2-6-13-34)42-40(21-7-8-22-40)39(46)41-37(30-32-10-3-1-4-11-32)14-9-23-43-24-26-44(27-25-43)31-33-19-28-47-29-20-33/h1-6,10-13,15-18,33,37H,7-9,14,19-31H2,(H,41,46)(H,42,45)/t37-/m0/s1
Standard InChI Key: PGRZDFUKUNJXDD-QNGWXLTQSA-N
Molfile:
RDKit 2D
47 52 0 0 0 0 0 0 0 0999 V2000
18.2956 0.0148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0081 0.4314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8320 1.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0106 1.3196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6792 0.5637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1500 -0.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8645 0.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5789 -0.4000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8645 0.8375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0079 -0.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7224 0.0125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0079 -1.2250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4368 -0.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1513 0.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4368 -1.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1513 -1.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1472 -2.4636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8609 -2.8760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5763 -2.4634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5737 -1.6342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8594 -1.2255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8658 -0.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5802 0.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2947 -0.4000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2894 -1.2260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9998 -1.6384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7167 -1.2294 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.7186 -0.4034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0037 0.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4296 -1.6446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1456 -1.2348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8548 -1.6551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5687 -1.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5761 -0.4235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8633 -0.0061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1432 -0.4140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4360 0.0154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7220 -0.3964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7216 -1.2222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4411 -1.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1521 -1.2204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0101 -1.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2948 -1.2230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5813 -1.6357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5820 -2.4616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3020 -2.8730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0125 -2.4579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22 23 1 0
1 2 1 0
23 24 1 0
24 25 1 0
10 12 2 0
13 11 1 0
6 7 1 0
13 14 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
2 3 1 0
27 30 1 0
13 15 1 1
30 31 1 0
31 32 1 0
7 8 1 0
15 16 1 0
3 4 1 0
16 17 2 0
7 9 2 0
31 36 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
17 18 1 0
6 37 2 0
8 1 1 0
37 38 1 0
18 19 2 0
38 39 2 0
4 5 1 0
39 40 1 0
19 20 1 0
40 41 2 0
41 6 1 0
1 10 1 0
20 21 2 0
42 43 2 0
21 16 1 0
43 44 1 0
5 1 1 0
44 45 2 0
14 22 1 0
45 46 1 0
10 11 1 0
46 47 2 0
47 42 1 0
39 42 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 636.88Molecular Weight (Monoisotopic): 636.4039AlogP: 5.95#Rotatable Bonds: 13Polar Surface Area: 73.91Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.82CX LogP: 6.11CX LogD: 4.68Aromatic Rings: 3Heavy Atoms: 47QED Weighted: 0.24Np Likeness Score: -0.71
References 1. Fattori D, Porcelloni M, D'Andrea P, Catalioto RM, Ettorre A, Giuliani S, Marastoni E, Mauro S, Meini S, Rossi C, Altamura M, Maggi CA.. (2010) Structure-activity relationships of 6-methyl-benzo[b]thiophene-2-carboxylic acid (1-[(S)-1-benzyl-4-[4-(tetrahydropyran-4-ylmethyl)piperazin-1-yl]butylcarbamoyl]cyclopentyl)amide, potent antagonist of the neurokinin-2 receptor., 53 (10): [PMID:20408549 ] [10.1021/jm100176s ]