The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-O-acetylgreenwayodendrin ID: ALA1083629
PubChem CID: 46891355
Max Phase: Preclinical
Molecular Formula: C25H33NO2
Molecular Weight: 379.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: 3-O-Acetylgreenwayodendrin | 3-O-acetylgreenwayodendrin|CHEMBL1083629|BDBM50320386
Canonical SMILES: CC(=O)O[C@H]1CC[C@]2(C)[C@H]3Cc4cc5ccccc5n4[C@]3(C)CC[C@H]2C1(C)C
Standard InChI: InChI=1S/C25H33NO2/c1-16(27)28-22-11-12-24(4)20(23(22,2)3)10-13-25(5)21(24)15-18-14-17-8-6-7-9-19(17)26(18)25/h6-9,14,20-22H,10-13,15H2,1-5H3/t20-,21+,22-,24-,25+/m0/s1
Standard InChI Key: DRMMGUOJBQDCMO-LJDQNPOQSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
-2.0563 -6.7232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0522 -7.5481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3377 -7.9512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3461 -6.2973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6314 -6.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6258 -7.5378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0874 -7.9424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8014 -7.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0761 -6.2928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7947 -6.7030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2429 -5.4805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0681 -5.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4037 -6.1518 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6813 -4.8372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4008 -5.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2264 -6.0582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8382 -6.6090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6252 -6.3579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7947 -5.5440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1805 -4.9944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7547 -8.6662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6466 -5.8882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0769 -7.1158 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.7797 -5.8780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6278 -8.3606 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.1253 -8.7457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7617 -7.9648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4773 -7.5587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1867 -7.9753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4834 -6.7359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3 6 1 0
5 4 1 0
5 6 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 1 0
10 13 1 0
12 11 1 0
11 9 1 0
12 13 1 0
13 16 1 0
15 14 1 0
14 12 2 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
3 21 1 0
5 22 1 1
9 23 1 6
10 24 1 1
6 25 1 6
3 26 1 0
2 27 1 1
1 2 1 0
27 28 1 0
1 4 1 0
28 29 1 0
2 3 1 0
28 30 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 379.54Molecular Weight (Monoisotopic): 379.2511AlogP: 5.70#Rotatable Bonds: 1Polar Surface Area: 31.23Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.21CX LogD: 5.21Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.60Np Likeness Score: 1.53
References 1. Ngantchou I, Nyasse B, Denier C, Blonski C, Hannaert V, Schneider B.. (2010) Antitrypanosomal alkaloids from Polyalthia suaveolens (Annonaceae): their effects on three selected glycolytic enzymes of Trypanosoma brucei., 20 (12): [PMID:20529682 ] [10.1016/j.bmcl.2010.04.145 ]