The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-3-(3-methoxy-4-(4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)piperidin-1-yl)benzamido)-2-(phenylsulfonamido)propanoic acid ID: ALA1083695
Cas Number: 247034-73-7
PubChem CID: 10281105
Max Phase: Preclinical
Molecular Formula: C26H34N6O6S
Molecular Weight: 558.66
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)NC[C@H](NS(=O)(=O)c2ccccc2)C(=O)O)ccc1N1CCC(NC2=NCCCN2)CC1
Standard InChI: InChI=1S/C26H34N6O6S/c1-38-23-16-18(8-9-22(23)32-14-10-19(11-15-32)30-26-27-12-5-13-28-26)24(33)29-17-21(25(34)35)31-39(36,37)20-6-3-2-4-7-20/h2-4,6-9,16,19,21,31H,5,10-15,17H2,1H3,(H,29,33)(H,34,35)(H2,27,28,30)/t21-/m0/s1
Standard InChI Key: YYKYFRLZWKUEIZ-NRFANRHFSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
7.2375 -21.3731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2375 -22.2027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9520 -22.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6711 -22.2027 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6711 -21.3731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9520 -20.9560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3860 -20.9613 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1000 -21.3746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0947 -22.1991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8047 -22.6122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5221 -22.2040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5249 -21.3780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8103 -20.9603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2321 -22.6198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2269 -23.4460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9386 -23.8618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6561 -23.4527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6574 -22.6234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9451 -22.2112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9467 -21.3861 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6621 -20.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3691 -23.8676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3663 -24.6927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0850 -23.4576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7981 -23.8726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5140 -23.4626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2270 -23.8775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9430 -23.4674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2242 -24.7026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5169 -22.6375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2328 -22.2274 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.2356 -21.4024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9400 -21.8085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6375 -22.9361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9532 -20.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9564 -20.1720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2428 -19.7562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5244 -20.1707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5248 -20.9935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19 14 1 0
11 14 1 0
2 3 1 0
19 20 1 0
3 4 1 0
20 21 1 0
4 5 2 0
17 22 1 0
5 6 1 0
22 23 2 0
8 13 1 0
22 24 1 0
9 10 1 0
24 25 1 0
10 11 1 0
25 26 1 0
11 12 1 0
26 27 1 0
12 13 1 0
27 28 1 0
27 29 2 0
5 7 1 0
26 30 1 6
14 15 2 0
30 31 1 0
1 2 1 0
31 32 1 0
15 16 1 0
31 33 2 0
7 8 1 0
31 34 2 0
16 17 2 0
32 35 2 0
8 9 1 0
35 36 1 0
17 18 1 0
36 37 2 0
1 6 1 0
37 38 1 0
18 19 2 0
38 39 2 0
39 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 558.66Molecular Weight (Monoisotopic): 558.2261AlogP: 0.76#Rotatable Bonds: 10Polar Surface Area: 161.46Molecular Species: ZWITTERIONHBA: 9HBD: 5#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.87CX Basic pKa: 11.78CX LogP: -1.06CX LogD: -1.06Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.28Np Likeness Score: -0.99
References 1. Allen JG, Fotsch C, Babij P.. (2010) Emerging targets in osteoporosis disease modification., 53 (11): [PMID:20218623 ] [10.1021/jm9018756 ] 2. Ishikawa M, Hashimoto Y.. (2011) Improvement in aqueous solubility in small molecule drug discovery programs by disruption of molecular planarity and symmetry., 54 (6): [PMID:21344906 ] [10.1021/jm101356p ]