2-((1R,3S,6S,8aR)-6-((S)-2-amino-5-guanidinopentanamido)-3-(tert-butoxycarbonyl)-5-oxooctahydroindolizin-1-yl)acetic acid

ID: ALA1083696

PubChem CID: 16115221

Max Phase: Preclinical

Molecular Formula: C21H36N6O6

Molecular Weight: 468.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(C)OC(=O)[C@@H]1C[C@H](CC(=O)O)[C@H]2CC[C@H](NC(=O)[C@@H](N)CCCNC(=N)N)C(=O)N21

Standard InChI:  InChI=1S/C21H36N6O6/c1-21(2,3)33-19(32)15-9-11(10-16(28)29)14-7-6-13(18(31)27(14)15)26-17(30)12(22)5-4-8-25-20(23)24/h11-15H,4-10,22H2,1-3H3,(H,26,30)(H,28,29)(H4,23,24,25)/t11-,12+,13+,14-,15+/m1/s1

Standard InChI Key:  DCMGGXYQQPZFEF-FQKPHLNHSA-N

Molfile:  

     RDKit          2D

 34 35  0  0  0  0  0  0  0  0999 V2000
   -2.7088  -27.5922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9943  -27.1797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4233  -27.1797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1377  -27.5922    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8523  -27.1797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5618  -27.5922    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8523  -26.3547    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2799  -27.5922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5653  -27.1797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1492  -27.5922    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5653  -26.3547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2799  -28.4173    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8636  -27.1797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5730  -27.5939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5753  -25.9447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8567  -26.3555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2897  -26.3594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2859  -27.1820    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0670  -27.4398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5535  -26.7766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0730  -26.1090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5712  -28.4189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4788  -25.3922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3038  -25.3853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7102  -24.6673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7224  -26.0962    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4742  -28.1469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0610  -28.8609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2992  -28.1476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4729  -29.5758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0596  -30.2899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2979  -29.5767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8776  -30.2828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2826  -25.5343    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
 17 18  1  0
  8  9  1  0
  4  5  1  0
  9 10  1  0
  1  3  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 17  1  0
  9 11  2  0
 14 22  2  0
  5  6  1  0
 21 23  1  1
  8 12  1  1
 23 24  1  0
  1  2  1  0
 24 25  2  0
 13 10  1  1
 24 26  1  0
 13 14  1  0
 19 27  1  1
  5  7  2  0
 27 28  1  0
  3  4  1  0
 27 29  2  0
  2  8  1  0
 28 30  1  0
 13 16  1  0
 30 31  1  0
 14 18  1  0
 30 32  1  0
 17 15  1  0
 30 33  1  0
 15 16  1  0
 17 34  1  1
M  END

Associated Targets(Human)

ITGB3 Tclin Integrin alpha-V/beta-3 (2708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.56Molecular Weight (Monoisotopic): 468.2696AlogP: -0.74#Rotatable Bonds: 9
Polar Surface Area: 200.93Molecular Species: ZWITTERIONHBA: 7HBD: 6
#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 8#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.19CX Basic pKa: 11.93CX LogP: -3.14CX LogD: -3.66
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.11Np Likeness Score: 0.47

References

1. Allen JG, Fotsch C, Babij P..  (2010)  Emerging targets in osteoporosis disease modification.,  53  (11): [PMID:20218623] [10.1021/jm9018756]

Source