The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((1R,3S,6S,8aR)-6-((S)-2-amino-5-guanidinopentanamido)-3-(tert-butoxycarbonyl)-5-oxooctahydroindolizin-1-yl)acetic acid ID: ALA1083696
PubChem CID: 16115221
Max Phase: Preclinical
Molecular Formula: C21H36N6O6
Molecular Weight: 468.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)OC(=O)[C@@H]1C[C@H](CC(=O)O)[C@H]2CC[C@H](NC(=O)[C@@H](N)CCCNC(=N)N)C(=O)N21
Standard InChI: InChI=1S/C21H36N6O6/c1-21(2,3)33-19(32)15-9-11(10-16(28)29)14-7-6-13(18(31)27(14)15)26-17(30)12(22)5-4-8-25-20(23)24/h11-15H,4-10,22H2,1-3H3,(H,26,30)(H,28,29)(H4,23,24,25)/t11-,12+,13+,14-,15+/m1/s1
Standard InChI Key: DCMGGXYQQPZFEF-FQKPHLNHSA-N
Molfile:
RDKit 2D
34 35 0 0 0 0 0 0 0 0999 V2000
-2.7088 -27.5922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9943 -27.1797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4233 -27.1797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1377 -27.5922 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.8523 -27.1797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5618 -27.5922 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.8523 -26.3547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2799 -27.5922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5653 -27.1797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1492 -27.5922 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5653 -26.3547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2799 -28.4173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8636 -27.1797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5730 -27.5939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5753 -25.9447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8567 -26.3555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2897 -26.3594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2859 -27.1820 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0670 -27.4398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5535 -26.7766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0730 -26.1090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5712 -28.4189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4788 -25.3922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3038 -25.3853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7102 -24.6673 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7224 -26.0962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4742 -28.1469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0610 -28.8609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2992 -28.1476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4729 -29.5758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0596 -30.2899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2979 -29.5767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8776 -30.2828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2826 -25.5343 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17 18 1 0
8 9 1 0
4 5 1 0
9 10 1 0
1 3 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 17 1 0
9 11 2 0
14 22 2 0
5 6 1 0
21 23 1 1
8 12 1 1
23 24 1 0
1 2 1 0
24 25 2 0
13 10 1 1
24 26 1 0
13 14 1 0
19 27 1 1
5 7 2 0
27 28 1 0
3 4 1 0
27 29 2 0
2 8 1 0
28 30 1 0
13 16 1 0
30 31 1 0
14 18 1 0
30 32 1 0
17 15 1 0
30 33 1 0
15 16 1 0
17 34 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.56Molecular Weight (Monoisotopic): 468.2696AlogP: -0.74#Rotatable Bonds: 9Polar Surface Area: 200.93Molecular Species: ZWITTERIONHBA: 7HBD: 6#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 8#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.19CX Basic pKa: 11.93CX LogP: -3.14CX LogD: -3.66Aromatic Rings: ┄Heavy Atoms: 33QED Weighted: 0.11Np Likeness Score: 0.47
References 1. Allen JG, Fotsch C, Babij P.. (2010) Emerging targets in osteoporosis disease modification., 53 (11): [PMID:20218623 ] [10.1021/jm9018756 ]