The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-Chlorobenzofuran-2-carboxylic Acid(1-{(S)-1-Benzyl-4-[4-(tetrahydropyran-4-ylmethyl)piperazin-1-yl]butylcarbamoyl}-cyclopentyl)amide ID: ALA1083846
PubChem CID: 46238093
Max Phase: Preclinical
Molecular Formula: C36H47ClN4O4
Molecular Weight: 635.25
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC1(C(=O)N[C@@H](CCCN2CCN(CC3CCOCC3)CC2)Cc2ccccc2)CCCC1)c1cc2cc(Cl)ccc2o1
Standard InChI: InChI=1S/C36H47ClN4O4/c37-30-10-11-32-29(24-30)25-33(45-32)34(42)39-36(14-4-5-15-36)35(43)38-31(23-27-7-2-1-3-8-27)9-6-16-40-17-19-41(20-18-40)26-28-12-21-44-22-13-28/h1-3,7-8,10-11,24-25,28,31H,4-6,9,12-23,26H2,(H,38,43)(H,39,42)/t31-/m0/s1
Standard InChI Key: QXHSKALBSZTNEQ-HKBQPEDESA-N
Molfile:
RDKit 2D
45 50 0 0 0 0 0 0 0 0999 V2000
0.7748 -12.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4873 -12.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3112 -11.4788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4898 -11.3971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1584 -12.1530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3708 -13.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6564 -12.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0581 -13.1167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6564 -11.8792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4871 -13.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2015 -12.7042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4871 -13.9417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9160 -13.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6305 -12.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9160 -13.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6305 -14.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6264 -15.1802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3400 -15.5927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0555 -15.1801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0528 -14.3508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3386 -13.9422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3449 -13.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0594 -12.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7739 -13.1167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7686 -13.9426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4789 -14.3550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1958 -13.9460 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1978 -13.1201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4829 -12.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9087 -14.3612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6248 -13.9514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3340 -14.3717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0478 -13.9655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0552 -13.1401 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3425 -12.7227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6224 -13.1307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1263 -12.7853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4589 -13.9413 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2658 -14.1129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6753 -13.3969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4982 -13.3946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9127 -14.1074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4981 -14.8242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6766 -14.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7377 -14.1065 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
14 22 1 0
10 11 1 0
22 23 1 0
1 2 1 0
23 24 1 0
24 25 1 0
10 12 2 0
13 11 1 0
6 7 1 0
13 14 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
2 3 1 0
27 30 1 0
13 15 1 1
30 31 1 0
31 32 1 0
7 8 1 0
15 16 1 0
3 4 1 0
16 17 2 0
7 9 2 0
31 36 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
6 37 2 0
17 18 1 0
8 1 1 0
37 40 1 0
39 38 1 0
38 6 1 0
18 19 2 0
4 5 1 0
39 40 2 0
19 20 1 0
40 41 1 0
1 10 1 0
41 42 2 0
20 21 2 0
42 43 1 0
21 16 1 0
43 44 2 0
44 39 1 0
5 1 1 0
42 45 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 635.25Molecular Weight (Monoisotopic): 634.3286AlogP: 5.68#Rotatable Bonds: 12Polar Surface Area: 87.05Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.20CX Basic pKa: 8.82CX LogP: 5.15CX LogD: 3.72Aromatic Rings: 3Heavy Atoms: 45QED Weighted: 0.27Np Likeness Score: -0.92
References 1. Fattori D, Porcelloni M, D'Andrea P, Catalioto RM, Ettorre A, Giuliani S, Marastoni E, Mauro S, Meini S, Rossi C, Altamura M, Maggi CA.. (2010) Structure-activity relationships of 6-methyl-benzo[b]thiophene-2-carboxylic acid (1-[(S)-1-benzyl-4-[4-(tetrahydropyran-4-ylmethyl)piperazin-1-yl]butylcarbamoyl]cyclopentyl)amide, potent antagonist of the neurokinin-2 receptor., 53 (10): [PMID:20408549 ] [10.1021/jm100176s ]