6-Methylbenzo[b]thiophene-2-carboxylic Acid1-[(S)-1-Benzyl-4-(4-morpholin-4-ylpiperidin-1-yl)-4-oxobutylcarbamoyl]-cyclopentyl}amide

ID: ALA1083853

PubChem CID: 46889639

Max Phase: Preclinical

Molecular Formula: C35H46N4O3S

Molecular Weight: 602.84

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc2cc(C(=O)NC3(C(=O)N[C@@H](CCN4CCC(N5CCOCC5)CC4)Cc4ccccc4)CCCC3)sc2c1

Standard InChI:  InChI=1S/C35H46N4O3S/c1-26-9-10-28-25-32(43-31(28)23-26)33(40)37-35(14-5-6-15-35)34(41)36-29(24-27-7-3-2-4-8-27)11-16-38-17-12-30(13-18-38)39-19-21-42-22-20-39/h2-4,7-10,23,25,29-30H,5-6,11-22,24H2,1H3,(H,36,41)(H,37,40)/t29-/m0/s1

Standard InChI Key:  JSQUFUABHMZJIE-LJAQVGFWSA-N

Molfile:  

     RDKit          2D

 43 48  0  0  0  0  0  0  0  0999 V2000
   15.9180   -7.5712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6314   -7.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4561   -6.3495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6344   -6.2640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3003   -7.0206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7740   -7.9881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4852   -7.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2005   -7.9881    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4852   -6.7481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6312   -7.9881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3465   -7.5734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6312   -8.8135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0619   -7.9881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7772   -7.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0619   -8.8135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7772   -9.2241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7731  -10.0505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4876  -10.4652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1998  -10.0504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1971   -9.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4925   -7.9881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0177   -7.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6822   -8.8131    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.8748   -8.9840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4672   -8.2672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6439   -8.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2272   -8.9785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6440   -9.6961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4659   -9.6950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2300  -10.4077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4910   -8.8094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2045   -7.5788    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9125   -7.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6222   -7.5881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6280   -6.7666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9178   -6.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2017   -6.7599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3381   -6.3617    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.0469   -6.7785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7582   -6.3754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7670   -5.5539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0584   -5.1371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3408   -5.5418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 10  1  0
 14 21  1  0
  6 22  2  0
  5  1  1  0
 10 11  1  0
 22 25  1  0
 24 23  1  0
 23  6  1  0
  1  2  1  0
 10 12  2  0
 24 25  2  0
 25 26  1  0
 13 11  1  0
 26 27  2  0
  6  7  1  0
 27 28  1  0
 13 14  1  0
 28 29  2  0
 29 24  1  0
  2  3  1  0
 28 30  1  0
 13 15  1  1
  7  8  1  0
 21 32  1  0
 32 33  1  0
 15 16  1  0
  3  4  1  0
 16 17  2  0
  7  9  2  0
 17 18  1  0
 32 37  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 38 39  1  0
  8  1  1  0
 18 19  2  0
  4  5  1  0
 19 20  1  0
 20 31  2  0
 31 16  1  0
 38 43  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42 43  1  0
 35 38  1  0
M  END

Associated Targets(Human)

TACR2 Tchem Neurokinin 2 receptor (3341 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

TACR2 Neurokinin 2 receptor (349 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 602.84Molecular Weight (Monoisotopic): 602.3291AlogP: 5.17#Rotatable Bonds: 10
Polar Surface Area: 73.91Molecular Species: BASEHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.02CX LogP: 5.01CX LogD: 3.36
Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.34Np Likeness Score: -1.21

References

1. Fattori D, Porcelloni M, D'Andrea P, Catalioto RM, Ettorre A, Giuliani S, Marastoni E, Mauro S, Meini S, Rossi C, Altamura M, Maggi CA..  (2010)  Structure-activity relationships of 6-methyl-benzo[b]thiophene-2-carboxylic acid (1-[(S)-1-benzyl-4-[4-(tetrahydropyran-4-ylmethyl)piperazin-1-yl]butylcarbamoyl]cyclopentyl)amide, potent antagonist of the neurokinin-2 receptor.,  53  (10): [PMID:20408549] [10.1021/jm100176s]

Source