The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-Methylbenzo[b]thiophene-2-carboxylic Acid[1-((S)-1-Benzyl-4-{4-[methyl(tetrahydropyran-4-yl)amino]piperidin-1-yl}-4-oxobutylcarbamoyl)cyclopentyl]amide ID: ALA1083855
PubChem CID: 46889640
Max Phase: Preclinical
Molecular Formula: C37H50N4O3S
Molecular Weight: 630.90
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2cc(C(=O)NC3(C(=O)N[C@@H](CCN4CCC(N(C)C5CCOCC5)CC4)Cc4ccccc4)CCCC3)sc2c1
Standard InChI: InChI=1S/C37H50N4O3S/c1-27-10-11-29-26-34(45-33(29)24-27)35(42)39-37(17-6-7-18-37)36(43)38-30(25-28-8-4-3-5-9-28)12-19-41-20-13-31(14-21-41)40(2)32-15-22-44-23-16-32/h3-5,8-11,24,26,30-32H,6-7,12-23,25H2,1-2H3,(H,38,43)(H,39,42)/t30-/m0/s1
Standard InChI Key: FRIBUZAMFTUFSB-PMERELPUSA-N
Molfile:
RDKit 2D
45 50 0 0 0 0 0 0 0 0999 V2000
20.5133 -14.4846 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.2174 -14.9164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9363 -14.5201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9591 -13.6957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2533 -13.2668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5246 -13.6623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6817 -13.2987 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.7034 -12.4746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4284 -12.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4498 -11.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7473 -10.8333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.0215 -11.2233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9997 -12.0521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3826 -13.7259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2297 -14.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9426 -14.0678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7675 -13.2613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9461 -13.1758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6122 -13.9321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0866 -14.8991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7975 -14.4846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5124 -14.8991 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7975 -13.6597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9424 -14.8991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6575 -14.4846 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9424 -15.7241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3725 -14.8991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0874 -14.4846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3725 -15.7241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0874 -16.1346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0834 -16.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7976 -17.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5094 -16.9605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5068 -16.1312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8025 -14.8991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3308 -14.5653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9949 -15.7238 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.1879 -15.8945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7804 -15.1780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9575 -15.1756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5410 -15.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9576 -16.6063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7792 -16.6052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5438 -17.3175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8010 -15.7200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 6 1 0
21 23 2 0
22 15 1 0
8 13 1 0
15 24 1 0
9 10 1 0
24 25 1 0
10 11 1 0
24 26 2 0
11 12 1 0
27 25 1 0
12 13 1 0
27 28 1 0
1 2 1 0
27 29 1 1
7 14 1 0
29 30 1 0
15 16 1 0
30 31 2 0
4 7 1 0
31 32 1 0
32 33 2 0
7 8 1 0
33 34 1 0
34 45 2 0
45 30 1 0
8 9 1 0
28 35 1 0
20 36 2 0
1 6 1 0
16 17 1 0
36 39 1 0
38 37 1 0
37 20 1 0
17 18 1 0
18 19 1 0
38 39 2 0
19 15 1 0
39 40 1 0
2 3 1 0
40 41 2 0
3 4 1 0
41 42 1 0
20 21 1 0
42 43 2 0
43 38 1 0
4 5 1 0
42 44 1 0
21 22 1 0
35 1 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 630.90Molecular Weight (Monoisotopic): 630.3604AlogP: 5.95#Rotatable Bonds: 11Polar Surface Area: 73.91Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.45CX LogP: 5.19CX LogD: 2.13Aromatic Rings: 3Heavy Atoms: 45QED Weighted: 0.27Np Likeness Score: -1.10
References 1. Fattori D, Porcelloni M, D'Andrea P, Catalioto RM, Ettorre A, Giuliani S, Marastoni E, Mauro S, Meini S, Rossi C, Altamura M, Maggi CA.. (2010) Structure-activity relationships of 6-methyl-benzo[b]thiophene-2-carboxylic acid (1-[(S)-1-benzyl-4-[4-(tetrahydropyran-4-ylmethyl)piperazin-1-yl]butylcarbamoyl]cyclopentyl)amide, potent antagonist of the neurokinin-2 receptor., 53 (10): [PMID:20408549 ] [10.1021/jm100176s ]