6-Methylbenzo[b]thiophene-2-carboxylic Acid[1-((S)-1-Benzyl-4-{4-[methyl(tetrahydropyran-4-yl)amino]piperidin-1-yl}-4-oxobutylcarbamoyl)cyclopentyl]amide

ID: ALA1083855

PubChem CID: 46889640

Max Phase: Preclinical

Molecular Formula: C37H50N4O3S

Molecular Weight: 630.90

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  Cc1ccc2cc(C(=O)NC3(C(=O)N[C@@H](CCN4CCC(N(C)C5CCOCC5)CC4)Cc4ccccc4)CCCC3)sc2c1

Standard InChI:  InChI=1S/C37H50N4O3S/c1-27-10-11-29-26-34(45-33(29)24-27)35(42)39-37(17-6-7-18-37)36(43)38-30(25-28-8-4-3-5-9-28)12-19-41-20-13-31(14-21-41)40(2)32-15-22-44-23-16-32/h3-5,8-11,24,26,30-32H,6-7,12-23,25H2,1-2H3,(H,38,43)(H,39,42)/t30-/m0/s1

Standard InChI Key:  FRIBUZAMFTUFSB-PMERELPUSA-N

Molfile:  

     RDKit          2D

 45 50  0  0  0  0  0  0  0  0999 V2000
   20.5133  -14.4846    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2174  -14.9164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9363  -14.5201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9591  -13.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2533  -13.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5246  -13.6623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6817  -13.2987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.7034  -12.4746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4284  -12.0835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4498  -11.2665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7473  -10.8333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.0215  -11.2233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9997  -12.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3826  -13.7259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2297  -14.4824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9426  -14.0678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7675  -13.2613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9461  -13.1758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6122  -13.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0866  -14.8991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7975  -14.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5124  -14.8991    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7975  -13.6597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9424  -14.8991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6575  -14.4846    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9424  -15.7241    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3725  -14.8991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0874  -14.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3725  -15.7241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0874  -16.1346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0834  -16.9606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7976  -17.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5094  -16.9605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5068  -16.1312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8025  -14.8991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3308  -14.5653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9949  -15.7238    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.1879  -15.8945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7804  -15.1780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9575  -15.1756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5410  -15.8890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9576  -16.6063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7792  -16.6052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5438  -17.3175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8010  -15.7200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  6  1  0
 21 23  2  0
 22 15  1  0
  8 13  1  0
 15 24  1  0
  9 10  1  0
 24 25  1  0
 10 11  1  0
 24 26  2  0
 11 12  1  0
 27 25  1  0
 12 13  1  0
 27 28  1  0
  1  2  1  0
 27 29  1  1
  7 14  1  0
 29 30  1  0
 15 16  1  0
 30 31  2  0
  4  7  1  0
 31 32  1  0
 32 33  2  0
  7  8  1  0
 33 34  1  0
 34 45  2  0
 45 30  1  0
  8  9  1  0
 28 35  1  0
 20 36  2  0
  1  6  1  0
 16 17  1  0
 36 39  1  0
 38 37  1  0
 37 20  1  0
 17 18  1  0
 18 19  1  0
 38 39  2  0
 19 15  1  0
 39 40  1  0
  2  3  1  0
 40 41  2  0
  3  4  1  0
 41 42  1  0
 20 21  1  0
 42 43  2  0
 43 38  1  0
  4  5  1  0
 42 44  1  0
 21 22  1  0
 35  1  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA1083855

   6-methyl-N-[1-[[(2R)-4-[4-[methyl(oxan-4-yl)amino]piperidin-1-yl]-1-phenylbutan-2-yl]carbamoyl]cyclopentyl]-1-benzothiophene-2-carboxamide

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 630.90

Molecular Weight (Monoisotopic): 630.3604

AlogP: 5.95

#Rotatable Bonds: 11

Polar Surface Area: 73.91

Molecular Species: BASE

HBA: 6

HBD: 2

#RO5 Violations: 2

HBA (Lipinski): 7

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 2

CX Acidic pKa: ┄

CX Basic pKa: 10.45

CX LogP: 5.19

CX LogD: 2.13

Aromatic Rings: 3

Heavy Atoms: 45

QED Weighted: 0.27

Np Likeness Score: -1.10

References

1. Fattori D, Porcelloni M, D'Andrea P, Catalioto RM, Ettorre A, Giuliani S, Marastoni E, Mauro S, Meini S, Rossi C, Altamura M, Maggi CA..  (2010)  Structure-activity relationships of 6-methyl-benzo[b]thiophene-2-carboxylic acid (1-[(S)-1-benzyl-4-[4-(tetrahydropyran-4-ylmethyl)piperazin-1-yl]butylcarbamoyl]cyclopentyl)amide, potent antagonist of the neurokinin-2 receptor.,  53  (10): [PMID:20408549] [10.1021/jm100176s]

Source

Source(1):

• Scientific Literature