The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
((4-(2-(cis-4-aminocyclohexyl)-9-ethyl-9H-purin-6-ylamino)phenyl)(hydroxy)phosphoryl)methylphosphonic acid ID: ALA1084268
PubChem CID: 11957378
Max Phase: Preclinical
Molecular Formula: C20H28N6O5P2
Molecular Weight: 494.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Synonyms: AP-23451 | CHEMBL1084268|{[(4-{[2-(4-AMINOCYCLOHEXYL)-9-ETHYL-9H-PURIN-6-YL]AMINO}PHENYL)(HYDROXY)PHOSPHORYL]METHYL}PHOSPHONIC ACID|2bdf|24A|ap23451|2,6,9-Trisubstituted Purine, 8|BDBM50318870|AP-23451|2,6,9-Trisubstituted Purine, AP23451|Q27452692|((4-(2-(cis-4-aminocyclohexyl)-9-ethyl-9H-purin-6-ylamino)phenyl)(hydroxy)phosphoryl)methylphosphonic acid|[[4-[[2-(4-aminocyclohexyl)-9-ethylpurin-6-yl]amino]phenyl]-hydroxyphosphoryl]methylphosphonic acid|{[(R)-(4-{[2-(trans-4-aminocyclohexyl)-9-eth Show More⌵
Canonical SMILES: CCn1cnc2c(Nc3ccc(P(=O)(O)CP(=O)(O)O)cc3)nc([C@H]3CC[C@H](N)CC3)nc21
Standard InChI: InChI=1S/C20H28N6O5P2/c1-2-26-11-22-17-19(24-18(25-20(17)26)13-3-5-14(21)6-4-13)23-15-7-9-16(10-8-15)32(27,28)12-33(29,30)31/h7-11,13-14H,2-6,12,21H2,1H3,(H,27,28)(H,23,24,25)(H2,29,30,31)/t13-,14-
Standard InChI Key: FGMSUCIOAMNCKF-HDJSIYSDSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
10.9771 -4.7071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9771 -5.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6915 -5.9491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4106 -5.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4106 -4.7071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6915 -4.2900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1247 -4.2953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8390 -4.7102 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8356 -3.0602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1241 -3.4737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5547 -3.4732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5579 -4.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3429 -4.5495 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8251 -3.8804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3378 -3.2155 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8335 -2.2352 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5470 -1.8209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2612 -2.2335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9741 -1.8199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9725 -0.9941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2520 -0.5835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5419 -0.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6854 -0.5788 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
17.4013 -0.9886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1143 -0.5733 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
18.8303 -0.9831 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1111 0.2517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6822 0.2462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1086 -1.3979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6240 -1.3704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7483 -5.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5733 -5.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2625 -5.9491 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9 16 1 0
8 12 1 0
16 17 1 0
1 6 1 0
17 18 2 0
11 9 1 0
18 19 1 0
2 3 1 0
19 20 2 0
9 10 2 0
20 21 1 0
10 7 1 0
21 22 2 0
22 17 1 0
5 7 1 1
20 23 1 0
11 12 2 0
23 24 1 0
3 4 1 0
24 25 1 0
5 4 1 0
25 26 1 0
5 6 1 0
25 27 2 0
23 28 2 0
1 2 1 0
25 29 1 0
12 13 1 0
23 30 1 0
13 14 1 0
13 31 1 0
14 15 2 0
31 32 1 0
15 11 1 0
7 8 2 0
2 33 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.43Molecular Weight (Monoisotopic): 494.1596AlogP: 2.61#Rotatable Bonds: 7Polar Surface Area: 176.48Molecular Species: ZWITTERIONHBA: 8HBD: 5#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 1.53CX Basic pKa: 10.45CX LogP: -1.31CX LogD: -2.47Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.31Np Likeness Score: -0.72
References 1. Allen JG, Fotsch C, Babij P.. (2010) Emerging targets in osteoporosis disease modification., 53 (11): [PMID:20218623 ] [10.1021/jm9018756 ]