The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2''-Methoxy-[1,1'3',1'']terphenyl-4''-yl)-((1S,5R)-1,3,3-trimethyl-6-aza-bicyclo[3.2.1]oct-6-yl)-methanone ID: ALA1084326
PubChem CID: 46890613
Max Phase: Preclinical
Molecular Formula: C30H33NO2
Molecular Weight: 439.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)N2C[C@]3(C)C[C@H]2CC(C)(C)C3)ccc1-c1cccc(-c2ccccc2)c1
Standard InChI: InChI=1S/C30H33NO2/c1-29(2)17-25-18-30(3,19-29)20-31(25)28(32)24-13-14-26(27(16-24)33-4)23-12-8-11-22(15-23)21-9-6-5-7-10-21/h5-16,25H,17-20H2,1-4H3/t25-,30-/m1/s1
Standard InChI Key: CTBZDBSILXBDGE-FYBSXPHGSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
4.8712 2.8899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6140 3.2353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3537 2.8700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6766 2.0828 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5337 2.0669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1859 1.4342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0110 1.4282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2695 -2.0391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2684 -2.8655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9813 -3.2779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6958 -2.8651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6929 -2.0354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9795 -1.6268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9769 -0.8027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6870 -0.3920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6849 0.4313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9706 0.8419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2569 0.4233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2625 -0.3986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9670 1.6659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2527 2.0749 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5672 3.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1474 3.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5792 2.4805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3383 0.6730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1936 3.3532 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.5449 -0.8205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8207 -0.4100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5469 -3.2809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8279 -2.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1069 -3.2772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1055 -4.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8311 -4.5274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5490 -4.1102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16 17 2 0
8 9 2 0
17 18 1 0
3 5 1 0
18 19 2 0
19 14 1 0
9 10 1 0
17 20 1 0
2 3 1 0
20 21 2 0
20 4 1 0
10 11 2 0
3 22 1 0
4 6 1 0
3 23 1 0
11 12 1 0
1 24 1 0
24 7 1 0
1 2 1 0
7 25 1 1
12 13 2 0
1 26 1 1
13 8 1 0
19 27 1 0
5 7 1 0
27 28 1 0
13 14 1 0
9 29 1 0
6 7 1 0
29 30 2 0
14 15 2 0
30 31 1 0
1 4 1 0
31 32 2 0
15 16 1 0
32 33 1 0
33 34 2 0
34 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.60Molecular Weight (Monoisotopic): 439.2511AlogP: 7.07#Rotatable Bonds: 4Polar Surface Area: 29.54Molecular Species: NEUTRALHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.62CX LogD: 6.62Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.43Np Likeness Score: -0.45
References 1. Crombie AL, Antrilli TM, Campbell BA, Crandall DL, Failli AA, He Y, Kern JC, Moore WJ, Nogle LM, Trybulski EJ.. (2010) Synthesis and evaluation of azabicyclo[3.2.1]octane derivatives as potent mixed vasopressin antagonists., 20 (12): [PMID:20471258 ] [10.1016/j.bmcl.2010.04.068 ]