The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((1-(3-(9H-carbazol-4-yloxy)-2-hydroxypropyl)piperidin-4-yl)methyl)-5-hydroxy-1H-benzo[de]isoquinoline-1,3(2H)-dione ID: ALA1084706
PubChem CID: 46889771
Max Phase: Preclinical
Molecular Formula: C33H31N3O5
Molecular Weight: 549.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C1c2cccc3cc(O)cc(c23)C(=O)N1CC1CCN(CC(O)COc2cccc3[nH]c4ccccc4c23)CC1
Standard InChI: InChI=1S/C33H31N3O5/c37-22-15-21-5-3-7-25-30(21)26(16-22)33(40)36(32(25)39)17-20-11-13-35(14-12-20)18-23(38)19-41-29-10-4-9-28-31(29)24-6-1-2-8-27(24)34-28/h1-10,15-16,20,23,34,37-38H,11-14,17-19H2
Standard InChI Key: CLPVTJDKXLZHON-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 47 0 0 0 0 0 0 0 0999 V2000
21.5581 -7.3485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2745 -6.9352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2716 -6.1047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9846 -5.6895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7006 -6.0993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4135 -5.6841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1295 -6.0939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4104 -4.8591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8424 -5.6787 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5583 -6.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2691 -5.6800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2703 -4.8546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5544 -4.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8374 -4.8560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9847 -4.4422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6992 -4.8547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.6935 -5.6846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4079 -4.4451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4054 -6.0936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3999 -6.9140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1090 -7.3299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8251 -6.9194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1228 -4.8621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1183 -5.6857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8281 -6.0995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5429 -5.6910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5434 -4.8643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8330 -4.4541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9781 -6.0955 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.4095 -3.6201 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8432 -6.9357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2580 -4.4520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8362 -6.1056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5521 -5.6931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2226 -5.5522 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.5592 -4.7975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3779 -4.8846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8607 -4.2200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5260 -3.4681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7038 -3.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2246 -4.0502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24 19 2 0
7 9 1 0
19 20 1 0
9 10 1 0
20 21 2 0
3 4 1 0
21 22 1 0
22 25 2 0
1 2 2 0
4 5 1 0
23 24 1 0
31 1 1 0
24 25 1 0
5 6 1 0
25 26 1 0
9 14 1 0
26 27 2 0
10 11 1 0
27 28 1 0
28 23 2 0
11 12 1 0
17 29 2 0
12 13 1 0
18 30 2 0
31 33 2 0
13 14 1 0
2 3 1 0
27 32 1 0
33 34 1 0
12 15 1 0
6 7 1 0
15 16 1 0
34 37 1 0
36 35 1 0
35 33 1 0
16 17 1 0
3 34 2 0
36 37 2 0
6 8 1 0
37 38 1 0
16 18 1 0
38 39 2 0
17 19 1 0
39 40 1 0
23 18 1 0
40 41 2 0
41 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 549.63Molecular Weight (Monoisotopic): 549.2264AlogP: 4.93#Rotatable Bonds: 7Polar Surface Area: 106.10Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.29CX Basic pKa: 8.89CX LogP: 3.52CX LogD: 2.97Aromatic Rings: 5Heavy Atoms: 41QED Weighted: 0.25Np Likeness Score: -0.28
References 1. Tasler S, Baumgartner R, Aschenbrenner A, Ammendola A, Wolf K, Wieber T, Schachtner J, Blisse M, Quotschalla U, Ney P.. (2010) A vHTS approach for the identification of beta-adrenoceptor ligands., 20 (11): [PMID:20434333 ] [10.1016/j.bmcl.2010.04.009 ]