The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((1-(3-(9H-carbazol-4-yloxy)-2-hydroxypropyl)piperidin-4-yl)methyl)-5-methoxy-1H-benzo[de]isoquinoline-1,3(2H)-dione ID: ALA1084707
PubChem CID: 46889772
Max Phase: Preclinical
Molecular Formula: C34H33N3O5
Molecular Weight: 563.65
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c3c(cccc3c1)C(=O)N(CC1CCN(CC(O)COc3cccc4[nH]c5ccccc5c34)CC1)C2=O
Standard InChI: InChI=1S/C34H33N3O5/c1-41-24-16-22-6-4-8-26-31(22)27(17-24)34(40)37(33(26)39)18-21-12-14-36(15-13-21)19-23(38)20-42-30-11-5-10-29-32(30)25-7-2-3-9-28(25)35-29/h2-11,16-17,21,23,35,38H,12-15,18-20H2,1H3
Standard InChI Key: SBAJMOUEQDPSIH-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 48 0 0 0 0 0 0 0 0999 V2000
-3.8794 -13.8360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1630 -13.4227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1659 -12.5922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4529 -12.1770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7369 -12.5868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0240 -12.1716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3080 -12.5814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0271 -11.3466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4049 -12.1662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1208 -12.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8316 -12.1675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8328 -11.3421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1169 -10.9301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3999 -11.3435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5472 -10.9297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2617 -11.3422 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2560 -12.1721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9704 -10.9326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9679 -12.5811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9624 -13.4015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6715 -13.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3876 -13.4069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6853 -11.3496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6808 -12.1732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3906 -12.5870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1054 -12.1785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1059 -11.3518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3955 -10.9416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5406 -12.5830 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9720 -10.1076 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5943 -13.4232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8205 -10.9395 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6013 -12.5931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8854 -12.1806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2149 -12.0397 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.8783 -11.2850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0596 -11.3721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5768 -10.7075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9115 -9.9556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7337 -9.8722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2129 -10.5377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5349 -11.3522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24 19 2 0
7 9 1 0
19 20 1 0
9 10 1 0
20 21 2 0
3 4 1 0
21 22 1 0
22 25 2 0
1 2 2 0
4 5 1 0
23 24 1 0
31 1 1 0
24 25 1 0
5 6 1 0
25 26 1 0
9 14 1 0
26 27 2 0
10 11 1 0
27 28 1 0
28 23 2 0
11 12 1 0
17 29 2 0
12 13 1 0
18 30 2 0
31 33 2 0
13 14 1 0
2 3 1 0
27 32 1 0
33 34 1 0
12 15 1 0
6 7 1 0
15 16 1 0
34 37 1 0
36 35 1 0
35 33 1 0
16 17 1 0
3 34 2 0
36 37 2 0
6 8 1 0
37 38 1 0
16 18 1 0
38 39 2 0
17 19 1 0
39 40 1 0
23 18 1 0
40 41 2 0
41 36 1 0
32 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 563.65Molecular Weight (Monoisotopic): 563.2420AlogP: 5.23#Rotatable Bonds: 8Polar Surface Area: 95.10Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.62CX LogP: 4.37CX LogD: 3.12Aromatic Rings: 5Heavy Atoms: 42QED Weighted: 0.25Np Likeness Score: -0.45
References 1. Tasler S, Baumgartner R, Aschenbrenner A, Ammendola A, Wolf K, Wieber T, Schachtner J, Blisse M, Quotschalla U, Ney P.. (2010) A vHTS approach for the identification of beta-adrenoceptor ligands., 20 (11): [PMID:20434333 ] [10.1016/j.bmcl.2010.04.009 ]