5-[4-(3-Hydroxypropoxy)phenyl]-11,12-dihydro-5H-6,13-dioxabenzo[3,4]cyclohepta[1,2-a]naphthal ene-2,8-diol

ID: ALA1084913

PubChem CID: 44597970

Max Phase: Preclinical

Molecular Formula: C26H24O6

Molecular Weight: 432.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  OCCCOc1ccc(C2Oc3cc(O)ccc3C3=C2c2ccc(O)cc2OCC3)cc1

Standard InChI:  InChI=1S/C26H24O6/c27-11-1-12-30-19-6-2-16(3-7-19)26-25-21(20-8-4-18(29)15-24(20)32-26)10-13-31-23-14-17(28)5-9-22(23)25/h2-9,14-15,26-29H,1,10-13H2

Standard InChI Key:  DVEXRUSVKFNKTJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   -5.1032  -11.3253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1044  -12.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3916  -12.5619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3934  -10.9137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6802  -11.3218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6767  -12.1523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9597  -12.5624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2414  -12.1465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7236   -9.5141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2440  -11.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9665  -10.9012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0942  -10.0387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5452   -9.4531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2325  -10.1693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4651  -11.0027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8604  -11.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0228  -11.4027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2067  -10.5651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3997   -9.9526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0469  -10.3447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5281  -12.5562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5298  -13.3789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8173  -13.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1049  -13.3755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1094  -12.5487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8224  -12.1428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6089  -13.7843    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3199  -13.3705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0338  -13.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8171  -12.5610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7447  -13.3654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4585  -13.7741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 14 15  2  0
  5 11  1  0
 15 16  1  0
  6  7  1  0
 16 17  2  0
  7  8  1  0
 17 18  1  0
  8 10  1  0
 18 19  2  0
 19 14  1  0
  5  4  2  0
 18 20  1  0
  4  1  1  0
  8 21  1  0
  5  6  1  0
 21 22  2  0
 22 23  1  0
  2  3  1  0
 23 24  2  0
 14  9  1  0
 24 25  1  0
 15 10  1  0
 25 26  2  0
 26 21  1  0
 11 12  1  0
 24 27  1  0
 12 13  1  0
 27 28  1  0
 13  9  1  0
 28 29  1  0
 10 11  2  0
  2 30  1  0
  3  6  2  0
 29 31  1  0
  1  2  2  0
 31 32  1  0
M  END

Associated Targets(Human)

ESR2 Tclin Estrogen receptor beta (9272 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ESR1 Tclin Estrogen receptor alpha (17718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 432.47Molecular Weight (Monoisotopic): 432.1573AlogP: 4.69#Rotatable Bonds: 5
Polar Surface Area: 88.38Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.61CX Basic pKa: CX LogP: 3.75CX LogD: 3.72
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.51Np Likeness Score: 0.66

References

1. Jain N, Xu J, Kanojia RM, Du F, Jian-Zhong G, Pacia E, Lai MT, Musto A, Allan G, Reuman M, Li X, Hahn D, Cousineau M, Peng S, Ritchie D, Russell R, Lundeen S, Sui Z..  (2009)  Identification and structure-activity relationships of chromene-derived selective estrogen receptor modulators for treatment of postmenopausal symptoms.,  52  (23): [PMID:19366247] [10.1021/jm900146e]

Source