1-((1-(2-hydroxy-3-(2-isopropylphenoxy)propyl)piperidin-4-yl)methyl)piperidine-2,6-dione

ID: ALA1085010

PubChem CID: 46889768

Max Phase: Preclinical

Molecular Formula: C23H34N2O4

Molecular Weight: 402.54

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)c1ccccc1OCC(O)CN1CCC(CN2C(=O)CCCC2=O)CC1

Standard InChI:  InChI=1S/C23H34N2O4/c1-17(2)20-6-3-4-7-21(20)29-16-19(26)15-24-12-10-18(11-13-24)14-25-22(27)8-5-9-23(25)28/h3-4,6-7,17-19,26H,5,8-16H2,1-2H3

Standard InChI Key:  GTKJMMNKVVZZMQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
    8.4122   -1.6569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1287   -1.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1258   -0.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8387    0.0022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5547   -0.4076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2677    0.0076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9837   -0.4022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2645    0.8326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6966    0.0130    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4125   -0.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1233    0.0117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1244    0.8370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4086    1.2490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6915    0.8357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8389    1.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5534    0.8370    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5477    0.0070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2620    1.2465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2595   -0.4019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9769    0.8296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9724    0.0060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8322   -0.4038    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2637    2.0715    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6974   -1.2440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6940   -0.4151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4063   -0.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4036    0.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1167    1.2385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6877    1.2337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 12 13  1  0
 13 14  1  0
  2  3  1  0
 12 15  1  0
  6  7  1  0
 15 16  1  0
 16 17  1  0
  3 26  2  0
  6  8  1  0
 16 18  1  0
 17 19  1  0
 20 18  1  0
 21 19  1  0
  7  9  1  0
  9 10  1  0
 20 21  1  0
  3  4  1  0
 17 22  2  0
  1  2  2  0
 18 23  2  0
 24 25  2  0
  4  5  1  0
 25 26  1  0
 24  1  1  0
  5  6  1  0
  9 14  1  0
 26 27  1  0
 10 11  1  0
 27 28  1  0
 11 12  1  0
 27 29  1  0
M  END

Associated Targets(Human)

ADRB1 Tclin Beta-1 adrenergic receptor (6630 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRB2 Tclin Beta-2 adrenergic receptor (11824 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRB3 Tclin Beta-3 adrenergic receptor (5850 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 402.54Molecular Weight (Monoisotopic): 402.2519AlogP: 2.80#Rotatable Bonds: 8
Polar Surface Area: 70.08Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.56CX LogP: 2.42CX LogD: 1.23
Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.68Np Likeness Score: -0.90

References

1. Tasler S, Baumgartner R, Aschenbrenner A, Ammendola A, Wolf K, Wieber T, Schachtner J, Blisse M, Quotschalla U, Ney P..  (2010)  A vHTS approach for the identification of beta-adrenoceptor ligands.,  20  (11): [PMID:20434333] [10.1016/j.bmcl.2010.04.009]

Source