The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-((1-(2-hydroxy-3-(2-isopropylphenoxy)propyl)piperidin-4-yl)methyl)piperidine-2,6-dione ID: ALA1085010
PubChem CID: 46889768
Max Phase: Preclinical
Molecular Formula: C23H34N2O4
Molecular Weight: 402.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1ccccc1OCC(O)CN1CCC(CN2C(=O)CCCC2=O)CC1
Standard InChI: InChI=1S/C23H34N2O4/c1-17(2)20-6-3-4-7-21(20)29-16-19(26)15-24-12-10-18(11-13-24)14-25-22(27)8-5-9-23(25)28/h3-4,6-7,17-19,26H,5,8-16H2,1-2H3
Standard InChI Key: GTKJMMNKVVZZMQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
8.4122 -1.6569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1287 -1.2435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1258 -0.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8387 0.0022 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5547 -0.4076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2677 0.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9837 -0.4022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2645 0.8326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6966 0.0130 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4125 -0.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1233 0.0117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1244 0.8370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4086 1.2490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6915 0.8357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8389 1.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5534 0.8370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5477 0.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2620 1.2465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2595 -0.4019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9769 0.8296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9724 0.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8322 -0.4038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2637 2.0715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6974 -1.2440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6940 -0.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4063 -0.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4036 0.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1167 1.2385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6877 1.2337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12 13 1 0
13 14 1 0
2 3 1 0
12 15 1 0
6 7 1 0
15 16 1 0
16 17 1 0
3 26 2 0
6 8 1 0
16 18 1 0
17 19 1 0
20 18 1 0
21 19 1 0
7 9 1 0
9 10 1 0
20 21 1 0
3 4 1 0
17 22 2 0
1 2 2 0
18 23 2 0
24 25 2 0
4 5 1 0
25 26 1 0
24 1 1 0
5 6 1 0
9 14 1 0
26 27 1 0
10 11 1 0
27 28 1 0
11 12 1 0
27 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 402.54Molecular Weight (Monoisotopic): 402.2519AlogP: 2.80#Rotatable Bonds: 8Polar Surface Area: 70.08Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.56CX LogP: 2.42CX LogD: 1.23Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.68Np Likeness Score: -0.90
References 1. Tasler S, Baumgartner R, Aschenbrenner A, Ammendola A, Wolf K, Wieber T, Schachtner J, Blisse M, Quotschalla U, Ney P.. (2010) A vHTS approach for the identification of beta-adrenoceptor ligands., 20 (11): [PMID:20434333 ] [10.1016/j.bmcl.2010.04.009 ]