2-((1-(3-(2-allylphenoxy)-2-hydroxypropyl)piperidin-4-yl)methyl)-5-hydroxy-1H-benzo[de]isoquinoline-1,3(2H)-dione

ID: ALA1085014

PubChem CID: 46889701

Max Phase: Preclinical

Molecular Formula: C30H32N2O5

Molecular Weight: 500.60

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CCc1ccccc1OCC(O)CN1CCC(CN2C(=O)c3cccc4cc(O)cc(c34)C2=O)CC1

Standard InChI:  InChI=1S/C30H32N2O5/c1-2-6-21-7-3-4-10-27(21)37-19-24(34)18-31-13-11-20(12-14-31)17-32-29(35)25-9-5-8-22-15-23(33)16-26(28(22)25)30(32)36/h2-5,7-10,15-16,20,24,33-34H,1,6,11-14,17-19H2

Standard InChI Key:  WCGAHWOFNPWVLF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    8.9914  -12.2777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7078  -11.8644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7050  -11.0338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4179  -10.6186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1339  -11.0284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8468  -10.6133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5628  -11.0231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8437   -9.7883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2758  -10.6079    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.9916  -11.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7024  -10.6092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7036   -9.7838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9877   -9.3718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2707   -9.7852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4181   -9.3713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1325   -9.7838    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1268  -10.6138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8412   -9.3743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8387  -11.0227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8332  -11.8432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5423  -12.2591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2585  -11.8486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5561   -9.7913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5516  -10.6148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2614  -11.0287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9763  -10.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9768   -9.7934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2663   -9.3833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4114  -11.0246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8428   -8.5493    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2766  -11.8648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2732  -11.0359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9855  -10.6222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9827   -9.7972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6958   -9.3824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6931   -8.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6914   -9.3812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  6  8  1  0
 16 18  1  0
 17 19  1  0
 23 18  1  0
 24 19  2  0
  7  9  1  0
 19 20  1  0
  9 10  1  0
 20 21  2  0
  3  4  1  0
 21 22  1  0
 22 25  2  0
  1  2  2  0
  4  5  1  0
 23 24  1  0
 31  1  1  0
 24 25  1  0
  5  6  1  0
 25 26  1  0
  9 14  1  0
 26 27  2  0
 10 11  1  0
 27 28  1  0
 28 23  2  0
 11 12  1  0
 17 29  2  0
 12 13  1  0
 18 30  2  0
 31 32  2  0
 13 14  1  0
 32 33  1  0
  2  3  1  0
 12 15  1  0
  6  7  1  0
 33 34  1  0
 15 16  1  0
 34 35  1  0
 16 17  1  0
 35 36  2  0
  3 33  2  0
 27 37  1  0
M  END

Associated Targets(Human)

ADRB1 Tclin Beta-1 adrenergic receptor (6630 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRB2 Tclin Beta-2 adrenergic receptor (11824 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRB3 Tclin Beta-3 adrenergic receptor (5850 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 500.60Molecular Weight (Monoisotopic): 500.2311AlogP: 4.02#Rotatable Bonds: 9
Polar Surface Area: 90.31Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.85CX Basic pKa: 8.25CX LogP: 3.52CX LogD: 3.02
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.34Np Likeness Score: -0.40

References

1. Tasler S, Baumgartner R, Aschenbrenner A, Ammendola A, Wolf K, Wieber T, Schachtner J, Blisse M, Quotschalla U, Ney P..  (2010)  A vHTS approach for the identification of beta-adrenoceptor ligands.,  20  (11): [PMID:20434333] [10.1016/j.bmcl.2010.04.009]

Source