The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((1-(3-(2-allylphenoxy)-2-hydroxypropyl)piperidin-4-yl)methyl)-5-hydroxy-1H-benzo[de]isoquinoline-1,3(2H)-dione ID: ALA1085014
PubChem CID: 46889701
Max Phase: Preclinical
Molecular Formula: C30H32N2O5
Molecular Weight: 500.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=CCc1ccccc1OCC(O)CN1CCC(CN2C(=O)c3cccc4cc(O)cc(c34)C2=O)CC1
Standard InChI: InChI=1S/C30H32N2O5/c1-2-6-21-7-3-4-10-27(21)37-19-24(34)18-31-13-11-20(12-14-31)17-32-29(35)25-9-5-8-22-15-23(33)16-26(28(22)25)30(32)36/h2-5,7-10,15-16,20,24,33-34H,1,6,11-14,17-19H2
Standard InChI Key: WCGAHWOFNPWVLF-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
8.9914 -12.2777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7078 -11.8644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7050 -11.0338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4179 -10.6186 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1339 -11.0284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8468 -10.6133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5628 -11.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8437 -9.7883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2758 -10.6079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9916 -11.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7024 -10.6092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7036 -9.7838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9877 -9.3718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2707 -9.7852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4181 -9.3713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1325 -9.7838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1268 -10.6138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8412 -9.3743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8387 -11.0227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8332 -11.8432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5423 -12.2591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2585 -11.8486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5561 -9.7913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5516 -10.6148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2614 -11.0287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9763 -10.6201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9768 -9.7934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2663 -9.3833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4114 -11.0246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8428 -8.5493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2766 -11.8648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2732 -11.0359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9855 -10.6222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9827 -9.7972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6958 -9.3824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6931 -8.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6914 -9.3812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6 8 1 0
16 18 1 0
17 19 1 0
23 18 1 0
24 19 2 0
7 9 1 0
19 20 1 0
9 10 1 0
20 21 2 0
3 4 1 0
21 22 1 0
22 25 2 0
1 2 2 0
4 5 1 0
23 24 1 0
31 1 1 0
24 25 1 0
5 6 1 0
25 26 1 0
9 14 1 0
26 27 2 0
10 11 1 0
27 28 1 0
28 23 2 0
11 12 1 0
17 29 2 0
12 13 1 0
18 30 2 0
31 32 2 0
13 14 1 0
32 33 1 0
2 3 1 0
12 15 1 0
6 7 1 0
33 34 1 0
15 16 1 0
34 35 1 0
16 17 1 0
35 36 2 0
3 33 2 0
27 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 500.60Molecular Weight (Monoisotopic): 500.2311AlogP: 4.02#Rotatable Bonds: 9Polar Surface Area: 90.31Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.85CX Basic pKa: 8.25CX LogP: 3.52CX LogD: 3.02Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.34Np Likeness Score: -0.40
References 1. Tasler S, Baumgartner R, Aschenbrenner A, Ammendola A, Wolf K, Wieber T, Schachtner J, Blisse M, Quotschalla U, Ney P.. (2010) A vHTS approach for the identification of beta-adrenoceptor ligands., 20 (11): [PMID:20434333 ] [10.1016/j.bmcl.2010.04.009 ]