The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((1-(3-(2-allylphenoxy)-2-hydroxypropyl)piperidin-4-yl)methyl)isoindoline-1,3-dione ID: ALA1085016
PubChem CID: 46889729
Max Phase: Preclinical
Molecular Formula: C26H30N2O4
Molecular Weight: 434.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=CCc1ccccc1OCC(O)CN1CCC(CN2C(=O)c3ccccc3C2=O)CC1
Standard InChI: InChI=1S/C26H30N2O4/c1-2-7-20-8-3-6-11-24(20)32-18-21(29)17-27-14-12-19(13-15-27)16-28-25(30)22-9-4-5-10-23(22)26(28)31/h2-6,8-11,19,21,29H,1,7,12-18H2
Standard InChI Key: ZRTLUFPYPDJNIH-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
20.5081 -18.6444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2245 -18.2310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2216 -17.4005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9346 -16.9853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6506 -17.3951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3635 -16.9799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0795 -17.3897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3604 -16.1549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.7924 -16.9745 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5083 -17.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2191 -16.9758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2203 -16.1505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5044 -15.7385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7874 -16.1518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9347 -15.7380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6492 -16.1505 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7932 -18.2315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7899 -17.4026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5021 -16.9889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7356 -16.9672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4030 -15.8112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9551 -16.4242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5411 -17.1344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9490 -17.8458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7708 -17.8484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1829 -17.1335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7726 -16.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5728 -15.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.1240 -17.5209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4994 -16.1639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2125 -15.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2098 -14.9240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12 15 1 0
6 7 1 0
15 16 1 0
17 18 2 0
3 19 2 0
18 19 1 0
6 8 1 0
16 20 1 0
7 9 1 0
9 10 1 0
20 23 1 0
22 21 1 0
21 16 1 0
3 4 1 0
1 2 2 0
22 23 2 0
4 5 1 0
23 24 1 0
17 1 1 0
24 25 2 0
5 6 1 0
25 26 1 0
9 14 1 0
26 27 2 0
27 22 1 0
10 11 1 0
21 28 2 0
11 12 1 0
20 29 2 0
12 13 1 0
19 30 1 0
13 14 1 0
30 31 1 0
2 3 1 0
31 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.54Molecular Weight (Monoisotopic): 434.2206AlogP: 3.16#Rotatable Bonds: 9Polar Surface Area: 70.08Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.54CX LogP: 3.52CX LogD: 2.34Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.49Np Likeness Score: -0.76
References 1. Tasler S, Baumgartner R, Aschenbrenner A, Ammendola A, Wolf K, Wieber T, Schachtner J, Blisse M, Quotschalla U, Ney P.. (2010) A vHTS approach for the identification of beta-adrenoceptor ligands., 20 (11): [PMID:20434333 ] [10.1016/j.bmcl.2010.04.009 ]