2-((1-(2-hydroxy-3-(2-isopropylphenoxy)propyl)piperidin-4-yl)methyl)isoindoline-1,3-dione

ID: ALA1085270

PubChem CID: 46889730

Max Phase: Preclinical

Molecular Formula: C26H32N2O4

Molecular Weight: 436.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)c1ccccc1OCC(O)CN1CCC(CN2C(=O)c3ccccc3C2=O)CC1

Standard InChI:  InChI=1S/C26H32N2O4/c1-18(2)21-7-5-6-10-24(21)32-17-20(29)16-27-13-11-19(12-14-27)15-28-25(30)22-8-3-4-9-23(22)26(28)31/h3-10,18-20,29H,11-17H2,1-2H3

Standard InChI Key:  HTODTPFUFZLFBO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -2.5253  -25.0194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8088  -24.6060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8117  -23.7755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0988  -23.3603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3828  -23.7701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3302  -23.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0462  -23.7647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3270  -22.5299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7591  -23.3495    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4750  -23.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1858  -23.3508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1869  -22.5255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4711  -22.1135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7540  -22.5268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9014  -22.1130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6159  -22.5255    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2401  -24.6065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2435  -23.7776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5312  -23.3639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7022  -23.3422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3697  -22.1862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9218  -22.7992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5078  -23.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9157  -24.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7375  -24.2234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1496  -23.5085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7393  -22.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5395  -21.3789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0907  -23.8959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5339  -22.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8208  -22.1240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2498  -22.1288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 12 15  1  0
  6  7  1  0
 15 16  1  0
 17 18  2  0
  3 19  2  0
 18 19  1  0
  6  8  1  0
 16 20  1  0
  7  9  1  0
  9 10  1  0
 20 23  1  0
 22 21  1  0
 21 16  1  0
  3  4  1  0
  1  2  2  0
 22 23  2  0
  4  5  1  0
 23 24  1  0
 17  1  1  0
 24 25  2  0
  5  6  1  0
 25 26  1  0
  9 14  1  0
 26 27  2  0
 27 22  1  0
 10 11  1  0
 21 28  2  0
 11 12  1  0
 20 29  2  0
 12 13  1  0
 19 30  1  0
 13 14  1  0
 30 31  1  0
  2  3  1  0
 30 32  1  0
M  END

Associated Targets(Human)

ADRB1 Tclin Beta-1 adrenergic receptor (6630 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRB2 Tclin Beta-2 adrenergic receptor (11824 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRB3 Tclin Beta-3 adrenergic receptor (5850 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 436.55Molecular Weight (Monoisotopic): 436.2362AlogP: 3.56#Rotatable Bonds: 8
Polar Surface Area: 70.08Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.56CX LogP: 3.66CX LogD: 2.47
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.64Np Likeness Score: -0.92

References

1. Tasler S, Baumgartner R, Aschenbrenner A, Ammendola A, Wolf K, Wieber T, Schachtner J, Blisse M, Quotschalla U, Ney P..  (2010)  A vHTS approach for the identification of beta-adrenoceptor ligands.,  20  (11): [PMID:20434333] [10.1016/j.bmcl.2010.04.009]

Source