The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2-methoxy-4'-methylbiphenyl-4-yl)((1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methanone ID: ALA1085299
PubChem CID: 46890654
Max Phase: Preclinical
Molecular Formula: C25H31NO2
Molecular Weight: 377.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)N2C[C@]3(C)C[C@H]2CC(C)(C)C3)ccc1-c1ccc(C)cc1
Standard InChI: InChI=1S/C25H31NO2/c1-17-6-8-18(9-7-17)21-11-10-19(12-22(21)28-5)23(27)26-16-25(4)14-20(26)13-24(2,3)15-25/h6-12,20H,13-16H2,1-5H3/t20-,25-/m1/s1
Standard InChI Key: GEBXIWZNCWWKDS-CJFMBICVSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
-2.2707 -5.1007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5269 -4.7548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7862 -5.1206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4655 -5.9088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6061 -5.9247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9556 -6.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1295 -6.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8744 -10.0360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8755 -10.8634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1617 -11.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4463 -10.8630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4493 -10.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1636 -9.6231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1661 -8.7980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4551 -8.3868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4572 -7.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1725 -7.1513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8871 -7.5704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8814 -8.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1761 -6.3262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8913 -5.9167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5726 -4.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0084 -4.9044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5618 -5.5106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8017 -7.3204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9492 -4.6368 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.6000 -8.8158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.3251 -8.4048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1619 -12.1099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 7 1 0
14 15 2 0
1 4 1 0
15 16 1 0
16 17 2 0
8 9 2 0
17 18 1 0
3 5 1 0
18 19 2 0
19 14 1 0
9 10 1 0
17 20 1 0
2 3 1 0
20 21 2 0
20 4 1 0
10 11 2 0
3 22 1 0
4 6 1 0
3 23 1 0
11 12 1 0
1 24 1 0
24 7 1 0
1 2 1 0
7 25 1 1
12 13 2 0
1 26 1 1
13 8 1 0
19 27 1 0
5 7 1 0
27 28 1 0
13 14 1 0
10 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 377.53Molecular Weight (Monoisotopic): 377.2355AlogP: 5.71#Rotatable Bonds: 3Polar Surface Area: 29.54Molecular Species: NEUTRALHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.49CX LogD: 5.49Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.69Np Likeness Score: -0.53
References 1. Crombie AL, Antrilli TM, Campbell BA, Crandall DL, Failli AA, He Y, Kern JC, Moore WJ, Nogle LM, Trybulski EJ.. (2010) Synthesis and evaluation of azabicyclo[3.2.1]octane derivatives as potent mixed vasopressin antagonists., 20 (12): [PMID:20471258 ] [10.1016/j.bmcl.2010.04.068 ]