(2-methoxy-4'-methylbiphenyl-4-yl)((1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methanone

ID: ALA1085299

PubChem CID: 46890654

Max Phase: Preclinical

Molecular Formula: C25H31NO2

Molecular Weight: 377.53

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(C(=O)N2C[C@]3(C)C[C@H]2CC(C)(C)C3)ccc1-c1ccc(C)cc1

Standard InChI:  InChI=1S/C25H31NO2/c1-17-6-8-18(9-7-17)21-11-10-19(12-22(21)28-5)23(27)26-16-25(4)14-20(26)13-24(2,3)15-25/h6-12,20H,13-16H2,1-5H3/t20-,25-/m1/s1

Standard InChI Key:  GEBXIWZNCWWKDS-CJFMBICVSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   -2.2707   -5.1007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5269   -4.7548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7862   -5.1206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4655   -5.9088    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6061   -5.9247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9556   -6.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1295   -6.5642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8744  -10.0360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8755  -10.8634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1617  -11.2764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4463  -10.8630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4493  -10.0323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1636   -9.6231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1661   -8.7980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4551   -8.3868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4572   -7.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1725   -7.1513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8871   -7.5704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8814   -8.3934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1761   -6.3262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8913   -5.9167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5726   -4.3192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0084   -4.9044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5618   -5.5106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8017   -7.3204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9492   -4.6368    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6000   -8.8158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3251   -8.4048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1619  -12.1099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  7  1  0
 14 15  2  0
  1  4  1  0
 15 16  1  0
 16 17  2  0
  8  9  2  0
 17 18  1  0
  3  5  1  0
 18 19  2  0
 19 14  1  0
  9 10  1  0
 17 20  1  0
  2  3  1  0
 20 21  2  0
 20  4  1  0
 10 11  2  0
  3 22  1  0
  4  6  1  0
  3 23  1  0
 11 12  1  0
  1 24  1  0
 24  7  1  0
  1  2  1  0
  7 25  1  1
 12 13  2  0
  1 26  1  1
 13  8  1  0
 19 27  1  0
  5  7  1  0
 27 28  1  0
 13 14  1  0
 10 29  1  0
M  END

Associated Targets(Human)

AVPR1A Tclin Vasopressin V1a receptor (5412 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
AVPR2 Tclin Vasopressin V2 receptor (2912 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 377.53Molecular Weight (Monoisotopic): 377.2355AlogP: 5.71#Rotatable Bonds: 3
Polar Surface Area: 29.54Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.49CX LogD: 5.49
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.69Np Likeness Score: -0.53

References

1. Crombie AL, Antrilli TM, Campbell BA, Crandall DL, Failli AA, He Y, Kern JC, Moore WJ, Nogle LM, Trybulski EJ..  (2010)  Synthesis and evaluation of azabicyclo[3.2.1]octane derivatives as potent mixed vasopressin antagonists.,  20  (12): [PMID:20471258] [10.1016/j.bmcl.2010.04.068]

Source