The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[2,2-dimethyl-3-(N-(4-cyanobenzoyl)aminoi)-5-phenylpentanoic anhydride] ID: ALA108540
PubChem CID: 10394816
Max Phase: Preclinical
Molecular Formula: C42H42N4O5
Molecular Weight: 682.82
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C(=O)OC(=O)C(C)(C)C(CCc1ccccc1)NC(=O)c1ccc(C#N)cc1)C(CCc1ccccc1)NC(=O)c1ccc(C#N)cc1
Standard InChI: InChI=1S/C42H42N4O5/c1-41(2,35(25-19-29-11-7-5-8-12-29)45-37(47)33-21-15-31(27-43)16-22-33)39(49)51-40(50)42(3,4)36(26-20-30-13-9-6-10-14-30)46-38(48)34-23-17-32(28-44)18-24-34/h5-18,21-24,35-36H,19-20,25-26H2,1-4H3,(H,45,47)(H,46,48)
Standard InChI Key: HQNCLEFIYXURJH-UHFFFAOYSA-N
Molfile:
RDKit 2D
51 54 0 0 0 0 0 0 0 0999 V2000
4.4667 -2.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8917 -2.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6042 -2.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7542 -2.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1792 -2.7375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7375 -2.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6167 -2.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0250 -2.7292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3292 -2.7417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3125 -2.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0417 -2.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2917 -4.3750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9500 -4.4000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2333 -3.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5792 -3.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9042 -2.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4500 -2.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4625 -1.5042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8875 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7375 -1.4917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6125 -1.5125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0375 -1.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3042 -1.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1875 -2.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9042 -3.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4417 -3.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1542 -2.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5208 -3.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8667 -3.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1792 -3.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0042 -3.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1625 -3.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3375 -3.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 -1.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0167 -1.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1917 -3.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1542 -3.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5250 -2.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8667 -2.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 -0.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0167 -0.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7292 0.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3042 0.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0375 0.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6042 0.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2917 0.9833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0292 0.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6042 0.9583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7292 0.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0125 1.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 1.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 2 1 0
4 1 1 0
5 1 1 0
6 8 1 0
7 9 1 0
8 10 1 0
9 11 1 0
10 3 1 0
11 4 1 0
12 15 3 0
13 14 3 0
14 28 1 0
15 29 1 0
16 7 1 0
17 6 1 0
18 1 2 0
19 2 2 0
20 6 2 0
21 7 2 0
22 11 1 0
23 10 1 0
24 16 2 0
25 16 1 0
26 17 2 0
27 17 1 0
28 36 1 0
29 39 1 0
30 3 1 0
31 3 1 0
32 4 1 0
33 4 1 0
34 22 1 0
35 23 1 0
36 25 2 0
37 26 1 0
38 24 1 0
39 27 2 0
40 34 1 0
41 35 1 0
42 41 2 0
43 41 1 0
44 40 2 0
45 40 1 0
46 43 2 0
47 44 1 0
48 45 2 0
49 42 1 0
50 46 1 0
51 48 1 0
28 38 2 0
51 47 2 0
29 37 2 0
50 49 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 682.82Molecular Weight (Monoisotopic): 682.3155AlogP: 6.71#Rotatable Bonds: 14Polar Surface Area: 149.15Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 8.60CX LogD: 8.60Aromatic Rings: 4Heavy Atoms: 51QED Weighted: 0.11Np Likeness Score: -0.29
References 1. Iijima K, Katada J, Yasuda E, Uno I, Hayashi Y.. (1999) N-[2,2-dimethyl-3-(N-(4-cyanobenzoyl)amino)nonanoyl]-L-phenylalanine ethyl ester as a stable ester-type inhibitor of chymotrypsin-like serine proteases: structural requirements for potent inhibition of alpha-chymotrypsin., 42 (2): [PMID:9925737 ] [10.1021/jm980562h ] 2. Iijima K, Katada J, Hayashi Y.. (1999) Symmetrical anhydride-type serine protease inhibitors: structure-activity relationship studies of human chymase inhibitors., 9 (3): [PMID:10091694 ] [10.1016/s0960-894x(99)00012-8 ]