arteminorin C

ID: ALA1085430

PubChem CID: 44178672

Max Phase: Preclinical

Molecular Formula: C20H14O9

Molecular Weight: 398.32

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: Arteminorin C | arteminorin C|CHEMBL1085430|BDBM50310442

Canonical SMILES:  COc1cc2cc(-c3cc4cc(O)c(O)cc4oc3=O)c(=O)oc2c(OC)c1O

Standard InChI:  InChI=1S/C20H14O9/c1-26-15-6-9-4-11(20(25)29-17(9)18(27-2)16(15)23)10-3-8-5-12(21)13(22)7-14(8)28-19(10)24/h3-7,21-23H,1-2H3

Standard InChI Key:  XFGGVXYNIBUVBK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   -1.2514   -1.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2526   -1.8607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5378   -2.2735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5396   -0.6205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1758   -1.0297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1746   -1.8627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8915   -2.2780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6142   -1.8648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6154   -1.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8939   -0.6119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5381   -3.0985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2527   -3.5108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9660   -0.6210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6804   -1.0336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3275   -2.2793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3308   -0.6210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0431   -1.0389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0494    0.6101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3298    0.2012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6165    0.6157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7627    0.1936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7557   -0.6315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4658   -1.0483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1832   -0.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1861    0.1873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4755    0.6003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9019    0.5975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8954   -1.0574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9674   -2.2726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 13 14  1  0
  1  2  2  0
  8 15  2  0
  5  4  2  0
  9 16  1  0
 16 17  2  0
  4  1  1  0
  5 10  1  0
  6  7  1  0
 16 19  1  0
 17 22  1  0
 21 18  1  0
 18 19  1  0
  7  8  1  0
 19 20  2  0
  8  9  1  0
  9 10  2  0
 21 22  2  0
  5  6  1  0
 22 23  1  0
  3 11  1  0
 23 24  2  0
 24 25  1  0
 11 12  1  0
 25 26  2  0
 26 21  1  0
  2  3  1  0
 25 27  1  0
  1 13  1  0
 24 28  1  0
  3  6  2  0
  2 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA1085430

    ARTEMINORIN C

Associated Targets(Human)

XDH Tclin Xanthine dehydrogenase (1038 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 398.32Molecular Weight (Monoisotopic): 398.0638AlogP: 2.70#Rotatable Bonds: 3
Polar Surface Area: 139.57Molecular Species: NEUTRALHBA: 9HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 7.46CX Basic pKa: CX LogP: 1.78CX LogD: 1.47
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.35Np Likeness Score: 0.93

References

1. He ZZ, Yan JF, Song ZJ, Ye F, Liao X, Peng SL, Ding LS..  (2009)  Chemical constituents from the aerial parts of Artemisia minor.,  72  (6): [PMID:19476336] [10.1021/np800643n]

Source