The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
arteminorin C ID: ALA1085430
PubChem CID: 44178672
Max Phase: Preclinical
Molecular Formula: C20H14O9
Molecular Weight: 398.32
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Arteminorin C | arteminorin C|CHEMBL1085430|BDBM50310442
Canonical SMILES: COc1cc2cc(-c3cc4cc(O)c(O)cc4oc3=O)c(=O)oc2c(OC)c1O
Standard InChI: InChI=1S/C20H14O9/c1-26-15-6-9-4-11(20(25)29-17(9)18(27-2)16(15)23)10-3-8-5-12(21)13(22)7-14(8)28-19(10)24/h3-7,21-23H,1-2H3
Standard InChI Key: XFGGVXYNIBUVBK-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
-1.2514 -1.0333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2526 -1.8607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5378 -2.2735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5396 -0.6205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1758 -1.0297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1746 -1.8627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8915 -2.2780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6142 -1.8648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6154 -1.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8939 -0.6119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5381 -3.0985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2527 -3.5108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9660 -0.6210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6804 -1.0336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3275 -2.2793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3308 -0.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0431 -1.0389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0494 0.6101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3298 0.2012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6165 0.6157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7627 0.1936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7557 -0.6315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4658 -1.0483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1832 -0.6410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1861 0.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4755 0.6003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9019 0.5975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8954 -1.0574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9674 -2.2726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13 14 1 0
1 2 2 0
8 15 2 0
5 4 2 0
9 16 1 0
16 17 2 0
4 1 1 0
5 10 1 0
6 7 1 0
16 19 1 0
17 22 1 0
21 18 1 0
18 19 1 0
7 8 1 0
19 20 2 0
8 9 1 0
9 10 2 0
21 22 2 0
5 6 1 0
22 23 1 0
3 11 1 0
23 24 2 0
24 25 1 0
11 12 1 0
25 26 2 0
26 21 1 0
2 3 1 0
25 27 1 0
1 13 1 0
24 28 1 0
3 6 2 0
2 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 398.32Molecular Weight (Monoisotopic): 398.0638AlogP: 2.70#Rotatable Bonds: 3Polar Surface Area: 139.57Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.46CX Basic pKa: ┄CX LogP: 1.78CX LogD: 1.47Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.35Np Likeness Score: 0.93
References 1. He ZZ, Yan JF, Song ZJ, Ye F, Liao X, Peng SL, Ding LS.. (2009) Chemical constituents from the aerial parts of Artemisia minor., 72 (6): [PMID:19476336 ] [10.1021/np800643n ]