(2S,4S)-1-(2-(4-(azepan-1-yl)-2-methyl-4-oxobutan-2-ylamino)acetyl)-4-fluoropyrrolidine-2-carbonitrile

ID: ALA1085598

PubChem CID: 46890853

Max Phase: Preclinical

Molecular Formula: C18H29FN4O2

Molecular Weight: 352.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(CC(=O)N1CCCCCC1)NCC(=O)N1C[C@@H](F)C[C@H]1C#N

Standard InChI:  InChI=1S/C18H29FN4O2/c1-18(2,10-16(24)22-7-5-3-4-6-8-22)21-12-17(25)23-13-14(19)9-15(23)11-20/h14-15,21H,3-10,12-13H2,1-2H3/t14-,15-/m0/s1

Standard InChI Key:  VTDRHIJOQBZZOM-GJZGRUSLSA-N

Molfile:  

     RDKit          2D

 25 26  0  0  0  0  0  0  0  0999 V2000
    7.3363  -13.3015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0393  -13.7170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3472  -12.4768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7300  -13.2501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4579  -13.6384    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1581  -13.2020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8860  -13.5902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5860  -13.1539    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9137  -14.4147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3490  -13.4587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8801  -12.8274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4437  -12.1273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6431  -12.3259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5496  -14.2588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7517  -15.0587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1417  -12.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3125  -12.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6170  -13.7056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6713  -14.5245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0598  -15.0811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9422  -13.2319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2460  -14.9537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1503  -13.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8434  -14.2349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7537  -11.3627    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
 11 12  1  0
 12 13  1  0
 13  8  1  0
 10 14  1  1
  1  3  2  0
 14 15  3  0
  4 16  1  0
  2  4  1  0
  4 17  1  0
  4  5  1  0
  1 18  1  0
  5  6  1  0
 18 19  1  0
  6  7  1  0
 19 20  1  0
  7  8  1  0
 18 21  1  0
  7  9  2  0
 20 22  1  0
  8 10  1  0
 21 23  1  0
  1  2  1  0
 22 24  1  0
 23 24  1  0
 10 11  1  0
 12 25  1  1
M  END

Associated Targets(Human)

DPP9 Tchem Dipeptidyl peptidase IX (1624 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DPP8 Tchem Dipeptidyl peptidase VIII (2139 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DPP4 Tclin Dipeptidyl peptidase IV (7109 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 352.45Molecular Weight (Monoisotopic): 352.2275AlogP: 1.61#Rotatable Bonds: 5
Polar Surface Area: 76.44Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.41CX LogP: 0.17CX LogD: -0.88
Aromatic Rings: Heavy Atoms: 25QED Weighted: 0.82Np Likeness Score: -0.75

References

1. Yeh TK, Tsai TY, Hsu T, Cheng JH, Chen X, Song JS, Shy HS, Chiou MC, Chien CH, Tseng YJ, Huang CY, Yeh KC, Huang YL, Huang CH, Huang YW, Wang MH, Tang HK, Chao YS, Chen CT, Jiaang WT..  (2010)  (2S,4S)-1-[2-(1,1-dimethyl-3-oxo-3-pyrrolidin-1-yl-propylamino)acetyl]-4-fluoro-pyrrolidine-2-carbonitrile: a potent, selective, and orally bioavailable dipeptide-derived inhibitor of dipeptidyl peptidase IV.,  20  (12): [PMID:20483603] [10.1016/j.bmcl.2010.04.124]

Source