The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Manglieside B ID: ALA1085764
PubChem CID: 25111341
Max Phase: Preclinical
Molecular Formula: C20H28O11
Molecular Weight: 444.43
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CCc1ccc(O)c(O[C@@H]2O[C@H](CO[C@@H]3OC[C@](O)(CO)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)c1
Standard InChI: InChI=1S/C20H28O11/c1-2-3-10-4-5-11(22)12(6-10)30-18-16(25)15(24)14(23)13(31-18)7-28-19-17(26)20(27,8-21)9-29-19/h2,4-6,13-19,21-27H,1,3,7-9H2/t13-,14-,15+,16-,17+,18-,19-,20-/m1/s1
Standard InChI Key: IJQCJDUCBNKRAY-LTRJMQNCSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
10.0834 -24.6950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0834 -25.5246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7978 -25.9371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5169 -25.5246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5169 -24.6950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7978 -24.2779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7966 -23.4529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3678 -24.2842 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3688 -25.9371 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7966 -26.7621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0816 -27.1736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0805 -27.9986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2318 -24.2832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9458 -24.6964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9399 -25.5212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6532 -25.9343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3691 -25.5225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3672 -24.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6534 -24.2838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6504 -23.4588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6519 -26.7593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3658 -27.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3646 -27.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4159 -28.4845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6698 -29.2694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4949 -29.2705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7507 -28.4862 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6311 -28.2301 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9512 -29.6771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2399 -29.2592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6616 -30.0941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
15 16 1 0
1 8 1 6
16 17 2 0
1 6 1 0
17 18 1 0
2 9 1 1
18 19 2 0
19 14 1 0
2 3 1 0
19 20 1 0
3 10 1 6
16 21 1 0
3 4 1 0
21 22 1 0
10 11 1 0
22 23 2 0
12 24 1 0
5 4 1 0
12 11 1 6
6 5 1 0
5 13 1 6
24 25 1 0
25 26 1 0
26 27 1 0
27 12 1 0
24 28 1 1
13 14 1 0
25 29 1 6
6 7 1 1
29 30 1 0
14 15 2 0
25 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.43Molecular Weight (Monoisotopic): 444.1632AlogP: -2.24#Rotatable Bonds: 8Polar Surface Area: 178.53Molecular Species: NEUTRALHBA: 11HBD: 7#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.78CX Basic pKa: ┄CX LogP: -1.08CX LogD: -1.08Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.22Np Likeness Score: 2.49
References 1. Allen JG, Fotsch C, Babij P.. (2010) Emerging targets in osteoporosis disease modification., 53 (11): [PMID:20218623 ] [10.1021/jm9018756 ]