The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1-(3-(9H-carbazol-4-yloxy)-2-hydroxypropyl)piperidin-4-yl)(4-fluorophenyl)methanone ID: ALA1086077
PubChem CID: 46889854
Max Phase: Preclinical
Molecular Formula: C27H27FN2O3
Molecular Weight: 446.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccc(F)cc1)C1CCN(CC(O)COc2cccc3[nH]c4ccccc4c23)CC1
Standard InChI: InChI=1S/C27H27FN2O3/c28-20-10-8-18(9-11-20)27(32)19-12-14-30(15-13-19)16-21(31)17-33-25-7-3-6-24-26(25)22-4-1-2-5-23(22)29-24/h1-11,19,21,29,31H,12-17H2
Standard InChI Key: JUCXTUIBEHQPPZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
10.1967 -2.0979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9130 -1.6847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9101 -0.8545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6228 -0.4394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3386 -0.8491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0514 -0.4340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7672 -0.8437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0482 0.3908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4799 -0.4286 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1956 -0.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9061 -0.4299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9072 0.3953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1917 0.8072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4748 0.3939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6215 0.8076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4821 -1.6852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4750 -0.8553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1908 -0.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8617 -0.3021 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1982 0.4524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0167 0.3653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4993 1.0297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1647 1.7814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3428 1.8648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8637 1.1994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3358 0.3952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3338 -0.4301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0472 -0.8425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7625 -0.4300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7598 0.3990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0458 0.8076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6215 1.6323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4773 -0.8415 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16 17 2 0
6 7 1 0
17 18 1 0
3 18 2 0
6 8 1 0
18 21 1 0
20 19 1 0
19 17 1 0
7 9 1 0
9 10 1 0
20 21 2 0
3 4 1 0
21 22 1 0
1 2 2 0
22 23 2 0
4 5 1 0
23 24 1 0
16 1 1 0
24 25 2 0
25 20 1 0
5 6 1 0
15 26 1 0
9 14 1 0
26 27 2 0
10 11 1 0
27 28 1 0
11 12 1 0
28 29 2 0
12 13 1 0
29 30 1 0
13 14 1 0
30 31 2 0
31 26 1 0
2 3 1 0
15 32 2 0
12 15 1 0
29 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.52Molecular Weight (Monoisotopic): 446.2006AlogP: 4.79#Rotatable Bonds: 7Polar Surface Area: 65.56Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.87CX LogP: 4.29CX LogD: 3.70Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.40Np Likeness Score: -0.79
References 1. Tasler S, Baumgartner R, Aschenbrenner A, Ammendola A, Wolf K, Wieber T, Schachtner J, Blisse M, Quotschalla U, Ney P.. (2010) A vHTS approach for the identification of beta-adrenoceptor ligands., 20 (11): [PMID:20434333 ] [10.1016/j.bmcl.2010.04.009 ]