4-[3-(4-Methylphenyl)-4,4-diethyl-5-oxo-2-thioxoimidazolidin-1-yl]-2-trifluoromethylbenzonitrile

ID: ALA1086362

PubChem CID: 46889901

Max Phase: Preclinical

Molecular Formula: C22H20F3N3OS

Molecular Weight: 431.48

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC1(CC)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=S)N1c1ccc(C)cc1

Standard InChI:  InChI=1S/C22H20F3N3OS/c1-4-21(5-2)19(29)27(20(30)28(21)16-9-6-14(3)7-10-16)17-11-8-15(13-26)18(12-17)22(23,24)25/h6-12H,4-5H2,1-3H3

Standard InChI Key:  MDNREXJSWLWGIZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   -2.6471   -7.9453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6482   -8.7726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9335   -9.1854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2171   -8.7721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2199   -7.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9353   -7.5325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3628   -7.5272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0772   -7.1149    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3630   -9.1845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0771   -8.7714    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3637  -10.0094    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5759   -8.3874    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5495   -9.2491    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5422  -10.0740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2447  -10.3220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7237   -9.6503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2328   -8.9873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2052  -10.5648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4808   -8.2005    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.2375  -11.1451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9541  -10.7326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5475   -9.6414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9674  -10.3536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7923  -10.3452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1984   -9.6252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7734   -8.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9499   -8.9241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0233   -9.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9483  -11.5637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4805  -11.5513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  7  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
  4 13  1  0
 14 18  2  0
  2  9  1  0
 17 19  2  0
  4  5  1  0
 15 20  1  0
  9 10  1  0
 15 21  1  0
 16 22  1  0
  2  3  1  0
  9 11  1  0
 22 23  2  0
  5  6  2  0
 23 24  1  0
  9 12  1  0
 24 25  2  0
 13 14  1  0
 25 26  1  0
  6  1  1  0
 26 27  2  0
 27 22  1  0
  1  2  2  0
 25 28  1  0
 21 29  1  0
  3  4  2  0
  7  8  3  0
 20 30  1  0
M  END

Associated Targets(non-human)

Ar Androgen Receptor (5522 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.48Molecular Weight (Monoisotopic): 431.1279AlogP: 5.58#Rotatable Bonds: 4
Polar Surface Area: 47.34Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.50CX LogD: 6.50
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.59Np Likeness Score: -1.13

References

1. Jung ME, Ouk S, Yoo D, Sawyers CL, Chen C, Tran C, Wongvipat J..  (2010)  Structure-activity relationship for thiohydantoin androgen receptor antagonists for castration-resistant prostate cancer (CRPC).,  53  (7): [PMID:20218717] [10.1021/jm901488g]

Source