4-[3-(4-Methylphenyl)-5,5-diethyl-4-oxo-2-thioxoimidazolidin-1-yl]-2-trifluoromethylbenzonitrile

ID: ALA1086364

PubChem CID: 46889904

Max Phase: Preclinical

Molecular Formula: C22H20F3N3OS

Molecular Weight: 431.48

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC1(CC)C(=O)N(c2ccc(C)cc2)C(=S)N1c1ccc(C#N)c(C(F)(F)F)c1

Standard InChI:  InChI=1S/C22H20F3N3OS/c1-4-21(5-2)19(29)27(16-9-6-14(3)7-10-16)20(30)28(21)17-11-8-15(13-26)18(12-17)22(23,24)25/h6-12H,4-5H2,1-3H3

Standard InChI Key:  MQNOMYXZAXKUJV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    7.6194  -13.0666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6182  -13.8940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3331  -14.3069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0495  -13.8935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0466  -13.0630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3313  -12.6539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9037  -12.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1891  -12.2362    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9034  -14.3059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1893  -13.8929    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.9028  -15.1309    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.6906  -13.5089    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.7172  -14.3705    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7245  -15.1955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5113  -15.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9904  -14.7718    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4995  -14.1087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7474  -13.3219    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.8143  -14.7628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2342  -15.4752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0592  -15.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4653  -14.7466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0403  -14.0336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2167  -14.0455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2902  -14.7367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7732  -16.2258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9208  -15.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5042  -15.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0820  -16.5764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3420  -14.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  7  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
  4 13  1  0
 17 18  2  0
 16 19  1  0
  2  9  1  0
  4  5  1  0
 19 20  2  0
  9 10  1  0
 20 21  1  0
  2  3  1  0
 21 22  2  0
  9 11  1  0
 22 23  1  0
  5  6  2  0
 23 24  2  0
 24 19  1  0
  9 12  1  0
 22 25  1  0
 13 14  1  0
 15 26  2  0
  6  1  1  0
 14 27  1  0
  1  2  2  0
 14 28  1  0
  3  4  2  0
 28 29  1  0
  7  8  3  0
 27 30  1  0
M  END

Associated Targets(non-human)

Ar Androgen Receptor (5522 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.48Molecular Weight (Monoisotopic): 431.1279AlogP: 5.58#Rotatable Bonds: 4
Polar Surface Area: 47.34Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.50CX LogD: 6.50
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.59Np Likeness Score: -1.11

References

1. Jung ME, Ouk S, Yoo D, Sawyers CL, Chen C, Tran C, Wongvipat J..  (2010)  Structure-activity relationship for thiohydantoin androgen receptor antagonists for castration-resistant prostate cancer (CRPC).,  53  (7): [PMID:20218717] [10.1021/jm901488g]

Source