5R-(+)-[4-(2-dimethylaminoethoxy)phenyl]-11,12-dihydro-5H-6,13-dioxabenzo[3,4]cyclohepta[1,2-a]naphthalen-2-ol

ID: ALA1086389

PubChem CID: 44596359

Max Phase: Preclinical

Molecular Formula: C27H27NO4

Molecular Weight: 429.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)CCOc1ccc([C@H]2Oc3ccccc3C3=C2c2ccc(O)cc2OCC3)cc1

Standard InChI:  InChI=1S/C27H27NO4/c1-28(2)14-16-30-20-10-7-18(8-11-20)27-26-22(21-5-3-4-6-24(21)32-27)13-15-31-25-17-19(29)9-12-23(25)26/h3-12,17,27,29H,13-16H2,1-2H3/t27-/m1/s1

Standard InChI Key:  OWFHDXINKUZAPM-HHHXNRCGSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    5.2915   -5.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2903   -6.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0031   -6.9367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0013   -5.2885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7146   -5.6964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7180   -6.5271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4351   -6.9372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1534   -6.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6712   -3.8889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1508   -5.6953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4283   -5.2758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3006   -4.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8496   -3.8279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1622   -4.5441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9296   -5.3775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5344   -5.9935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3719   -5.7774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6014   -4.9397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9950   -4.3273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4416   -4.7194    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8667   -6.9309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8649   -7.7535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5774   -8.1631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2899   -7.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2854   -6.9234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5723   -6.5174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0037   -8.1590    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7146   -7.7452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4285   -8.1539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1395   -7.7401    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.8533   -8.1489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1365   -6.9175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 14 15  2  0
  5 11  1  0
 15 16  1  0
  6  7  1  0
 16 17  2  0
  7  8  1  0
 17 18  1  0
  8 10  1  0
 18 19  2  0
 19 14  1  0
  5  4  2  0
 18 20  1  0
  4  1  1  0
  8 21  1  1
  5  6  1  0
 21 22  2  0
 22 23  1  0
  2  3  1  0
 23 24  2  0
 14  9  1  0
 24 25  1  0
 15 10  1  0
 25 26  2  0
 26 21  1  0
 11 12  1  0
 24 27  1  0
 12 13  1  0
 27 28  1  0
 13  9  1  0
 28 29  1  0
 10 11  2  0
 29 30  1  0
  3  6  2  0
 30 31  1  0
  1  2  2  0
 30 32  1  0
M  END

Associated Targets(Human)

ESR2 Tclin Estrogen receptor beta (9272 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ESR1 Tclin Estrogen receptor alpha (17718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 429.52Molecular Weight (Monoisotopic): 429.1940AlogP: 5.16#Rotatable Bonds: 5
Polar Surface Area: 51.16Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.13CX Basic pKa: 8.52CX LogP: 4.16CX LogD: 3.32
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.61Np Likeness Score: 0.20

References

1. Jain N, Xu J, Kanojia RM, Du F, Jian-Zhong G, Pacia E, Lai MT, Musto A, Allan G, Reuman M, Li X, Hahn D, Cousineau M, Peng S, Ritchie D, Russell R, Lundeen S, Sui Z..  (2009)  Identification and structure-activity relationships of chromene-derived selective estrogen receptor modulators for treatment of postmenopausal symptoms.,  52  (23): [PMID:19366247] [10.1021/jm900146e]

Source