1-(9H-carbazol-4-yloxy)-3-(4-benzylpiperidin-1-yl)propan-2-ol

ID: ALA1086542

PubChem CID: 46889810

Max Phase: Preclinical

Molecular Formula: C27H30N2O2

Molecular Weight: 414.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  OC(COc1cccc2[nH]c3ccccc3c12)CN1CCC(Cc2ccccc2)CC1

Standard InChI:  InChI=1S/C27H30N2O2/c30-22(18-29-15-13-21(14-16-29)17-20-7-2-1-3-8-20)19-31-26-12-6-11-25-27(26)23-9-4-5-10-24(23)28-25/h1-12,21-22,28,30H,13-19H2

Standard InChI Key:  FNPRERNONGSACT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   -2.8364  -20.1554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1203  -19.7423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1232  -18.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4106  -18.4971    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6950  -18.9067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0177  -18.4918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7333  -18.9014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0145  -17.6672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4459  -18.4864    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1615  -18.8991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8719  -18.4877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8730  -17.6627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1576  -17.2509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4408  -17.6641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5872  -17.2504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5509  -19.7427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5580  -18.9131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8423  -18.5007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1712  -18.3599    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8347  -17.6056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0164  -17.6926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5339  -17.0284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8684  -16.2768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6902  -16.1934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1692  -16.8587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3013  -17.6627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2993  -18.4879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0126  -18.9001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7277  -18.4878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7250  -17.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0112  -17.2504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
 12 15  1  0
 16 17  2  0
  6  7  1  0
 17 18  1  0
  3 18  2  0
  6  8  1  0
 18 21  1  0
 20 19  1  0
 19 17  1  0
  7  9  1  0
  9 10  1  0
 20 21  2  0
  3  4  1  0
 21 22  1  0
  1  2  2  0
 22 23  2  0
  4  5  1  0
 23 24  1  0
 16  1  1  0
 24 25  2  0
 25 20  1  0
  5  6  1  0
 15 26  1  0
  9 14  1  0
 26 27  2  0
 10 11  1  0
 27 28  1  0
 11 12  1  0
 28 29  2  0
 12 13  1  0
 29 30  1  0
 13 14  1  0
 30 31  2  0
 31 26  1  0
M  END

Associated Targets(Human)

ADRB1 Tclin Beta-1 adrenergic receptor (6630 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRB2 Tclin Beta-2 adrenergic receptor (11824 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRB3 Tclin Beta-3 adrenergic receptor (5850 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.55Molecular Weight (Monoisotopic): 414.2307AlogP: 5.02#Rotatable Bonds: 7
Polar Surface Area: 48.49Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.98CX LogP: 5.04CX LogD: 3.45
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.45Np Likeness Score: -0.33

References

1. Tasler S, Baumgartner R, Aschenbrenner A, Ammendola A, Wolf K, Wieber T, Schachtner J, Blisse M, Quotschalla U, Ney P..  (2010)  A vHTS approach for the identification of beta-adrenoceptor ligands.,  20  (11): [PMID:20434333] [10.1016/j.bmcl.2010.04.009]

Source