The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-{4-[4-benzoyl-1-(4-chlorophenyl)-1H-pyrazole-3-carbonyl]-1-phenyl-1H-pyrazol-3-yl}-3-dimethylamino-propenone ID: ALA1086793
PubChem CID: 45277903
Max Phase: Preclinical
Molecular Formula: C31H24ClN5O3
Molecular Weight: 550.02
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)/C=C/C(=O)c1nn(-c2ccccc2)cc1C(=O)c1nn(-c2ccc(Cl)cc2)cc1C(=O)c1ccccc1
Standard InChI: InChI=1S/C31H24ClN5O3/c1-35(2)18-17-27(38)28-25(19-36(33-28)23-11-7-4-8-12-23)31(40)29-26(30(39)21-9-5-3-6-10-21)20-37(34-29)24-15-13-22(32)14-16-24/h3-20H,1-2H3/b18-17+
Standard InChI Key: WJBMOBUCEGEMQV-ISLYRVAYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
17.9404 -8.1507 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6227 -7.6764 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3806 -6.8834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5515 -6.8681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2802 -7.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1380 -6.1544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5497 -5.4394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3130 -6.1554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9041 -5.4413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0798 -5.4420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6673 -6.1576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0851 -6.8739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9081 -6.8697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9240 -8.9757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2019 -9.3690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1851 -10.1932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8918 -10.6206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6169 -10.2181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6301 -9.3952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0713 -6.4352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8061 -6.8106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8149 -7.6353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6038 -7.8799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0795 -7.2047 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.5825 -6.5448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0150 -8.5953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5983 -9.3064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0088 -10.0213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8347 -10.0234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2486 -9.3046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8357 -8.5927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9734 -5.8182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5396 -5.1164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0286 -5.6112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7981 -5.7934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2319 -6.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0567 -6.4705 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4904 -7.1723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4475 -5.7438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8765 -11.4456 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
19 14 1 0
4 5 2 0
3 20 1 0
9 10 1 0
20 21 1 0
22 23 1 0
5 1 1 0
10 11 2 0
2 3 2 0
11 12 1 0
21 22 2 0
23 24 1 0
24 25 2 0
25 21 1 0
4 6 1 0
23 26 1 0
12 13 2 0
26 27 2 0
13 8 1 0
27 28 1 0
28 29 2 0
1 14 1 0
29 30 1 0
6 7 2 0
30 31 2 0
31 26 1 0
14 15 2 0
25 32 1 0
1 2 1 0
32 33 2 0
15 16 1 0
20 34 2 0
6 8 1 0
32 35 1 0
16 17 2 0
35 36 2 0
3 4 1 0
36 37 1 0
17 18 1 0
37 38 1 0
8 9 2 0
37 39 1 0
18 19 2 0
17 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 550.02Molecular Weight (Monoisotopic): 549.1568AlogP: 5.43#Rotatable Bonds: 9Polar Surface Area: 90.09Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.34CX LogD: 6.34Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.18Np Likeness Score: -0.91
References 1. Riyadh SM, Farghaly TA, Abdallah MA, Abdalla MM, Abd El-Aziz MR.. (2010) New pyrazoles incorporating pyrazolylpyrazole moiety: synthesis, anti-HCV and antitumor activity., 45 (3): [PMID:20022411 ] [10.1016/j.ejmech.2009.11.050 ]