The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-O-Acetylbetulinyl-28-nitrile ID: ALA1086992
PubChem CID: 44606413
Max Phase: Preclinical
Molecular Formula: C32H49NO2
Molecular Weight: 479.75
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C(C)[C@@H]1CC[C@]2(C#N)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](OC(C)=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12
Standard InChI: InChI=1S/C32H49NO2/c1-20(2)22-11-16-32(19-33)18-17-30(7)23(27(22)32)9-10-25-29(6)14-13-26(35-21(3)34)28(4,5)24(29)12-15-31(25,30)8/h22-27H,1,9-18H2,2-8H3/t22-,23+,24-,25+,26-,27+,29-,30+,31+,32+/m0/s1
Standard InChI Key: UQAXAJKEWFTAND-VFUWXHBOSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
5.2861 -17.6100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2861 -18.4350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9985 -18.8475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9985 -17.1925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7108 -17.6100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7117 -18.4350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4201 -18.8485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1382 -18.4425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4286 -17.1934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1377 -17.6154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1534 -15.9651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4300 -16.3717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8677 -16.3871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8507 -17.2126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5539 -17.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2744 -17.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5827 -15.9886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2860 -16.4107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9064 -15.8740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5901 -15.1190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7709 -15.1874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7069 -16.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1277 -16.7902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8458 -18.0328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9948 -16.8207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2293 -14.5613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5000 -13.7773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4170 -14.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5764 -19.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4013 -19.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7018 -19.2600 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.4198 -18.0225 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.5740 -16.8156 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.8611 -15.5527 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.7129 -17.2332 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5669 -18.8496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8483 -18.4342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1292 -18.8488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8489 -17.6040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7 8 1 0
8 10 1 0
9 10 1 0
3 6 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 17 1 0
5 4 1 0
5 22 1 1
5 6 1 0
10 23 1 1
14 24 1 6
9 12 1 0
18 25 1 1
10 14 1 0
21 26 1 6
13 11 1 0
26 27 2 0
11 12 1 0
26 28 1 0
13 14 1 0
3 29 1 0
1 2 1 0
3 30 1 0
1 4 1 0
6 31 1 6
2 3 1 0
9 32 1 6
5 9 1 0
17 33 1 6
13 17 1 0
13 34 1 1
14 15 1 0
25 35 3 0
15 16 1 0
2 36 1 1
16 18 1 0
36 37 1 0
17 18 1 0
37 38 1 0
6 7 1 0
37 39 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.75Molecular Weight (Monoisotopic): 479.3763AlogP: 8.10#Rotatable Bonds: 2Polar Surface Area: 50.09Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.14CX LogD: 7.14Aromatic Rings: ┄Heavy Atoms: 35QED Weighted: 0.30Np Likeness Score: 2.78
References 1. Pohjala L, Alakurtti S, Ahola T, Yli-Kauhaluoma J, Tammela P.. (2009) Betulin-derived compounds as inhibitors of alphavirus replication., 72 (11): [PMID:19839605 ] [10.1021/np9003245 ]