The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
28-O-Bromoacetylbetulin ID: ALA1086993
PubChem CID: 44606586
Max Phase: Preclinical
Molecular Formula: C32H51BrO3
Molecular Weight: 563.66
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: 28-O-Bromoacetylbetulin | 28-O-Bromoacetylbetulin|SCHEMBL5449653|CHEMBL1086993
Canonical SMILES: C=C(C)[C@@H]1CC[C@]2(COC(=O)CBr)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12
Standard InChI: InChI=1S/C32H51BrO3/c1-20(2)21-10-15-32(19-36-26(35)18-33)17-16-30(6)22(27(21)32)8-9-24-29(5)13-12-25(34)28(3,4)23(29)11-14-31(24,30)7/h21-25,27,34H,1,8-19H2,2-7H3/t21-,22+,23-,24+,25-,27+,29-,30+,31+,32+/m0/s1
Standard InChI Key: CTFFJIXPQYHVER-NHQBIICYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
-5.2039 -0.5245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2039 -1.3494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4917 -1.7618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4917 -0.1069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7793 -0.5245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7786 -1.3494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0703 -1.7627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3521 -1.3567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0617 -0.1078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3526 -0.5299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3371 1.1204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0603 0.7138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6229 0.6984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6398 -0.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9366 -0.5489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2162 -0.1512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9079 1.0967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2046 0.6748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4157 1.2114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0995 1.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7197 1.8980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7832 0.3055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3626 0.2954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6446 -0.9471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5041 0.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2612 2.5238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9905 3.3079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0733 2.3708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9136 -2.4747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0888 -2.4747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7884 -2.1743 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.0704 -0.9370 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.9165 0.2698 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.6294 1.5327 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-5.9229 -1.7639 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2233 0.6792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9417 0.2636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9410 -0.5664 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6572 0.6811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3779 0.2693 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
8 10 1 0
9 10 1 0
3 6 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 17 1 0
5 4 1 0
5 22 1 1
5 6 1 0
10 23 1 1
14 24 1 6
9 12 1 0
18 25 1 1
10 14 1 0
21 26 1 6
13 11 1 0
26 27 2 0
11 12 1 0
26 28 1 0
13 14 1 0
3 29 1 0
1 2 1 0
3 30 1 0
1 4 1 0
6 31 1 6
2 3 1 0
9 32 1 6
5 9 1 0
17 33 1 6
13 17 1 0
13 34 1 1
14 15 1 0
2 35 1 1
15 16 1 0
25 36 1 0
16 18 1 0
36 37 1 0
37 39 1 0
17 18 1 0
37 38 2 0
6 7 1 0
7 8 1 0
39 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 563.66Molecular Weight (Monoisotopic): 562.3022AlogP: 7.94#Rotatable Bonds: 4Polar Surface Area: 46.53Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 2HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.33CX LogD: 7.33Aromatic Rings: ┄Heavy Atoms: 36QED Weighted: 0.21Np Likeness Score: 2.96
References 1. Pohjala L, Alakurtti S, Ahola T, Yli-Kauhaluoma J, Tammela P.. (2009) Betulin-derived compounds as inhibitors of alphavirus replication., 72 (11): [PMID:19839605 ] [10.1021/np9003245 ] 2. Tsepaeva OV, Nemtarev AV, Abdullin TI, Grigor'eva LR, Kuznetsova EV, Akhmadishina RA, Ziganshina LE, Cong HH, Mironov VF.. (2017) Design, Synthesis, and Cancer Cell Growth Inhibitory Activity of Triphenylphosphonium Derivatives of the Triterpenoid Betulin., 80 (8): [PMID:28782948 ] [10.1021/acs.jnatprod.7b00105 ]